Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 1,2,3-Trimethylbenzene: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 443243242 of page 1,2,3-Trimethylbenzene for the Chem/Drugbox validation project (updated: '').
 
Citation bot (talk | contribs)
Misc citation tidying. | Use this bot. Report bugs. | Suggested by AManWithNoPlan | #UCB_CommandLine
 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:1,2,3-Trimethylbenzene|oldid=443243242}} 443243242] of page [[1,2,3-Trimethylbenzene]] with values updated to verified values.}}
{{Chembox
{{Chembox
| Watchedfields = changed
| verifiedrevid = 443241783
| verifiedrevid = 477202533
| ImageFileL1 = Hemellitol.svg
| ImageFileL1 = Hemellitol.svg
| ImageSizeL1 = 100px
| ImageFileR1 = 1,2,3-Trimethylbenzene-3D-balls.png
| ImageFileR1 = 1,2,3-Trimethylbenzene-3D-balls.png
| PIN = 1,2,3-Trimethylbenzene
| ImageSizeR1 = 120px
| IUPACName = 1,2,3-Trimethylbenzene
| OtherNames = Hemellitol; Hemimellitol, Hemimelithol; Hemimellitine; Hemimellitene
| OtherNames = Hemellitol; Hemimellitol, Hemimelithol; Hemimellitine; Hemimellitene
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 526-73-8
| PubChem = 10686
| CASNo = 526-73-8
| ChEBI_Ref = {{ebicite|correct|EBI}}
| Beilstein = 1903410
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 34037
| ChEBI = 34037
| ChEMBL = 1797279
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10236
| EINECS = 208-394-8
| Gmelin = 326517
| PubChem = 10686
| RTECS = DC3300000
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ZK4R7UPH6R
| UNNumber = 1993
| SMILES = c1(cccc(c1C)C)C
| InChI = 1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3
| StdInChI = 1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FYGHSUNMUKGBRK-UHFFFAOYSA-N
| StdInChIKey = FYGHSUNMUKGBRK-UHFFFAOYSA-N
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10236
| RTECS = DC3300000
| SMILES = c1(cccc(c1C)C)C
| InChI = InChI=1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=9|H=12
| C=9 | H=12
| Appearance = Colorless liquid<ref name=GESTIS>{{GESTIS|ZVG=31060}}</ref>
| Appearance =
| Density = 0.894 g/mL
| Density = 0.89 g/mL<ref name=GESTIS/>
| MeltingPtC = −25
| MeltingPtC = −25
| MeltingPt_ref = <ref name=GESTIS/>
| BoilingPtCL = 175
| BoilingPtCH = 176
| BoilingPtC = 176
| BoilingPt_ref = <ref name=GESTIS/>
| Solubility =
| Solubility = 0.006% (20°C)<ref name=PGCH/>
| VaporPressure = 1 mmHg (16.7°C)<ref name=PGCH/>
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards = Flammable<ref name=pocket>[https://www.cdc.gov/niosh/npg/npgd0637.html CDC - NIOSH Pocket Guide to Chemical Hazards]</ref>
| MainHazards =
| FlashPtF = 51
| FlashPt = {{convert|119|F|C}}
| FlashPt_ref = <ref name=GESTIS/>
| Autoignition =
| AutoignitionPtF = 470
| RPhrases = {{R10}} {{R37}}
| AutoignitionPt_ref = <ref name=GESTIS/>
| SPhrases = {{S16}}
| GHSPictograms = {{GHS02}}{{GHS07}}{{GHS08}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|226|315|319|335}}
| PPhrases = {{P-phrases|210|233|240|241|242|243|261|264|271|280|302+352|303+361+353|304+340|305+351+338|312|321|332+313|337+313|362|370+378|403+233|403+235|405|501}}
| PEL = none<ref name=PGCH>{{PGCH|0637}}</ref>
| ExploLimits = 0.8%-6.6%<ref name=PGCH/>
| IDLH = N.D.<ref name=PGCH/>
| REL = TWA 25 ppm (125 mg/m{{sup|3}})<ref name=PGCH/>
}}
}}
}}
}}

'''1,2,3-Trimethylbenzene''' is an [[organic compound]] with the chemical formula C{{sub|6}}H{{sub|3}}(CH{{sub|3}}){{sub|3}}. Classified as an [[aromatic hydrocarbon]], it is a flammable colorless liquid. It is nearly insoluble in water but soluble in organic solvents. It occurs naturally in [[coal tar]] and [[petroleum]]. It is one of the three [[isomer]]s of [[trimethylbenzene]]. It is used in jet fuel, mixed with other [[hydrocarbons]], to prevent the formation of solid particles which might damage the engine.

==Production and uses==
Industrially, it is isolated from the C{{sub|9}} [[aromatic hydrocarbon]] fraction during [[petroleum distillation]]. It is also generated by [[methylation]] of [[toluene]] and [[xylene]]s.<ref name=Ullmanns>Karl Griesbaum, Arno Behr, Dieter Biedenkapp, Heinz-Werner Voges, Dorothea Garbe, Christian Paetz, Gerd Collin, Dieter Mayer, Hartmut Höke "Hydrocarbons" in Ullmann's Encyclopedia of Industrial Chemistry 2002 Wiley-VCH, Weinheim. {{doi|10.1002/14356007.a13_227}}</ref>

== References ==
{{reflist}}

{{DEFAULTSORT:Trimethylbenzene, 1, 2, 3-}}
[[Category:Alkylbenzenes]]
[[Category:C3-Benzenes]]


{{hydrocarbon-stub}}
{{Hydrocarbons}}