View source for Prazitone

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 449584977
| IUPAC_name = 5-phenyl-5-(piperidin-2-ylmethyl)pyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione
| image = Prazitone.png
| width = 200

<!--Clinical data-->
| tradename =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 2409-26-9
| ATC_prefix = none
| ATC_suffix =  
| PubChem = 3050417
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6DZB018428
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 2312482
| synonyms = AGN-511; 5-Phenyl-5-(2-piperidylmethyl)barbituric acid

<!--Chemical data-->
| C = 16 | H = 19 | N = 3 | O = 3 
| SMILES = C1CCNC(C1)CC2(C(=O)NC(=O)NC2=O)C3=CC=CC=C3
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C16H19N3O3/c20-13-16(11-6-2-1-3-7-11,14(21)19-15(22)18-13)10-12-8-4-5-9-17-12/h1-3,6-7,12,17H,4-5,8-10H2,(H2,18,19,20,21,22)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = UGZAKKMLMJITLL-UHFFFAOYSA-N
}}

'''Prazitone''' ({{Abbrlink|INN|International Nonproprietary Name}}, {{Abbrlink|BAN|British Approved Name}}; developmental code name '''AGN-511''') is a [[barbiturate]] [[chemical derivative|derivative]] described as an [[antidepressant]] which was developed in the 1960s.<ref name="Elks2014">{{cite book | last=Elks | first=J. | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA1011 | access-date=20 October 2024 | page=1011}}</ref><ref>DE Patent 1645911</ref> Unlike most barbiturates, it has little or no [[sedative]] effects, instead acting as a non-sedating [[anxiolytic]] and antidepressant.<ref>[https://patents.google.com/patent/US3806596 Ross Langlands. Method for imparting anti-depressant and/or anxiolytic effects to animals. US Patent 3,806,596]</ref><ref name="Elks2014" /> The dosage range in humans is around 200–600&nbsp;mg, although higher doses have been used in trials for the treatment of [[depression (mood)|depression]] associated with [[Parkinson's disease]].{{Citation needed|date=October 2024}}

== References ==
{{Reflist}}

{{Antidepressants}}
{{Anxiolytics}}
{{Barbiturates}}

[[Category:Abandoned drugs]]
[[Category:Antidepressants]]
[[Category:Anxiolytics]]
[[Category:Barbiturates]]
[[Category:Piperidines]]
[[Category:Pyrimidines]]


{{Anxiolytic-stub}}