Triphenyl phosphate
From Wikipedia, the free encyclopedia
| Triphenyl phosphate | |
|---|---|
3.png) |
|
 |
|
| IUPAC name |
Triphenyl phosphate
|
| Identifiers | |
| CAS number | 115-86-6 |
| PubChem | 8289 |
| SMILES |
C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3
|
| InChI |
InChI=1S/C18H15O4P/c19-23(20-16-10-4-1-5-11-16, 21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H
|
| Properties | |
| Molecular formula | C18H15O4P |
| Molar mass | 326.28 g/mol |
| Appearance | colourless liquid |
| Density | 1.184 g/mL |
| Melting point |
48-50 °C |
| Boiling point |
244 °C 10 mm Hg |
| Solubility in water | organic solvents |
| Hazards | |
| Main hazards | flammable |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
Triphenyl phosphate is the chemical compound with the formula OP(OC6H5)3. This colourless solid is the ester (triester) of phosphoric acid and phenol. It is used as a plasticizer and a fire retardant.
Triphenylphosphate is prepared by the reaction of phosphorus oxychloride and phenol in the presence of a base:
- POCl3 + 3 HOC6H5 → OP(OC6H5)3 + 3 HCl
 |
This inorganic compound-related article is a stub. You can help Wikipedia by expanding it. |
