Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 3-Hydroxyanthranilic acid: Difference between pages

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477218575

| ImageFile = 3-Hydroxyanthranilic acid.png

| ImageSize = 160px

| ImageAlt = Skeletal formula of 3-hydroxyanthranilic acid

| ImageFile1 = 3-Hydroxyanthranilic-acid-zwitterion-3D-balls.png

| ImageSize1 = 160px

| ImageAlt1 = Ball-and-stick model of the 3-hydroxyanthranilic acid molecule as a zwitterion

| PIN= 2-Amino-3-hydroxybenzoic acid

| OtherNames=

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 548-93-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1UQB1BT4OT

| PubChem = 86

| ChEBI_Ref = {{ebicite|correct|EBI}}

| SMILES = C1=CC(=C(C(=C1)O)N)C(=O)O

| MeSHName = 3-Hydroxyanthranilic+Acid

| Section2 = {{Chembox Properties

| C=7|H=7|N=1|O=3

| Appearance = powder

| Density = ≈ 1 g/cm³

| MeltingPtC = 240-265

| MeltingPt_ref =<ref>{{cite journal|last1 = Moline|first1= Sheldon W.|last2 = Walker|first2 = H.C.|last3 = Schweigert|first3 = B.S.|year = 1958|title = 3-Hydroxyanthranilic Acid Metabolism: VII. Mechanism of Formation of Quinolinic Acid|url = http://www.jbc.org/content/234/4/880|journal = Journal of Biological Chemistry|volume = 234|issue = 4|pages = 880–883|doi= 10.1016/S0021-9258(18)70194-4|pmid= 13654282|access-date = 2015-09-24|doi-access= free}}</ref><br/> decomposes<br/> {{convert|227|C|F K}}<ref name=plc>{{cite book|first1 = Wilfred L.F.|last1 = Armarego|first2 = Christina L.L.|last2 = Chai|year = 2009|title = Purification of Laboratory Chemicals|url = https://books.google.com/books?id=PTXyS7Yj6zUC&pg=PA297|publisher = Elsevier Inc.|edition = 6th|page = 297|isbn = 978-1-85617-567-8}}</ref><br/> from dilute [[hydrochloric acid|HCl]], decomposes

| LambdaMax = 298 nm<ref name=plc/>

| pKa = at 20 °C:<ref name=plc/><br/> 1 = 2.7, 2 = 5.19, 3 = 10.12

| Solubility = low<ref name=scbt/>

| SolubleOther = soluble in ether, [[chloroform|CHCl₃]], alcohols<ref name=scbt/>

| Solubility1 = 1 N:<ref name=scbt>{{cite web|url = https://www.scbt.com/scbt/product/3-hydroxyanthranilic-acid-548-93-6|title = 3-Hydroxyanthranilic acid|publisher = Santa Cruz Biotechnology, Inc.|access-date = 2015-09-24}}</ref><br/> 1 g/100 ml

| Solvent1 = hydrochloric acid

| Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

'''3-Hydroxyanthranilic acid''' is an [[reaction intermediate|intermediate]] in the [[tryptophan metabolism|metabolism of tryptophan]]. It is new [[antioxidant]] isolated from [[methanol]] extract of [[tempeh]]. It is effective in preventing [[autoxidation]] of [[soybean oil]] and powder, while antioxidant 6,7,4'-trihydroxyisoflavone is not.<ref>{{cite journal|doi=10.1021/jf950454t|title=New Antioxidant Isolated from Tempeh|journal=Journal of Agricultural and Food Chemistry|volume=44|issue=3|pages=696|year=1996|last1=Esaki|first1=Hideo|last2=Onozaki|first2=Hiromichi|last3=Kawakishi|first3=Shunro|last4=Osawa|first4=Toshihiko}}</ref>

==References==

{{reflist|35em}}

==External links==

*[https://web.archive.org/web/20180920120220/http://www.keydelay.tk/2015/09/asam-3-hidroksiantranilat.html HAA] concentration graph in lyophilized tempeh powder extract {{in lang|id}}

{{Amino acid metabolism intermediates}}

{{DEFAULTSORT:Hydroxyanthranilic acid, 3-}}

[[Category:Aldehyde dehydrogenase inhibitors]]

[[Category:Monohydroxybenzoic acids]]

[[Category:Anthranilic acids]]

{{aromatic-stub}}