Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 2,5-Dimethoxy-4-trifluoromethylamphetamine: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 472748681 of page 2,5-Dimethoxy-4-trifluoromethylamphetamine for the Chem/Drugbox validation project (updated: 'CAS_number'). |
m →top: insert hyphens |
||
Line 1: | Line 1: | ||
{{Short description|Psychedelic drug}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:2,5-Dimethoxy-4-trifluoromethylamphetamine|oldid=472748681}} 472748681] of page [[2,5-Dimethoxy-4-trifluoromethylamphetamine]] with values updated to verified values.}} |
|||
{{one source|date=April 2015}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 477211798 |
||
| IUPAC_name = (''RS'')-1-[2,5- |
| IUPAC_name = (''RS'')-1-[2,5-Dimethoxy-4-(trifluoromethyl)phenyl]propan-2-amine |
||
| image = 2,5-Dimethoxy-4-trifluoromethylamphetamine.svg |
| image = 2,5-Dimethoxy-4-trifluoromethylamphetamine.svg |
||
| width = 200px |
| width = 200px |
||
Line 10: | Line 12: | ||
| tradename = |
| tradename = |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_CA = Schedule I |
|||
⚫ | |||
| legal_UK = Class A |
|||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
Line 18: | Line 22: | ||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|changed|??}} |
| CAS_number_Ref = {{cascite|changed|??}} |
||
| CAS_number = |
| CAS_number = 159277-07-3 |
||
| CAS_supplemental = <BR> 159277-12-0 (hydrochloride) |
| CAS_supplemental = <BR> {{CAS|159277-12-0}} (hydrochloride) |
||
| ATC_prefix = |
| ATC_prefix = |
||
| ATC_suffix = |
| ATC_suffix = |
||
Line 35: | Line 39: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=12 | H=16 | F=3 | N=1 | O=2 |
|||
| chemical_formula = C<sub>12</sub>H<sub>16</sub>F<sub>3</sub>NO<sub>2</sub> |
|||
| molecular_weight = 263.26 g/mol |
|||
| smiles = FC(F)(F)c1cc(OC)c(cc1OC)CC(N)C |
| smiles = FC(F)(F)c1cc(OC)c(cc1OC)CC(N)C |
||
| InChI = 1/C12H16F3NO2/c1-7(16)4-8-5-11(18-3)9(12(13,14)15)6-10(8)17-2/h5-7H,4,16H2,1-3H3 |
|||
| InChIKey = WPGOTSORDNBMHP-UHFFFAOYAP |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C12H16F3NO2/c1-7(16)4-8-5-11(18-3)9(12(13,14)15)6-10(8)17-2/h5-7H,4,16H2,1-3H3 |
| StdInChI = 1S/C12H16F3NO2/c1-7(16)4-8-5-11(18-3)9(12(13,14)15)6-10(8)17-2/h5-7H,4,16H2,1-3H3 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = WPGOTSORDNBMHP-UHFFFAOYSA-N |
| StdInChIKey = WPGOTSORDNBMHP-UHFFFAOYSA-N |
||
| synonyms = 2,5- |
| synonyms = 2,5-Dimethoxy-4-trifluoromethylamphetamine |
||
}} |
}} |
||
'''2,5-Dimethoxy-4-trifluoromethylamphetamine''' ('''DOTFM''') is a [[psychedelic drug]] of the [[substituted phenethylamine|phenethylamine]] and [[substituted amphetamine|amphetamine]] [[chemical class]]es. It was first [[Chemical synthesis|synthesized]] in 1994 by a team at [[Purdue University]] led by [[David E. Nichols]].<ref name="pmid7996545">{{cite journal|author5-link=Bryan Roth |vauthors=Nichols DE, Frescas S, Marona-Lewicka D, Huang X, Roth BL, Gudelsky GA, Nash JF | title = 1-(2,5-Dimethoxy-4-(trifluoromethyl)phenyl)-2-aminopropane: a potent serotonin 5-HT<sub>2A/2C</sub> agonist | journal = Journal of Medicinal Chemistry | year = 1994 | volume = 37 | issue = 25 | pages = 4346–4351 | pmid = 7996545 | doi = 10.1021/jm00051a011 }}</ref> DOTFM is the [[alpha carbon|alpha]]-[[methyl]]ated [[Structural analog|analogue]] of [[2C-TFM]], and is around twice as potent in animal studies. It acts as an [[agonist]] at the [[5HT2A receptor|5-HT<sub>2A</sub>]] and [[5-HT2C receptor|5-HT<sub>2C</sub>]] [[Receptor (biochemistry)|receptor]]s.<ref name="pmid7996545"/> In drug-substitution experiments in rats, DOTFM fully substituted for [[LSD]] and was slightly more potent than [[2,5-Dimethoxy-4-iodoamphetamine|DOI]].<ref name="pmid7996545"/> |
|||
== See also == |
|||
* [[DOx]] |
|||
== References == |
|||
{{Reflist}} |
|||
{{Hallucinogens}} |
|||
{{Serotonergics}} |
|||
{{Phenethylamines}} |
|||
{{DEFAULTSORT:Dimethoxy-4-trifluoromethylamphetamine, 2,5-}} |
|||
[[Category:Substituted amphetamines]] |
|||
[[Category:Trifluoromethyl compounds]] |
|||
[[Category:2,5-Dimethoxyphenethylamines]] |
|||
[[Category:Substances discovered in the 1990s]] |