4-Androstenediol
From Wikipedia, the free encyclopedia
(Redirected from 4-androstenediol)
| 4-Androstenediol | |
|---|---|
 |
|
| IUPAC name |
(3S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol
|
| Other names | Androst-4-ene-3β,17β-diol |
| Identifiers | |
| CAS number | 1156-92-9 |
| PubChem | 136297 |
| SMILES |
C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C[C@H](CC[C@]34C)O
|
| Properties | |
| Molecular formula | C19H30O2 |
| Molar mass | 290.44 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
4-Androstenediol is an androstenediol that is converted to testosterone. The conversion rate is about 15.76%, almost triple that of androstenedione, due to utilization of a different enzymatic pathway. There is no direct conversion to estrogen, though some secondary aromatization does occur through metabolism. 4-Androstenediol is less androgenic, since it does not metabolize into the potent androgen dihydrotestosterone (DHT).[citation needed]
4-Androstenediol is closer to testosterone structurally than 5-androstenediol, and has androgenic effects.
[edit] Medical and commercial use
Patrick Arnold holds a 1999 patent on "Use of 4-androstenediol to increase testosterone levels in humans".[1]
[edit] References
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
