Neoconvalloside: Difference between revisions
Content deleted Content added
mNo edit summary |
chembox data; reference |
||
| Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| Name = Neoconvalloside |
| Name = Neoconvalloside |
||
| ImageFile = |
| ImageFile = Neoconvalloside.png |
||
| IUPACName_hidden = yes |
| IUPACName_hidden = yes |
||
| IUPACName = (3''S'',5''S'',8''R'',9''S'',10''S'',13''R'',14''S'',17''R'')-5,14-dihydroxy-13-methyl-17-(5-oxo-2,5-dihydrofuran-3-yl)-3-(((2''R'',3''R'',4''R'',5''R'',6''R'')-4,5,6-trihydroxy-3-(((2''S'',3''R'',4''S'',5''S'',6''R'')-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2''H''-pyran-2-yl)oxy)tetrahydro-2''H''-pyran-2-yl)oxy)hexadecahydro-1''H''-cyclopenta[a]phenanthrene-10-carbaldehyde |
|||
| |
| OtherNames = Strophanthidin 3-''O''-[β-<small>D</small>-glucopyranosyl-(1→2)-α-<small>L</small>-rhamnopyranoside] |
||
| OtherNames = |
|||
| Reference = <ref>{{cite book | title = Spectroscopic Data of Steroid Glycosides: Cardenolides and Pregnanes |
|||
| Reference = <ref>http://www.springerlink.com/content/xm95443974240l58/</ref> |
|||
| volume = 4 | author = Viqar Uddin Ahmad and Anwer Basha | year = 2006 | doi = 10.1007/978-0-387-39576-0_386 | isbn = 978-0-387-31162-3 | url = http://www.springerlink.com/content/xm95443974240l58/}}</ref> |
|||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| CASNo = 83841-55-8 |
| CASNo = 83841-55-8 |
||
| SMILES = C[C@@]12[C@@](CC[C@@H]2C3=CC(OC3)=O)(O)[C@]4([H])CC[C@]5(O)C[C@@H](O[C@]6([H])O[C@@H](O)[C@H](O)[C@@H](O)[C@H]6O[C@]7([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)CC[C@]5(C=O)[C@@]4([H])CC1 |
|||
| PubChem = |
| PubChem = |
||
| EINECS = |
| EINECS = |
||
| InChI = }} |
| InChI = }} |
||
| Section2 = {{Chembox Properties |
| Section2 = {{Chembox Properties |
||
| MeltingPt = 162-170 °C |
|||
| BoilingPt = |
| BoilingPt = |
||
| Density = |
| Density = |
||
| |
| C=32|H=52|O=15 |
||
| MolarMass = |
|||
| Appearance = |
| Appearance = |
||
| VaporPressure = }} |
| VaporPressure = }} |
||
| Line 24: | Line 26: | ||
}} |
}} |
||
'''Neoconvalloside''' is a [[cardenolide]] [[glycoside]] extracted from [[Convallaria majalis]]. |
'''Neoconvalloside''' is a [[cardenolide]] [[glycoside]] extracted from ''[[Convallaria majalis]]''.<ref>{{Cite journal | author = Komissarenko, N. F.; Stupakova, E. P. | title = Neoconvalloside - a cardenolide glycoside from plants of the genus Convallaria | journal = Khimiya Prirodnykh Soedinenii | year = 1986 | issue = 2 | pages = 201-204}}</ref> |
||
==References== |
==References== |
||
{{reflist}} |
{{reflist}} |
||
{{organic-compound-stub}} |
{{organic-compound-stub}} |
||
[[Category:Cardiac glycosides]] |
[[Category:Cardiac glycosides]] |
||
[[Category:Cardenolides]] |
[[Category:Cardenolides]] |
||
Revision as of 19:11, 14 May 2010
| |
| Names | |
|---|---|
| IUPAC name
(3S,5S,8R,9S,10S,13R,14S,17R)-5,14-dihydroxy-13-methyl-17-(5-oxo-2,5-dihydrofuran-3-yl)-3-(((2R,3R,4R,5R,6R)-4,5,6-trihydroxy-3-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)oxy)hexadecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde
| |
| Other names
Strophanthidin 3-O-[β-D-glucopyranosyl-(1→2)-α-L-rhamnopyranoside]
| |
| Identifiers | |
3D model (JSmol)
|
|
CompTox Dashboard (EPA)
|
|
| |
| Properties | |
| C32H52O15 | |
| Molar mass | 676.753 g·mol−1 |
| Melting point | 162-170 °C |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Neoconvalloside is a cardenolide glycoside extracted from Convallaria majalis.[2]
References
- ^ Viqar Uddin Ahmad and Anwer Basha (2006). Spectroscopic Data of Steroid Glycosides: Cardenolides and Pregnanes. Vol. 4. doi:10.1007/978-0-387-39576-0_386. ISBN 978-0-387-31162-3.
- ^ Komissarenko, N. F.; Stupakova, E. P. (1986). "Neoconvalloside - a cardenolide glycoside from plants of the genus Convallaria". Khimiya Prirodnykh Soedinenii (2): 201–204.
{{cite journal}}: CS1 maint: multiple names: authors list (link)
 | This article about an organic compound is a stub. You can help Wikipedia by expanding it. |