Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Α-Viniferin: Difference between pages

{{lowercase title}}

| Watchedfields = changed

| verifiedrevid = 477319821

| Name = α-Viniferin

| Reference =

| ImageFile = Alpha-viniferin.svg

| ImageSize = 200px

| PIN = (1''R'',5b''R'',6''R'',10b''S'',11''S'',15b''R'')-1,6,11-Tris(4-hydroxyphenyl)-1,5b,6,10b,11,15b-hexahydrocyclonona[1,2,3-''cd'':4,5,6-''c''′''d''′:7,8,9-''c''′′''d''′′]tris([1]benzofuran)-4,9,14-triol

| OtherNames = α-Viniferin; (+)-α-Viniferin

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 333272

| StdInChI = 1S/C42H30O9/c43-22-7-1-19(2-8-22)40-37-28-13-25(46)17-32-35(28)39(42(50-32)21-5-11-24(45)12-6-21)30-15-27(48)18-33-36(30)38(29-14-26(47)16-31(49-40)34(29)37)41(51-33)20-3-9-23(44)10-4-20/h1-18,37-48H

| StdInChIKey = KUTVNHOAKHJJFL-UHFFFAOYSA-N

| CASNo = 62218-13-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 53XER6FHLX

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 66359

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| SMILES = OC(C=C1)=CC=C1[C@@H]2[C@@H](C3=C4C(O[C@@H](C5=CC=C(O)C=C5)[C@@H]4C6=C([C@@H]7[C@H](C8=CC=C(O)C=C8)O9)C9=CC(O)=C6)=CC(O)=C3)C%10=C7C=C(O)C=C%10O2

|Section2={{Chembox Properties

| C=42 | H=30 | O=9

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

'''α-Viniferin''' is a stilbene [[trimer (chemistry)|trimer]]. It can be isolated from ''[[Caragana chamlagu]]''<ref name="Sang">{{cite journal | doi = 10.1248/bpb.25.125 | title = (+)-α-Viniferin, a Stilbene Trimer from Caragana chamlague, Inhibits Acetylcholinesterase | year = 2002 | last1 = Sung | first1 = Sang Hyun | last2 = Kang | first2 = So Young | last3 = Lee | first3 = Ki Yong | last4 = Park | first4 = Mi Jung | last5 = Kim | first5 = Jeong Hun | last6 = Park | first6 = Jong Hee | last7 = Kim | first7 = Young Chul | last8 = Kim | first8 = Jinwoong | last9 = Kim | first9 = Young Choong | journal = Biological & Pharmaceutical Bulletin | volume = 25 | issue = 1 | pages = 125–127| pmid = 11824541 | doi-access = free }}</ref> and from ''[[Caragana sinica]]''<ref name="Shu">{{cite journal | pmid = 16595888 | year = 2006 | last1 = Shu | first1 = N | last2 = Zhou | first2 = H | last3 = Hu | first3 = C | title = Simultaneous determination of the contents of three stilbene oligomers in Caragana sinica collected in different seasons using an improved HPLC method | volume = 29 | issue = 4 | pages = 608–12 | journal = Biological & Pharmaceutical Bulletin | doi=10.1248/bpb.29.608| doi-access = free }}</ref> and from the stem bark of ''[[Dryobalanops aromatica]]''.<ref>{{Cite journal|pmid=21338657|doi=10.1016/j.fitote.2011.02.006|title=Malaysianol A, a new trimer resveratrol oligomer from the stem bark of Dryobalanops aromatica|year=2011|last1=Wibowo|first1=A.|last2=Ahmat|first2=N.|last3=Hamzah|first3=A.S.|last4=Sufian|first4=A.S.|last5=Ismail|first5=N.H.|last6=Ahmad|first6=R.|last7=Jaafar|first7=F.M.|last8=Takayama|first8=H.|journal=Fitoterapia|volume=82|issue=4|pages=676–81}}</ref> It is also present in relation to resistance to ''[[Botrytis cinerea]]'' and ''[[Plasmopara viticola]]'' in ''[[Vitis vinifera]]'' and ''[[Vitis riparia]]''.<ref>Disease resistance of Vitis spp. and the production of the stress metabolites resveratrol, epsilon -viniferin, alpha -viniferin and pterostilbene. Langcake P, Physiological Plant Pathology, 1981, Vol. 18, No. 2, pages 213-226 ([http://www.cabdirect.org/abstracts/19811698041.html;jsessionid=53F909297760080793211FD6C4B32445 abstract] {{Webarchive|url=https://web.archive.org/web/20141210021426/http://www.cabdirect.org/abstracts/19811698041.html;jsessionid=53F909297760080793211FD6C4B32445 |date=2014-12-10 }})</ref> It has been shown to inhibit [[acetylcholinesterase]].<ref name="Sang"/>

== References ==

{{reflist}}

{{Acetylcholine metabolism and transport modulators}}

{{Oligostilbenoid}}

{{DEFAULTSORT:Viniferin, alpha-}}

[[Category:Resveratrol oligomers]]

[[Category:Acetylcholinesterase inhibitors]]

{{Aromatic-stub}}