Argininosuccinic acid

Argininosuccinic acid
	IUPAC name N-[{[(4S)-4-amino-4-carboxybutyl]amino}(imino)methyl]-L-aspartic acid
Identifiers
CAS number	2387-71-5
PubChem	16950
ChemSpider	16059
Jmol-3D images	Image 1
	SMILES O=C(O)C[C@@H](C(=O)O)NC(=N/CCC[C@H](N)C(=O)O)/N ;
	InChI InChI=1S/C10H18N4O6/c11-5(8(17)18)2-1-3-13-10(12)14-6(9(19)20)4-7(15)16/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H3,12,13,14)/t5-,6-/m0/s1 ; Key: KDZOASGQNOPSCU-WDSKDSINSA-N InChI=1/C10H18N4O6/c11-5(8(17)18)2-1-3-13-10(12)14-6(9(19)20)4-7(15)16/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H3,12,13,14)/t5-,6-/m0/s1; Key: KDZOASGQNOPSCU-WDSKDSINBJ ;
Properties
Molecular formula	C10H18N4O6
Molar mass	290.27 g mol−1
	(verify) (what is: /?); Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
	Infobox references

From Wikipedia, the free encyclopedia

Jump to: navigation, search

Argininosuccinic acid is a chemical compound that is a basic amino acid.

[edit] Reactions

Some cells synthesize argininosuccinic acid from citrulline and aspartic acid and use it as a precursor for arginine in the urea cycle or citrulline-NO cycle. The enzyme that catalyzes the reaction is argininosuccinate synthetase.

Argininosuccinic acid is a precursor to fumarate in the citric acid cycle via argininosuccinate lyase.