Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 3,5-Dinitrosalicylic acid: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 468044763 of page 3,5-Dinitrosalicylic_acid for the Chem/Drugbox validation project (updated: 'CASNo').
 
recategorized
 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:3,5-Dinitrosalicylic_acid|oldid=468044763}} 468044763] of page [[3,5-Dinitrosalicylic_acid]] with values updated to verified values.}}
{{Chembox
{{Chembox
| Verifiedfields = changed
⚫
| verifiedrevid = 444365590
| Watchedfields = changed
⚫
| verifiedrevid = 477217802
| ImageFileL1 = 3,5-Dinitrosalicylic Acid Structural Formulae V.1.svg
| ImageFileL1 = 3,5-Dinitrosalicylic Acid Structural Formulae V.1.svg
| ImageSizeL1 = 100px
| ImageFileR1 = 3,5-dinitrosalicylic-acid-3D-balls.png
| ImageFileR1 = 3,5-dinitrosalicylic-acid-3D-balls.png
| PIN = 2-Hydroxy-3,5-dinitrobenzoic acid
| ImageSizeR1 = 120px
| IUPACName = 2-hydroxy-3,5-dinitrobenzoic acid
| OtherNames = 3,5-Dinitrosalicylic acid
| OtherNames = 3,5-dinitrosalicylic acid
| Reference = <ref name="hand">
| Reference = <ref name="hand">
{{cite book | last = Lide | first = David R. | year = 1998
{{cite book | last = Lide | first = David R. | year = 1998
| title = Handbook of Chemistry and Physics
| title = Handbook of Chemistry and Physics
| edition = 87 | volume =
| edition = 87 | volume =
| location = Boca Raton, FL
| location = Boca Raton, Florida
| publisher = CRC Press
| publisher = CRC Press
| isbn = 0849305942 | pages = 3–318}}</ref>
| isbn = 978-0-8493-0594-8 | pages = 3–318}}</ref>
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 11380
| ChemSpiderID = 11380
Line 26: Line 25:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LWFUFLREGJMOIZ-UHFFFAOYSA-N
| StdInChIKey = LWFUFLREGJMOIZ-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = <!-- blanked - oldvalue: 609-99-4 -->
| CASNo = 609-99-4
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| PubChem =
| UNII = 2ACT5NW8HU
⚫
| PubChem = 11873
| Gmelin = 5309
| EC_number = 210-204-3
| Beilstein = 2220661
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 53648
| ChEBI = 53648
| ChEMBL = 2260697
| SMILES = c1c(cc(c(c1C(=O)O)O)[N+](=O)[O-])[N+](=O)[O-]
| SMILES = c1c(cc(c(c1C(=O)O)O)[N+](=O)[O-])[N+](=O)[O-]
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C = 7 | H = 4 | N = 2 | O = 7
| C=7 | H=4 | N=2 | O=7
| Formula =
| Formula =
| MolarMass =
| MolarMass =
| Appearance = yellow needles or plates
| Appearance = Yellow needles or plates
| Density =
| Density =
| MeltingPt = 182°C
| MeltingPtC = 182
| MeltingPt_notes =
| BoilingPt =
| BoilingPt =
| Solubility = soluble in water
| Solubility = Soluble
|SolubleOther = soluble in [[ethanol]], [[diethyl ether]], [[benzene]]}}
| SolubleOther = Soluble in [[ethanol]], [[diethyl ether]], [[benzene]]
⚫
| Section3 = {{Chembox Hazards
| Solvent = organic solvents}}
| MainHazards =
⚫
|Section3={{Chembox Hazards
⚫
| FlashPt =
| Autoignition = }}
| MainHazards =
⚫
| FlashPt =
| AutoignitionPt =
| GHSPictograms = {{GHS05}}{{GHS07}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|302|315|318|319|335}}
| PPhrases = {{P-phrases|261|264|270|271|280|301+312|302+352|304+340|305+351+338|310|312|321|330|332+313|337+313|362|403+233|405|501}}
}}
}}
}}

'''3,5-Dinitrosalicylic acid''' ('''DNS''' or '''DNSA''', [[IUPAC]] name '''2-hydroxy-3,5-dinitrobenzoic acid''') is an [[aromatic compound]] that reacts with [[reducing sugar]]s and other reducing molecules to form [[3-amino-5-nitrosalicylic acid]], which strongly absorbs [[light]] at 540 [[1 E-9 m|nm]]. It was first introduced as a method to detect reducing substances in urine by [[James B. Sumner]]<ref>Sumner, J.B. Dinitrosalicylic acid: a reagent for the estimation of sugar in normal and diabetic urine. Journal of Biological Chemistry 47, 5, 1921.</ref> and has since been widely used, for example, for quantifying [[carbohydrate]] levels in [[blood]].<ref>{{Cite web |url=http://www.glue.umd.edu/~NSW/ench485/lab4a.htm |title=Description of lab use from the ''Department of Chemical Engineering, University of Maryland'' |access-date=2006-03-17 |archive-date=2007-08-17 |archive-url=https://web.archive.org/web/20070817081726/http://www.glue.umd.edu/~NSW/ench485/lab4a.htm |url-status=dead }}</ref> It is mainly used in assay of [[alpha-amylase]]. However, [[enzyme|enzymatic]] methods are usually preferred due to DNS's lack of specificity.<ref>{{cite journal|first=Gail Lorenz|last=Miller|title=Use of dinitrosalicylic acid reagent for determination of reducing sugar|journal=Anal. Chem.|volume=31|issue=3|pages=426–428|year=1959|doi=10.1021/ac60147a030}}</ref>

== Synthesis ==
3,5-Dinitrosalicylic acid can be prepared by the [[nitration]] of [[salicylic acid]].<ref name="Thiel">Thiel, W.; Mayer, R.; Jauer, E.-A.; Modrow, H.; Dost, H.: ''Synthesis and Spectral Characterization of Blue Dyes of the Benzene Series'' in J. Prakt. Chem. (Leipzig) 328 (1986) 497-514, {{doi|10.1002/prac.19863280406}}.</ref>

[[File:3,5-Dinitrosalicylic acid synthesis01.svg|375px]]

==References==
{{Reflist}}

{{DEFAULTSORT:Dinitrosalicylic acid, 3, 5-}}
[[Category:Dinitrophenol derivatives]]
[[Category:Salicylic acids]]

{{aromatic-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"