Evariquinone: Difference between revisions
Content deleted Content added
KolbertBot (talk | contribs) m Bot: HTTP→HTTPS (v475) |
chembox and data added; ref added |
||
| Line 1: | Line 1: | ||
{{Chembox |
|||
[[image:Evariquinone.png|thumb|Evariquinone]] |
|||
<!-- Images --> |
|||
| ImageFile = Evariquinone.svg |
|||
'''Evariquinone''' is a bio-active isolate of sponge-derived ''Emericella variecolor''. |
|||
| ImageSize = 200px |
|||
<!-- Names --> |
|||
==External links== |
|||
| IUPACName = 1,2,3-Trihydroxy-8-methoxy-6-methyl-9,10-anthraquinone |
|||
*[https://www.ncbi.nlm.nih.gov/pubmed/12770594 Evariquinone, isoemericellin, and stromemycin from a sponge derived strain of the fungus Emericella variecolor] |
|||
| OtherNames = |
|||
*[http://www.chemspider.com/Chemical-Structure.9273742.html?rid=c487e502-44b4-4b4c-b55f-d91c4340dec8 ChemSpider - Evariquinone] |
|||
<!-- Sections --> |
|||
| Section1 = {{Chembox Identifiers |
|||
| CASNo = 594860-23-8 |
|||
| PubChem = |
|||
| ChemSpiderID = 9273742 |
|||
| SMILES = COC1=C2C(=O)C3=C(O)C(O)=C(O)C=C3C(=O)C2=CC(C)=C1 |
|||
}} |
|||
| Section2 = {{Chembox Properties |
|||
| C=16|H=12|O=6 |
|||
| Appearance = |
|||
| Density = |
|||
| MeltingPt = |
|||
| BoilingPt = |
|||
| Solubility = |
|||
}} |
|||
| Section3 = {{Chembox Hazards |
|||
| MainHazards = |
|||
| FlashPt = |
|||
| AutoignitionPt = |
|||
}} |
|||
}} |
|||
'''Evariquinone''' is a chemical compound of the [[anthraquinone]] class which has been isolated from a sponge-derived strain of the fungus ''[[Emericella variecolor]]''<ref>{{Cite journal | doi = 10.1016/s0031-9422(03)00189-4 }}</ref> and from ''[[Aspergillus versicolor]]''.<ref>{{Cite journal | doi = 10.1007/s12272-012-1006-x }}</ref> |
|||
==References== |
|||
{{reflist}} |
|||
[[Category:Trihydroxyanthraquinones]] |
[[Category:Trihydroxyanthraquinones]] |
||
| Line 13: | Line 37: | ||
{{organic- |
{{organic-compound-stub}} |
||
Revision as of 16:39, 4 October 2019
| |
| Names | |
|---|---|
| IUPAC name
1,2,3-Trihydroxy-8-methoxy-6-methyl-9,10-anthraquinone
| |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
| |
| Properties | |
| C16H12O6 | |
| Molar mass | 300.266 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Evariquinone is a chemical compound of the anthraquinone class which has been isolated from a sponge-derived strain of the fungus Emericella variecolor[1] and from Aspergillus versicolor.[2]
References
- ^ . doi:10.1016/s0031-9422(03)00189-4.
{{cite journal}}: Cite journal requires|journal=(help); Missing or empty|title=(help) - ^ . doi:10.1007/s12272-012-1006-x.
{{cite journal}}: Cite journal requires|journal=(help); Missing or empty|title=(help)
 | This article about an organic compound is a stub. You can help Wikipedia by expanding it. |