List of carboxylic acids

From Wikipedia, the free encyclopedia
Jump to: navigation, search

Carboxylic acids are organic compounds characterized by a carboxyl (-COOH) functional group. The naming of these compounds is governed by IUPAC nomenclature, which ensures systemic and consistent naming of chemicals. Numerous organic compounds have other common names, often originating in historical use of these. It is worth noting that the IUPAC name is not always the preferred name, for example, lactic acid is a common, and also the preferred, name for what systemic rules call 2-Hydroxypropanoic acid.

This list is ordered by the number of carbon atoms in a carboxylic acid.


IUPAC name Common name Structural formula
methanoic acid formic acid HCOOH


IUPAC name Common name Structural formula
ethanoic acid acetic acid CH
ethanedioic acid oxalic acid HOOCCOOH
oxoethanoic acid glyoxylic acid
formylformic acid
2-hydroxyethanoic acid glycolic acid
dicarbonous acid
hydroxyacetic acid



IUPAC name Common name Structural formula
propanoic acid propionic acid
ethanecarboxylic acid
prop-2-enoic acid acrylic acid
acroleic acid
ethylenecarboxylic acid
propene acid
vinylformic acid
propanedioic acid malonic acid
methanedicarboxylic acid
2-oxopropanoic acid pyruvic acid
α-ketopropionic acid
acetylformic acid
pyroracemic acid
2-hydroxypropanoic acid lactic acid
milk acid


IUPAC name Common name Structural formula
butanoic acid butyric acid
propanecarboxylic acid
2-methylpropanoic acid isobutyric acid
isobutanoic acid
butanedioic acid succinic acid HOOC(CH2)2COOH
3-oxobutanoic acid acetoacetic acid CH3COCH2COOH
(E)-butenedioic acid fumaric acid
trans-1,2-ethylenedicarboxylic acid
2-butenedioic acid
trans-butenedioic acid
allomaleic acid
boletic acid
donitic acid
lichenic acid
(Z)-butenedioic acid maleic acid
cis-butenedioic acid
maleinic acid
toxilic acid
oxobutanedioic acid oxaloacetic acid
oxalacetic acid
oxosuccinic acid
hydroxybutanedioic acid malic acid
hydroxybutanedioic acid
2,3-dihydroxybutanedioic acid tartaric acid
2,3-dihydroxysuccinic acid
threaric acid
racemic acid
uvic acid
paratartaric acid
(E)-but-2-enoic acid crotonic acid
trans-2-butenoic acid
beta-methylacrylic acid
3-methylacrylic acid
(E)-2-butenoic acid


IUPAC name Common name Structural formula
pentanoic acid valeric acid
valerianic acid
butane-1-carboxylic acid
pentanedioic acid glutaric acid
propane-1,3-dicarboxylic acid
1,3-propanedicarboxylic acid
n-pyrotartaric acid
2-oxopentanedioic acid alpha-Ketoglutaric acid
2-ketoglutaric acid
α-ketoglutaric acid
2-oxoglutaric acid
oxoglutaric acid


IUPAC name Common name Structural formula
hexanoic acid caproic acid
n-caproic acid
hexanedioic acid adipic acid
hexane-1,6-dioic acid
2-hydroxypropane-1,2,3-tricarboxylic acid citric acid
3-carboxy-3-hydroxypentanedioic acid
2-hydroxy-1,2,3-propanetricarboxylic acid
prop-1-ene-1,2,3-tricarboxylic acid aconitic acid
achilleic acid
equisetic acid
citridinic acid
pyrocitric acid
1-hydroxypropane-1,2,3-tricarboxylic acid isocitric acid HOOCCHOHCH(COOH)CH2COOH
(2E,4E)-hexa-2,4-dienoic acid sorbic acid CH3(CH=CH)2COOH


IUPAC name Common name Structural Formula
heptanoic acid enanthic acid
oenanthic acid
n-Heptylic acid
n-Heptoic acid
heptanedioic acid pimelic acid HOOC(CH2)5COOH
cyclohexanecarboxylic acid C
benzenecarboxylic acid benzoic acid
dracylic acid
2-hydroxybenzoic acid salicylic acid HOC


IUPAC name Common name Structural Formula
octanoic acid caprylic acid CH3(CH2)6COOH
benzene-1,2-dicarboxylic acid Phthalic acid C6H4(COOH)2


IUPAC name Common name Structural Formula
nonanoic acid pelargonic acid
1-octanecarboxylic acid
benzene-1,3,5-tricarboxylic acid trimesic acid C
(E)-3-phenylprop-2-enoic acid cinnamic acid
trans-cinnamic acid
phenylacrylic acid
cinnamylic acid
3-phenylacrylic acid
(E)-cinnamic acid
benzenepropenoic acid
isocinnamic acid


IUPAC name Common name Structural Formula
decanedioic acid sebacic acid
1,8-octanedicarboxylic acid


IUPAC name Common name Structural Formula
undecanoic acid hendecanoic acid CH3(CH2)9COOH


IUPAC name Common name Structural Formula
dodecanoic acid lauric acid
dodecylic acid
dodecoic acid
laurostearic acid
fulvic acid
1-undecanecarboxylic acid
duodecylic acid
benzene-1,2,3,4,5,6-hexacarboxylic acid mellitic acid
graphitic acid
benzenehexacarboxylic acid


IUPAC name Common name Structural Formula
tridecanoic acid tridecylic acid CH3(CH2)11COOH


IUPAC name Common name Structural Formula
tetradecanoic acid myristic acid CH3(CH2)12COOH


IUPAC name Common name Structural Formula
pentadecanoic acid pentadecylic acid CH3(CH2)13COOH


IUPAC name Common name Structural Formula
hexadecanoic acid palmitic acid CH3(CH2)14COOH


IUPAC name Common name Structural Formula
heptadecanoic acid margaric acid
heptadecylic acid


IUPAC name Common name Structural Formula
octadecanoic acid stearic acid CH3(CH2)16COOH
(9Z)-octadec-9-enoic acid oleic acid
(9Z)-octadecenoic acid
(Z)-octadec-9-enoic acid
cis-9-octadecenoic acid
cis9-octadecenoic acid
(9Z,12Z)-octadeca-9,12-dienoic acid linoleic acid CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH
(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid ALA
α-linolenic acid
cis, cis,cis-9,12,15-octadecatrienoic acid
(Z,Z,Z)-9,12,15-octadecatrienoic acid
(6Z,9Z,12Z)-octadeca-6,9,12-trienoic acid GLA
γ-linolenic acid
gamolenic acid
(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid SDA
stearidonic acid
moroctic acid


IUPAC name Common name Structural Formula
nonadecanoic acid nonadecylic acid CH3(CH2)17COOH


IUPAC name Common name Structural Formula
eicosanoic acid arachidic acid
eicosanoic acid
arachic acid
(5Z,8Z,11Z)-eicosa-5,8,11-trienoic acid Mead's acid CH3(CH2)7CH=CHCH2CH=CHCH2CH=CH(CH2)3COOH
(5Z,8Z,11Z,14Z)-eicosa-5,8,11,14-tetraenoic acid AA
arachidonic acid


IUPAC name Common name Structural Formula
heneicosanoic acid CH3(CH2)19COOH


IUPAC name Common name Structural Formula
docosanoic acid behenic acid CH3(CH2)20COOH
(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoic acid DHA
cervonic acid


IUPAC name Common name Structural formula
tricosanoic acid tricosylic acid CH3(CH2)21COOH


IUPAC name Common name Structural formula
tetracosanoic acid lignoceric acid CH3(CH2)22COOH


IUPAC name Common name Structural formula
pentacosanoic acid pentacosylic acid CH3(CH2)23COOH


IUPAC name Common name Structural formula
hexacosanoic acid cerotic acid CH3(CH2)24COOH