Schmiederite
From Wikipedia, the free encyclopedia
| Schmiederite | |
|---|---|
| General | |
| Category | Selenate minerals |
| Chemical formula | Pb2Cu2(Se4+O3)(Se6+O4)(OH)4 |
| Strunz classification | 07.BC.65 |
| Crystal symmetry | Monoclinic prismatic H-M symbol: (2/m) Space group: P 21/m |
| Unit cell | a = 9.92 Å, b = 5.71 Å, c = 9.36 Å; β = 101.86°; Z = 2 |
| Identification | |
| Color | Pale to deep Prussian blue |
| Crystal habit | Fibrous in radial clusters; may be in crusts; powdery |
| Crystal system | Monoclinic |
| Luster | Subadamantine to satiny |
| Streak | Light blue |
| Diaphaneity | Transparent |
| Specific gravity | 5.62 |
| Optical properties | Biaxial (+) |
| Refractive index | nα = 1.85–1.9 nβ = 1.9–1.95 nγ = 1.95–2.1 |
| References | [1][2][3] |
Schmiederite is a secondary mineral in the oxidized zone of selenium-bearing hydrothermal base metal deposits. Its chemical formula is Pb2Cu2(Se4+O3)(Se6+O4)(OH)4.[3][2]
It was first described in 1962 for an occurrence in the Cóndor mine, Los Llantenes district, Sierra de Cacheuta, La Rioja Province, Argentina (type locality). It was named for Oscar Schmieder (1891-1980), German geographer.[2]
[edit] References
| This article about a specific sulfate mineral is a stub. You can help Wikipedia by expanding it. |