Mereheadite
From Wikipedia, the free encyclopedia
 |
This article includes a list of references, related reading or external links, but its sources remain unclear because it lacks inline citations. Please improve this article by introducing more precise citations. (June 2011) |
| Mereheadite | |
|---|---|
| General | |
| Category | Halide |
| Chemical formula | Pb47Cl25(OH)13O24(CO3)(BO3)2 |
| Strunz classification | 03.DC.45 |
| Crystal symmetry | Monoclinic, Domatic H–M Symbol m |
| Unit cell |
a = 17.372(1) Å, b = 27.9419(19) Å, c = 10.6661(6) Å β = 93.152(5)° |
| Identification | |
| Color | Pale yellow |
| Crystal system | Monoclinic |
| Mohs scale hardness | 3½ |
| Luster | Vitreous, resinous |
| Streak | White |
| Optical properties | Biaxial |
| Refractive index | nα = 2.190 nγ = 2.280 |
| Birefringence | δ = 0.090 |
| References | [1][2][3] |
Mereheadite is a rare oxychloride that can be found with Mendipite at Merehead quarry, Cranmore, Somerset, in the United Kingdom. Most specimens are associated with Calcite, Mendipite or hydrous Cerussite in the Manganese pods on vein two. This mineral is associated with Symesite which is also light yellow to orange. Symesite is found in small blotches on the Calcites or Mendipites; Mereheadite does not, as it is most often found in veins.
[edit] References
| This article about a specific halide mineral is a stub. You can help Wikipedia by expanding it. |
