Jump to content

1,6-Methano(10)annulene: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
corrections / tweaks
restructure and expand
Line 32: Line 32:
}}
}}


'''1,6-Methano[10]annulene''' , '''1,6-methanonaphthalene''' or '''homonaphthalene''' is a [[hydrocarbon]] with [[chemical formula]] C<sub>11</sub>H<sub>12</sub>.
'''1,6-Methano[10]annulene''' , '''1,6-methanonaphthalene''' or '''homonaphthalene''' is an [[aromatic hydrocarbon]] with [[chemical formula]] C<sub>11</sub>H<sub>12</sub>, and was the first stable aromatic based on the [[cyclodecapentaene]] system to be discovered.

It is analogous to [[cyclodecapentaene]] ([''10'']annulene), but with two hydrogen atoms replaced by a transannular [[methylene bridge]] (-{{chem|CH|2}}-). This compound is aromatic as judged from lack in [[bond length]] alternation by [[x-ray crystallography]] and a telltale [[diamagnetic ring current]] from [[proton nuclear magnetic resonance|<sup>1</sup>H NMR spectroscopy]]. According to ''[[Organic Syntheses]]'', it can be prepared from [[naphthalene]].<ref>{{OrgSynth|title = 1,6-Methano[''10'']annulene|collvol = 6|collvolpages = 731|volume = 54|pages = 11|doi = 10.15227/orgsyn.054.0011|first1 = E.|last1 = Vogel|first2 = W.|last2 = Klug|first3 = A.|last3 = Breuer|url = http://www.orgsyn.org/demo.aspx?prep=cv6p0731}}</ref>


== Preparation ==
According to ''[[Organic Syntheses]]'', it can be prepared from [[naphthalene]].<ref name = OrgSynth />
[[File:Methanonaphtalene.gif|thumb|center|657px|Synthetic route to 1,6-methano[''10'']annulene]]
[[File:Methanonaphtalene.gif|thumb|center|657px|Synthetic route to 1,6-methano[''10'']annulene]]


== Aromaticity ==
Its resonance energy is smaller than that of [[naphthalene]].<ref>{{cite journal | last1 = Roth | first1 = Wolfgang R. | first2 = Manfred | last2 = Böhm |title = Resonance Energy of Bridged [''10'']Annulene | journal = [[Angewandte Chemie International Edition]] | year = 1983 | volume = 22| issue = 12 | pages = 1007–1008 | doi = 10.1002/anie.198310071}}</ref>
It is analogous to [[cyclodecapentaene]] ([''10'']annulene), but with two hydrogen atoms replaced by a transannular [[methylene bridge]] (-{{chem|CH|2}}-). Consequently, it obeys [[Hückel's rule]] (''n''&nbsp;=&nbsp;2) and despite the distortion from planarity introduced by the methylene bridge, the compound is [[aromatic compound|aromatic]].<ref name = Gatti /><ref name = Hill /> In fact, when prepared by Vogel in the 1960s<ref name = Vogel1 /><ref name = Vogel2 /> it was the first stable aromatic cyclodecapentaene to be discovered.<ref name = Hill /> Its [[aromaticity]] is confirmed by three main pieces of evidence. Firstly, the similarity in carbon-carbon [[bond length]]s as measured by [[x-ray crystallography]] is inconsistent with alternating [[single bond|single]] and [[double bond]]s. The actual structure is better considered as a pair of [[resonance hybrid]]s (like the [[benzene#Structure|Kekulé structures of benzene]]) rather than as having alternating single and double bonds.

Secondly, its [[proton nuclear magnetic resonance|<sup>1</sup>H NMR spectrum]] displays influence of the [[diamagnetic ring current]] which is characteristic of aromatic compounds. The peripheral protons around the ring are [[chemical shift|deshielded]] while the methylene bridge nuclei are strongly shielded.<ref name = Gatti /><ref name = Hill />

Its resonance energy is smaller than that of [[naphthalene]].<ref name = Roth />


== See also ==
== See also ==
Line 46: Line 51:


== References ==
== References ==
{{Reflist|refs=
{{reflist}}

<ref name = Gatti>{{cite book|title = Applications of Topological Methods in Molecular Chemistry|editor1-first = Remi|editor1-last = Chauvin|editor2-first = Christine|editor2-last = Lepetit|editor3-first = Bernard|editor3-last = Silvi|editor4-first = Esmail|editor4-last = Alikhani|publisher = [[Springer International Publishing]]|year = 2016|isbn = 9783319290225|volume = 22|series = Challenges and Advances in Computational Chemistry and Physics|first1 = Carlo|last1 = Gatti|first2 = Ahmed M.|last2 = Orlando|first3 = Emanuele|last3 = Monza|first4 = Leonardo|last4 = Lo Presti|doi = 10.1007/978-3-319-29022-5_5|pages = 101-129|chapter = Exploring Chemistry Through the Source Function for the Electron and the Electron Spin Densities}}</ref>

<ref name = Hill>{{cite journal|title = Forfeiture of the aromaticity of a bridged [''10'']annulene by benzannelation|first1 = Richard K.|last1 = Hill|first2 = Carolyn B.|last2 = Giberson|first3 = James V.|last3 = Silverton|journal = [[J. Am. Chem. Soc.]]|year = 1988|volume = 110|issue = 2|pages = 497–500|doi = 10.1021/ja00210a031}}</ref>

