Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 2,5-Dimethoxy-4-trifluoromethylamphetamine: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 472748681 of page 2,5-Dimethoxy-4-trifluoromethylamphetamine for the Chem/Drugbox validation project (updated: 'CAS_number').
 
m →‎top: insert hyphens
 
Line 1: Line 1:
{{Short description|Psychedelic drug}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:2,5-Dimethoxy-4-trifluoromethylamphetamine|oldid=472748681}} 472748681] of page [[2,5-Dimethoxy-4-trifluoromethylamphetamine]] with values updated to verified values.}}
{{one source|date=April 2015}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 413107065
| verifiedrevid = 477211798
| IUPAC_name = (''RS'')-1-[2,5-dimethoxy-4-(trifluoromethyl)phenyl]propan-2-amine
| IUPAC_name = (''RS'')-1-[2,5-Dimethoxy-4-(trifluoromethyl)phenyl]propan-2-amine
| image = 2,5-Dimethoxy-4-trifluoromethylamphetamine.svg
| image = 2,5-Dimethoxy-4-trifluoromethylamphetamine.svg
| width = 200px
| width = 200px
Line 10: Line 12:
| tradename =
| tradename =
| pregnancy_category =
| pregnancy_category =
| legal_CA = Schedule I
| legal_status = Uncontrolled
| legal_UK = Class A
| routes_of_administration =
| legal_status =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
Line 18: Line 22:
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = <!-- blanked - oldvalue: 159277-07-3 -->
| CAS_number = 159277-07-3
| CAS_supplemental = <BR> 159277-12-0 (hydrochloride)
| CAS_supplemental = <BR> {{CAS|159277-12-0}} (hydrochloride)
| ATC_prefix =
| ATC_prefix =
| ATC_suffix =
| ATC_suffix =
Line 35: Line 39:


<!--Chemical data-->
<!--Chemical data-->
| C=12 | H=16 | F=3 | N=1 | O=2
| chemical_formula = C<sub>12</sub>H<sub>16</sub>F<sub>3</sub>NO<sub>2</sub>

| molecular_weight = 263.26 g/mol
| smiles = FC(F)(F)c1cc(OC)c(cc1OC)CC(N)C
| smiles = FC(F)(F)c1cc(OC)c(cc1OC)CC(N)C
| InChI = 1/C12H16F3NO2/c1-7(16)4-8-5-11(18-3)9(12(13,14)15)6-10(8)17-2/h5-7H,4,16H2,1-3H3
| InChIKey = WPGOTSORDNBMHP-UHFFFAOYAP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H16F3NO2/c1-7(16)4-8-5-11(18-3)9(12(13,14)15)6-10(8)17-2/h5-7H,4,16H2,1-3H3
| StdInChI = 1S/C12H16F3NO2/c1-7(16)4-8-5-11(18-3)9(12(13,14)15)6-10(8)17-2/h5-7H,4,16H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WPGOTSORDNBMHP-UHFFFAOYSA-N
| StdInChIKey = WPGOTSORDNBMHP-UHFFFAOYSA-N
| synonyms = 2,5-dimethoxy-4-trifluoromethylamphetamine
| synonyms = 2,5-Dimethoxy-4-trifluoromethylamphetamine
}}
}}

'''2,5-Dimethoxy-4-trifluoromethylamphetamine''' ('''DOTFM''') is a [[psychedelic drug]] of the [[substituted phenethylamine|phenethylamine]] and [[substituted amphetamine|amphetamine]] [[chemical class]]es. It was first [[Chemical synthesis|synthesized]] in 1994 by a team at [[Purdue University]] led by [[David E. Nichols]].<ref name="pmid7996545">{{cite journal|author5-link=Bryan Roth |vauthors=Nichols DE, Frescas S, Marona-Lewicka D, Huang X, Roth BL, Gudelsky GA, Nash JF | title = 1-(2,5-Dimethoxy-4-(trifluoromethyl)phenyl)-2-aminopropane: a potent serotonin 5-HT<sub>2A/2C</sub> agonist | journal = Journal of Medicinal Chemistry | year = 1994 | volume = 37 | issue = 25 | pages = 4346–4351 | pmid = 7996545 | doi = 10.1021/jm00051a011 }}</ref> DOTFM is the [[alpha carbon|alpha]]-[[methyl]]ated [[Structural analog|analogue]] of [[2C-TFM]], and is around twice as potent in animal studies. It acts as an [[agonist]] at the [[5HT2A receptor|5-HT<sub>2A</sub>]] and [[5-HT2C receptor|5-HT<sub>2C</sub>]] [[Receptor (biochemistry)|receptor]]s.<ref name="pmid7996545"/> In drug-substitution experiments in rats, DOTFM fully substituted for [[LSD]] and was slightly more potent than [[2,5-Dimethoxy-4-iodoamphetamine|DOI]].<ref name="pmid7996545"/>

== See also ==
* [[DOx]]

== References ==
{{Reflist}}

{{Hallucinogens}}
{{Serotonergics}}
{{Phenethylamines}}

{{DEFAULTSORT:Dimethoxy-4-trifluoromethylamphetamine, 2,5-}}
[[Category:Substituted amphetamines]]
[[Category:Trifluoromethyl compounds]]
[[Category:2,5-Dimethoxyphenethylamines]]
[[Category:Substances discovered in the 1990s]]