Amprenavir
 |
| Systematic (IUPAC) name |
| (3S)-oxolan-3-yl N-[(2S,3R)-3-hydroxy-4-[N-(2-methylpropyl)(4-aminobenzene)sulfonamido]-1-phenylbutan-2-yl]carbamate |
| Clinical data |
| Trade names |
Agenerase |
| AHFS/Drugs.com |
monograph |
| MedlinePlus |
a699051 |
| Licence data |
EMA:Link, US FDA:link |
| Pregnancy cat. |
C (US) |
| Legal status |
? |
| Routes |
oral |
| Pharmacokinetic data |
| Protein binding |
90% |
| Metabolism |
hepatic |
| Half-life |
7.1-10.6 hours |
| Excretion |
<3% renal |
| Identifiers |
| CAS number |
161814-49-9 Y |
| ATC code |
J05AE05 |
| PubChem |
CID 65016 |
| DrugBank |
DB00701 |
| ChemSpider |
58532 Y |
| UNII |
5S0W860XNR Y |
| KEGG |
D00894 Y |
| ChEBI |
CHEBI:40050 Y |
| ChEMBL |
CHEMBL116 Y |
| NIAID ChemDB |
006080 |
| Chemical data |
| Formula |
C25H35N3O6S |
| Mol. mass |
505.628 g/mol |
- O=C(O[C@H]1CCOC1)N[C@@H](Cc2ccccc2)[C@H](O)CN(CC(C)C)S(=O)(=O)c3ccc(N)cc3
|
-
InChI=1S/C25H35N3O6S/c1-18(2)15-28(35(31,32)22-10-8-20(26)9-11-22)16-24(29)23(14-19-6-4-3-5-7-19)27-25(30)34-21-12-13-33-17-21/h3-11,18,21,23-24,29H,12-17,26H2,1-2H3,(H,27,30)/t21-,23-,24+/m0/s1 Y
Key:YMARZQAQMVYCKC-OEMFJLHTSA-N Y
|
Y (what is this?) (verify)
|
Amprenavir (Agenerase, GlaxoSmithKline) is a protease inhibitor used to treat HIV infection. It was approved by the Food and Drug Administration on April 15, 1999, for twice-a-day dosing instead of needing to be taken every eight hours. The convenient dosing came at a price, as the dose required is 1,200 mg, delivered in eight very large gel capsules.
Production of amprenavir was discontinued by the manufacturer December 31, 2004; a prodrug version (fosamprenavir) is available.
HIV-1 Protease dimer with Amprenavir (sticks) bound in the active site. PDB entry
3nu3 [1]
See also [edit]
External links [edit]