<ref name = OrgSynth>{{OrgSynth|title = 1,6-Methano[''10'']annulene|collvol = 6|collvolpages = 731|volume = 54|pages = 11|doi = 10.15227/orgsyn.054.0011|first1 = Emanuel|last1 = Vogel|first2 = W.|last2 = Klug|first3 = A.|last3 = Breuer|url = http://www.orgsyn.org/demo.aspx?prep=cv6p0731}}</ref>

<ref name = Roth>{{cite journal|last1 = Roth|first1 = Wolfgang R.|first2 = Manfred|last2 = Böhm|title = Resonance Energy of Bridged [''10'']Annulene|journal = [[Angew. Chem. Int. Ed.]]|year = 1983|volume = 22|issue = 12|pages = 1007–1008|doi = 10.1002/anie.198310071}}</ref>

<ref name = Vogel1>{{cite journal|last1 = Vogel|first1 = Emanuel|first2 = H. D.|last2 = Roth|title = The Cyclodecapentaene System|journal = [[Angew. Chem. Int. Ed.]]|year = 1964|volume = 3|issue = 3|pages = 228-229|doi = 10.1002/anie.196402282}}</ref>

<ref name = Vogel2>{{cite journal|last1 = Vogel|first1 = Emanuel|first2 = W. A.|last2 = Böll|journal = [[Angew. Chem. Int. Ed.]]|title = Substitution of 1,6-Methanocyclodecapentaene|year = 1964|volume = 3|issue = 9|page = 642|doi = 10.1002/anie.196406421}}</ref>
}}


{{DEFAULTSORT:Methanoannulene, 1,6-}}
{{DEFAULTSORT:Methanoannulene, 1,6-}}

Revision as of 14:55, 23 June 2017

1,6-Methano[10]annulene
Names
IUPAC name
Bicyclo[4.4.1]undeca-1,3,5,7,9-pentaene
Identifiers
3D model (JSmol)
ChemSpider
  • InChI=1S/C11H10/c1-2-6-11-8-4-3-7-10(5-1)9-11/h1-8H,9H2
    Key: OORRQYZWSVJKSO-UHFFFAOYSA-N
  • InChI=1/C11H10/c1-2-6-11-8-4-3-7-10(5-1)9-11/h1-8H,9H2
    Key: OORRQYZWSVJKSO-UHFFFAOYAC
  • c1ccc2ccccc(c1)C2
Properties
C11H12
Molar mass 144.217 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).

1,6-Methano[10]annulene , 1,6-methanonaphthalene or homonaphthalene is an aromatic hydrocarbon with chemical formula C11H12, and was the first stable aromatic based on the cyclodecapentaene system to be discovered.

Preparation

According to Organic Syntheses, it can be prepared from naphthalene.[1]

Synthetic route to 1,6-methano[10]annulene

Aromaticity

It is analogous to cyclodecapentaene ([10]annulene), but with two hydrogen atoms replaced by a transannular methylene bridge (-CH
2
-). Consequently, it obeys Hückel's rule (n = 2) and despite the distortion from planarity introduced by the methylene bridge, the compound is aromatic.[2][3] In fact, when prepared by Vogel in the 1960s[4][5] it was the first stable aromatic cyclodecapentaene to be discovered.[3] Its aromaticity is confirmed by three main pieces of evidence. Firstly, the similarity in carbon-carbon bond lengths as measured by x-ray crystallography is inconsistent with alternating single and double bonds. The actual structure is better considered as a pair of resonance hybrids (like the Kekulé structures of benzene) rather than as having alternating single and double bonds.

Secondly, its 1H NMR spectrum displays influence of the diamagnetic ring current which is characteristic of aromatic compounds. The peripheral protons around the ring are deshielded while the methylene bridge nuclei are strongly shielded.[2][3]

Its resonance energy is smaller than that of naphthalene.[6]

See also

References

  1. ^ Vogel, Emanuel; Klug, W.; Breuer, A. "1,6-Methano[10]annulene". Organic Syntheses. 54: 11. doi:10.15227/orgsyn.054.0011; Collected Volumes, vol. 6, p. 731.
  2. ^ a b Gatti, Carlo; Orlando, Ahmed M.; Monza, Emanuele; Lo Presti, Leonardo (2016). "Exploring Chemistry Through the Source Function for the Electron and the Electron Spin Densities". In Chauvin, Remi; Lepetit, Christine; Silvi, Bernard; Alikhani, Esmail (eds.). Applications of Topological Methods in Molecular Chemistry. Challenges and Advances in Computational Chemistry and Physics. Vol. 22. Springer International Publishing. pp. 101–129. doi:10.1007/978-3-319-29022-5_5. ISBN 9783319290225.
  3. ^ a b c Hill, Richard K.; Giberson, Carolyn B.; Silverton, James V. (1988). "Forfeiture of the aromaticity of a bridged [10]annulene by benzannelation". J. Am. Chem. Soc. 110 (2): 497–500. doi:10.1021/ja00210a031.
  4. ^ Vogel, Emanuel; Roth, H. D. (1964). "The Cyclodecapentaene System". Angew. Chem. Int. Ed. 3 (3): 228–229. doi:10.1002/anie.196402282.
  5. ^ Vogel, Emanuel; Böll, W. A. (1964). "Substitution of 1,6-Methanocyclodecapentaene". Angew. Chem. Int. Ed. 3 (9): 642. doi:10.1002/anie.196406421.
  6. ^ Roth, Wolfgang R.; Böhm, Manfred (1983). "Resonance Energy of Bridged [10]Annulene". Angew. Chem. Int. Ed. 22 (12): 1007–1008. doi:10.1002/anie.198310071.