Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 7-Methylguanosine: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 464810689 of page 7-Methylguanosine for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo').
 
move systematic name
 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:7-Methylguanosine|oldid=464810689}} 464810689] of page [[7-Methylguanosine]] with values updated to verified values.}}
{{Chembox
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477346139
| ImageFile = 7-Methylguanosine.svg
| ImageFile = 7-Methylguanosine.svg
| ImageSize = 180px
| ImageSize = 180px
| IUPACName = 7-Methylguanosine
| ImageFile1 = 7-Methylguanosine ball-and-stick.png
| ImageSize1 = 180px
| IUPACName = 7-Methylguanosin-7-ium
| SystematicName = 2-Amino-9-[(2''R'',3''R'',4''S'',5''R'')-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-6-oxo-6,9-dihydro-1''H''-purin-7-ium
| OtherNames = N7-Methylguanosine; 2-Amino-1,6-dihydro-7-methyl-6-oxo-9-β-<small>D</small>-ribofuranosylpurinium
| OtherNames = N7-Methylguanosine; 2-Amino-1,6-dihydro-7-methyl-6-oxo-9-β-<small>D</small>-ribofuranosylpurinium
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| Abbreviations = m7G; m<sup>7</sup>G
| Abbreviations = m7G; m<sup>7</sup>G
| CASNo = <!-- blanked - oldvalue: 20244-86-4 -->
| CASNo = 20244-86-4
| CASNo_Ref = {{cascite|correct|}}
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| ChEBI = 20794
| UNII = 5290OM2I6G
| ChEBI_Ref = {{ebicite|correct|EBI}}
⚫
| ChEBI = 20794
| PubChem = 445404
| PubChem = 445404
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 393054
| ChemSpiderID = 393054
| SMILES = O=C3/N=C(/N)Nc1c3n(c[n+]1[C@@H]2O[C@@H]([C@@H](O)[C@H]2O)CO)C
| SMILES = O=C3/N=C(/N)Nc1c3n(c[n+]1[C@@H]2O[C@@H]([C@@H](O)[C@H]2O)CO)C
| InChI = 1/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1
| InChI = 1/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1
| InChIKey = OGHAROSJZRTIOK-UJMNIJGGBX
| InChIKey = OGHAROSJZRTIOK-UJMNIJGGBX
⚫
| StdInChI = 1S/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫
| StdInChIKey = OGHAROSJZRTIOK-KQYNXXCUSA-O
⚫
| StdInChI = 1S/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫
| StdInChIKey = OGHAROSJZRTIOK-KQYNXXCUSA-O
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=11|H=16|N=5|O=5
| C=11 | H=16 | N=5 | O=5
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
| Solubility =
| Solubility =
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
}}
}}
}}
}}

'''7-Methylguanosine''' ('''m<sup>7</sup>G''') is a modified [[purine]] [[nucleoside]]. It is a [[methylation|methylated]] version of [[guanosine]] and when found in human urine, it may be a [[biomarker]] of some types of cancer. In the [[RNA]]s, 7-methylguanosine have been used to study and examine the reaction evolving methylguanosine. It also plays a role in [[Messenger RNA|mRNA]] as a blocking group at its [[Five-prime cap|5´-end]].<ref>{{cite journal | pmid = 1739950 | year = 1992 | last1 = Reynaud | first1 = C | last2 = Bruno | first2 = C | last3 = Boullanger | first3 = P | last4 = Grange | first4 = J | last5 = Barbesti | first5 = S | last6 = Niveleau | first6 = A | title = Monitoring of urinary excretion of modified nucleosides in cancer patients using a set of six monoclonal antibodies | volume = 61 | issue = 3 | pages = 255–62 | journal = Cancer Letters | doi=10.1016/0304-3835(92)90296-8}}</ref>

==See also==
*[[METTL1]]
*[[23S rRNA (guanine2445-N2)-methyltransferase]]
*[[16S rRNA (guanine527-N7)-methyltransferase]]

==References==
{{reflist}}

==External links==
* [http://www.hmdb.ca/metabolites/HMDB01107 Metabocard for 7-Methylguanosine (HMDB01107)], Human Metabolome Database, University of Alberta

{{DEFAULTSORT:Methylguanosine, 7-}}
[[Category:Nucleosides]]
[[Category:Purines]]
[[Category:Hydroxymethyl compounds]]
[[Category:Biomarkers]]


{{organic-compound-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"