Liriodendrin: Difference between revisions
Content deleted Content added
data |
No edit summary |
||
| Line 1: | Line 1: | ||
{{Chembox |
{{Chembox |
||
| ImageFile = Liriodendrin.svg |
| ImageFile = Liriodendrin.svg |
||
| ImageSize = |
| ImageSize = 250px |
||
| ImageAlt = |
| ImageAlt = |
||
| IUPACName = ( |
| IUPACName = (2''S'',3''R'',4''S'',5''S'',6''R'')-2-[4-[6-[3,5-Dimethoxy-4-[(2''S'',3''R'',4''S'',5''S'',6''R'')-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-''c'']furan-3-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
||
| OtherNames = |
| OtherNames = |
||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| Line 10: | Line 10: | ||
| SMILES = COC1=CC(=CC(=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC)C3C4COC(C4CO3)C5=CC(=C(C(=C5)OC)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)OC}} |
| SMILES = COC1=CC(=CC(=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC)C3C4COC(C4CO3)C5=CC(=C(C(=C5)OC)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)OC}} |
||
| Section2 = {{Chembox Properties |
| Section2 = {{Chembox Properties |
||
| |
| C=34|H=46|O=18 |
||
| MolarMass = 742.72 g/mol |
|||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = |
||
| Line 23: | Line 22: | ||
}} |
}} |
||
'''Liriodendrin''' is an antiarrhythmic [[lignan]] isolated from ''[[Pittosporum]]''. |
'''Liriodendrin''' is an antiarrhythmic [[lignan]] isolated from ''[[Pittosporum]]''.<ref>{{cite journal|pmid=21191756}}</ref> |
||
== |
==References== |
||
{[reflist}} |
|||
* [http://www.ncbi.nlm.nih.gov/pubmed/21191756 A new triterpene and an antiarrhythmic liriodendrin from Pittosporum brevicalyx] |
|||
{{organic- |
{{organic-compound-stub}} |
||
[[Category:Lignans]] |
|||
Revision as of 14:35, 28 October 2013
| |
| Names | |
|---|---|
| IUPAC name
(2S,3R,4S,5S,6R)-2-[4-[6-[3,5-Dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
| |
| Identifiers | |
3D model (JSmol)
|
|
PubChem CID
|
|
| |
| Properties | |
| C34H46O18 | |
| Molar mass | 742.724 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Liriodendrin is an antiarrhythmic lignan isolated from Pittosporum.[1]
References
{[reflist}}
 | This article about an organic compound is a stub. You can help Wikipedia by expanding it. |