Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 2-Phosphoglyceric acid: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 472757590 of page 2-Phosphoglyceric_acid for the Chem/Drugbox validation project (updated: 'CASNo'). |
M97uzivatel (talk | contribs) No edit summary |
||
| Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:2-Phosphoglyceric_acid|oldid=472757590}} 472757590] of page [[2-Phosphoglyceric_acid]] with values updated to verified values.}} |
|||
{{chembox |
{{chembox |
||
|Verifiedfields = changed |
|||
| verifiedrevid = 401673489 |
|||
|verifiedrevid = 477215471 |
|||
|ImageFile=2-Phosphoglycerate.png |
|ImageFile=2-Phosphoglycerate.png |
||
|ImageSize=180px |
|ImageSize=180px |
||
|IUPACName=3-hydroxy-2-phosphonooxypropanoic acid |
|IUPACName=3-hydroxy-2-phosphonooxypropanoic acid |
||
|OtherNames=2PG |
|OtherNames=2PG |
||
|Section1= |
|Section1={{Chembox Identifiers |
||
| |
|ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| |
|ChemSpiderID = 58 |
||
|ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| InChI = 1/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9) |
|||
|ChEBI = 24344 |
|||
| InChIKey = GXIURPTVHJPJLF-UHFFFAOYAQ |
|||
|InChI = 1/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9) |
|||
| SMILES1 = O=P(O)(O)OC(C(=O)O)CO |
|||
|InChIKey = GXIURPTVHJPJLF-UHFFFAOYAQ |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
|SMILES1 = O=P(O)(O)OC(C(=O)O)CO |
|||
| StdInChI = 1S/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9) |
|||
| |
|StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
|StdInChI = 1S/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9) |
|||
| StdInChIKey = GXIURPTVHJPJLF-UHFFFAOYSA-N |
|||
| |
|StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
|StdInChIKey = GXIURPTVHJPJLF-UHFFFAOYSA-N |
|||
| CASNo = <!-- blanked - oldvalue: 2553-59-5 --> |
|||
|CASNo_Ref = {{cascite|changed|??}} |
|||
| PubChem=59 |
|||
|CASNo=2553-59-5 |
|||
| SMILES=C(C(C(=O)O)OP(=O)(O)O)O |
|||
|PubChem=59 |
|||
}} |
|||
|SMILES=C(C(C(=O)O)OP(=O)(O)O)O |
|||
|Section2= {{Chembox Properties |
|||
| Formula=C<sub>3</sub>H<sub>7</sub>O<sub>7</sub>P |
|||
| MolarMass=186.06 g/mol |
|||
| Appearance= |
|||
| Density= |
|||
| MeltingPt= |
|||
| BoilingPt= |
|||
| Solubility= |
|||
}} |
|||
|Section3= {{Chembox Hazards |
|||
| MainHazards= |
|||
| FlashPt= |
|||
| Autoignition= |
|||
}} |
|||
}} |
}} |
||
|Section2={{Chembox Properties |
|||
|Formula=C<sub>3</sub>H<sub>7</sub>O<sub>7</sub>P |
|||
|MolarMass=186.06 g/mol}} |
|||
}} |
|||
'''2-Phosphoglyceric acid''' ('''2PG'''), or '''2-phosphoglycerate''', is a [[glyceric acids|glyceric acid]] which serves as the substrate in the ninth step of [[glycolysis]]. It is catalyzed by [[enolase]] into [[phosphoenolpyruvate]] (PEP), the penultimate step in the conversion of [[glucose]] to [[pyruvate]]. |
|||
==In glycolysis== |
|||
{| style="background: white; text-align:center;" |
|||
|- |
|||
| style="background:lightgreen" | [[3-phosphoglycerate|3-phospho-{{small|D}}-glycerate]] |
|||
| colspan="2" style="background:pink; width:75px" | [[Phosphoglyceromutase]] |
|||
| style="background:lightgreen" | [[2-phosphoglycerate|2-phospho-{{small|D}}-glycerate]] |
|||
| colspan="2" style="background:pink; width:75px" | [[Enolase]] |
|||
| style="background:lightgreen" | [[phosphoenolpyruvate]] |
|||
|- |
|||
| rowspan="5" | [[image:3-phospho-D-glycerate.svg|90px]] |
|||
| colspan="2" style="width:75px" | |
|||
| rowspan="5" | [[image:2-phospho-D-glycerate_wpmp.png]] |
|||
| colspan="2" style="width:75px" | |
|||
| rowspan="5" | [[image:phosphoenolpyruvate_wpmp.png]] |
|||
|- |
|||
| |
|||
| |
|||
| |
|||
| H<sub>2</sub>O |
|||
|- |
|||
| colspan="2" style="width:75px" | [[image:Biochem_reaction_arrow_reversible_NNNN_horiz_med.svg|75px]] |
|||
| colspan="2" style="width:75px" | [[image:Biochem_reaction_arrow_reversible_NYYN_horiz_med.svg|75px]] |
|||
|- |
|||
| |
|||
| |
|||
| |
|||
| H<sub>2</sub>O |
|||
|- |
|||
| colspan="2" style="width:75px" | |
|||
| colspan="2" style="width:75px" | |
|||
|- |
|||
| |
|||
| colspan="2" style="background:pink; width:75px" | [[Phosphoglyceromutase]] |
|||
| |
|||
| colspan="2" style="background:pink; width:75px" | [[Enolase]] |
|||
| align="right" | |
|||
|} |
|||
{{KEGG compound|C00197}} {{KEGG enzyme|5.4.2.1}} {{KEGG compound|C00631}} {{KEGG enzyme|4.2.1.11}} {{KEGG compound|C00074}} |
|||
{{GlycolysisGluconeogenesis_WP534|highlight=2-Phosphoglyceric_acid}} |
|||
==See also== |
|||
* [[3-Phosphoglyceric acid]] |
|||
==References== |
|||
{{refimprove|date=September 2007}} |
|||
{{reflist}} |
|||
{{Glycolysis}} |
|||
{{metabolism-stub}} |
|||
{{organic-compound-stub}} |
|||
{{DEFAULTSORT:Phosphoglyceric acid, 2-}} |
|||
[[Category:Organophosphates]] |
|||
[[Category:Glycolysis]] |
|||