Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 473305971 of page 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine for the Chem/Drugbox validation project (updated: 'CASNo'). |
No edit summary |
||
| Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine|oldid=473305971}} 473305971] of page [[2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine]] with values updated to verified values.}} |
|||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
| ⚫ | |||
| Watchedfields = changed |
|||
| ⚫ | |||
| ImageFile1 = 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine.svg |
| ImageFile1 = 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine.svg |
||
| ImageSize1 = |
| ImageSize1 = 200px |
||
| ⚫ | |||
| ImageFile2 = |
|||
| ⚫ | |||
| ImageSize2 = 200px |
|||
| IUPACName = (''RS'')-2-[4-(2-Fluoro-ethyl)-2,5-dimethoxy-phenyl]-1-methyl-ethylamine |
|||
| ⚫ | |||
| ⚫ | |||
| InChI = 1/C13H20FNO2/c1-9(15)6-11-8-12(16-2)10(4-5-14)7-13(11)17-3/h7-9H,4-6,15H2,1-3H3 |
| InChI = 1/C13H20FNO2/c1-9(15)6-11-8-12(16-2)10(4-5-14)7-13(11)17-3/h7-9H,4-6,15H2,1-3H3 |
||
| SMILES1 = COc1cc(CC(C)N)c(cc1CCF)OC |
| SMILES1 = COc1cc(CC(C)N)c(cc1CCF)OC |
||
| Line 18: | Line 16: | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = QLENKWFQUHHBKZ-UHFFFAOYSA-N |
| StdInChIKey = QLENKWFQUHHBKZ-UHFFFAOYSA-N |
||
| CASNo_Ref = {{cascite|changed|??}} |
|||
| CASNo = |
| CASNo = 121649-01-2 |
||
| UNII = 72UT55MXE3 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID=21106293 |
| ChemSpiderID=21106293 |
||
| PubChem = |
| PubChem = 14201982 |
||
| SMILES = C1(=CC(=C(C=C1CC(C)N)OC)CCF)OC |
| SMILES = C1(=CC(=C(C=C1CC(C)N)OC)CCF)OC |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| C=13|H=20|N=1|O=2|F=1 |
|||
| Formula = C<sub>13</sub>H<sub>20</sub>NO<sub>2</sub>F |
|||
| MolarMass = 241.31 g/mol |
|||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = |
||
| Line 32: | Line 31: | ||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = }} |
| Solubility = }} |
||
| |
|Section3={{Chembox Hazards |
||
| MainHazards = |
| MainHazards = |
||
| FlashPt = |
| FlashPt = |
||
| |
| AutoignitionPt = }} |
||
}} |
}} |
||
''' 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine''' ('''DOEF'''; also known as '''dimethoxyfluoroethylamphetamine''') is a lesser-known [[psychedelic drug]] and member of the [[DOx|DOx class]].<ref>{{cite journal | doi = 10.1016/S0040-4039(00)82391-6| title = Synthesis of 1-[2′,5′-dimethoxy-4′-(β-fluoroethyl)phenyl]-2-aminopropane:studies related to 18F-labeled serotonin receptor ligands| journal = Tetrahedron Letters| volume = 29| issue = 50| pages = 6537–6539| year = 1988| last1 = Gerdes| first1 = John M.| last2 = Mathis| first2 = Chester A.| last3 = Shulgin| first3 = Alexander T.}}</ref><ref>{{cite journal | doi = 10.1002/dta.413| pmid = 22374819| title = Fluorine in psychedelic phenethylamines| journal = Drug Testing and Analysis| volume = 4| issue = 7–8| pages = 577–590| year = 2012| last1 = Trachsel| first1 = Daniel}}</ref> DOEF was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL]]'', the dosage range is listed as 2–3.5 mg, and the duration is listed as 12–16 hours.<ref>[http://www.erowid.org/library/books_online/pihkal/pihkal065.shtml DOEF Entry in ''PiHKAL'']</ref> Very little data exists about the pharmacological properties, metabolism, and toxicity of DOEF. |
|||
==See also== |
|||
* [[DOET]] |
|||
* [[DOPF]] |
|||
* [[DOTFM]] |
|||
==References== |
|||
{{reflist}} |
|||
{{Hallucinogens}} |
|||
{{DEFAULTSORT:Dimethoxy-4-fluoroethylamphetamine, 2,5-}} |
|||
[[Category:Substituted amphetamines]] |
|||
[[Category:Fluoroethyl compounds]] |
|||
{{Psychoactive-stub}} |
|||