Carperidine: Difference between revisions
Content deleted Content added
←Created page with '{{drugbox | drug_name = Carperidine | image = Carperidine.png | legal_UK = | legal_DE = | C = 17 | H = 24 | N = 2 | O = 3 | IUPAC_name = ethyl 1-(3-amino-3-oxopropyl)-4-phenylpiperidine-4-carboxylate | CAS_number = 7528-13-4 | CAS_number_Ref = {{cascite|correct|CAS}} | ChEMBL = | ChemSpiderID = | PubChem = 24149 | UNII = | smiles = CCOC(=O)C1(CCN(CC1)CCC(=O)N)C2=CC=CC=C2 | StdInChI = 1S/C17H24N2O3/c1-2-22-16(21)17(14-6-4-3-5-7-1...' |
(No difference)
|
Revision as of 01:23, 28 December 2021
 | |
| Identifiers | |
|---|---|
| |
| CAS Number | |
| PubChem CID | |
| CompTox Dashboard (EPA) | |
| Chemical and physical data | |
| Formula | C17H24N2O3 |
| Molar mass | 304.390 g·mol−1 |
| 3D model (JSmol) | |
| |
| |
Carperidine is an opioid analgesic drug related to meperidine. It has analgesic and antitussive effects with similar potency to codeine, though several related compounds are significantly more potent.[1][2][3]
See also
References
- ^ Aram M. 4-aryl-1-carbamylalkyl-piperidines. US Patent 3117139A, granted 7 January 1964
- ^ List P.H., Hürhammer L. (1973) C. In: Sachverzeichnis für die Bände I–III, VIIA. pp 56-82. Hagers Handbuch der Pharmazeutischen Praxis (Für Apotheker · Arzneimittelhersteller Ärzte und Medizinalbeamte), vol 1,2,3,7A. Springer, Berlin, Heidelberg. doi:10.1007/978-3-642-67660-4_3
- ^ Richards GC. The Oxford Catalogue of Opioids: A systematic synthesis of opioid drug names and their pharmacology. British Journal of Clinical Pharmacology. 2021; 87(10):3790-3812. doi:10.1111/bcp.14786
 | This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |