Clevudine
 |
| Systematic (IUPAC) name |
| 1-[(2S,3R,4S,5S)-3-fluoro-4-hydroxy-5- (hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine- 2,4-dione |
| Clinical data |
| Pregnancy cat. |
? |
| Legal status |
? |
| Routes |
Oral |
| Identifiers |
| CAS number |
69256-17-3  Y |
| ATC code |
J05AF12 [1] |
| PubChem |
CID 73115 |
| ChemSpider |
65894  N |
| UNII |
IN51MVP5F1 N |
| KEGG |
D03537 Y |
| ChEMBL |
CHEMBL458875 N |
| Chemical data |
| Formula |
C10H13FN2O5 |
| Mol. mass |
260.219 g/mol |
-
InChI=1S/C10H13FN2O5/c1-4-2-13(10(17)12-8(4)16)9-6(11)7(15)5(3-14)18-9/h2,5-7,9,14-15H,3H2,1H3,(H,12,16,17)/t5-,6+,7-,9-/m0/s1 N
Key:GBBJCSTXCAQSSJ-XQXXSGGOSA-N N
|
 N (what is this?) (verify)
|
Clevudine (INN) is an antiviral drug for the treatment of hepatitis B. Clevudine is already approved for HBV in South Korea and the Philippines. It is marketed by Bukwang pharmaceuticals in South Korea under the tradenames Levovir and Revovir. Under license from Bukwang, Pharmasset was developing the drug, but its phase III clinical trial (international, multicenter, randomized, double-blind, 96 week QUASH studies) was terminated due to some myopathy cases in patients.
It is a nucleoside analog.[2]
Clevudine was approved in Korea but subsequently withdrawn due to postmarketing reports of myopathy.
References [edit]
|
|
|
| Baltimore I |
|
|
|
DNA-synthesis
inhibitor
|
|
|
|
Other
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Hepatitis B (VII) |
|
|
| Multiple/general |
|
Nucleic acid inhibitors
|
|
|
|
|
|
|
|
Multiple/unknown
|
|
|
|
|
|
|
(what is this?) (verify)
