Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and AMPA: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 464466940 of page AMPA for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo'). |
Added bibcode. |
||
Line 1: | Line 1: | ||
{{other uses}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:AMPA|oldid=464466940}} 464466940] of page [[AMPA]] with values updated to verified values.}} |
|||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 477236183 |
||
| ImageFile = AMPA.svg |
| ImageFile = AMPA.svg |
||
| ImageSize = 200px |
| ImageSize = 200px |
||
| IUPACName = 2- |
| IUPACName = 2-Amino-3-(3-hydroxy-5-methyl-isoxazol-4-yl)propanoic acid |
||
| OtherNames = |
| OtherNames = |
||
| |
|Section1={{Chembox Identifiers |
||
| InChIKey = UUDAMDVQRQNNHZ-UHFFFAOYAT |
| IUPHAR_ligand = 4131 |
||
| InChIKey = UUDAMDVQRQNNHZ-UHFFFAOYAT |
|||
| CASNo_Ref = {{cascite|changed|??}} |
| CASNo_Ref = {{cascite|changed|??}} |
||
| CASNo = |
| CASNo = 74341-63-2 |
||
| |
| PubChem = 1221 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 276815 |
||
| |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = DB02057 |
| DrugBank = DB02057 |
||
| KEGG_Ref = |
| KEGG_Ref = C13672 |
||
| KEGG = C11033 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12) |
| StdInChI = 1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12) |
||
Line 23: | Line 24: | ||
| StdInChIKey = UUDAMDVQRQNNHZ-UHFFFAOYSA-N |
| StdInChIKey = UUDAMDVQRQNNHZ-UHFFFAOYSA-N |
||
| SMILES = O=C1/C(=C(\ON1)C)CC(N)C(=O)O |
| SMILES = O=C1/C(=C(\ON1)C)CC(N)C(=O)O |
||
| |
| InChI = 1/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12) |
||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 1184 |
| ChemSpiderID = 1184 |
||
| |
| MeSHName = AMPA |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| |
| C=7 | H=10 | N=2 | O=4 |
||
| Appearance = |
|||
| MolarMass = 186.17 g/mol |
|||
| |
| Density = |
||
| |
| MeltingPt = |
||
| |
| BoilingPt = |
||
| |
| Solubility = |
||
}} |
}} |
||
| |
|Section3={{Chembox Hazards |
||
| |
| MainHazards = |
||
| |
| FlashPt = |
||
| |
| AutoignitionPt = |
||
| Autoignition = |
|||
}} |
}} |
||
}} |
}} |
||
'''α-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid''', better known as '''AMPA''', is a [[Chemical compound|compound]] that is a specific [[agonist]] for the [[AMPA receptor]], where it mimics the effects of the [[neurotransmitter]] [[Glutamate (neurotransmitter)|glutamate]].<ref name=Purves2008>{{cite book |author=Purves, Dale |author2=George J. Augustine |author3=David Fitzpatrick |author4=William C. Hall |author5=Anthony-Samuel LaMantia |author6=James O. McNamara |author7=Leonard E. White |name-list-style=amp|title=Neuroscience|edition=4th|publisher=Sinauer Associates|pages=128–33|year=2008|isbn=978-0-87893-697-7}}</ref> |
|||
There are several types of glutamatergic ion channels in the central nervous system including AMPA, [[kainic acid]] and [[N-Methyl-D-aspartic acid|''N''-methyl-<small>D</small>-aspartic acid]] (NMDA) channels. In the [[Chemical synapse|synapse]], these receptors serve very different purposes. AMPA can be used experimentally to distinguish the activity of one receptor from the other in order to understand their differing functions.<ref name=Dinh2009>{{cite journal|last1=Dinh|first1=L|author2=Nguyen T |author3=Salgado H |author4=Atzori M |title=Norepinephrine homogeneously inhibits alpha-amino-3-hydroxyl-5-methyl-4-isoxazole-propionate- (AMPAR-) mediated currents in all layers of the temporal cortex of the rat|journal=Neurochem Res|volume=34|issue=11|pages=1896–906|year=2009|pmid=19357950|doi=10.1007/s11064-009-9966-z|s2cid=25255160}}</ref> AMPA generates [[Fast Excitatory Postsynaptic Potential|fast]] [[excitatory postsynaptic potential]]s (EPSP).<ref name=Purves2008/> AMPA activates AMPA receptors that are non-selective cationic channels allowing the passage of Na<sup>+</sup> and K<sup>+</sup> and therefore have an [[equilibrium potential]] near 0 mV. |
|||
AMPA was first synthesized, along with several other [[ibotenic acid]] derivatives, by Krogsgaard-Larsen, Honoré, and others toward differentiating glutamate sensitive receptors from aspartate sensitive receptors.<ref name = KrogsgaardLarsen1980>{{cite journal |last1=Krogsgaard-Larsen|first1=P|author2=Honore T |author3=Hansen JJ |author4=Curtis DR|author5=Lodge D |title=New class of glutamate agonist structurally related to ibotenic acid|journal=Nature|volume=284|pages=64–66|year=1980|issue=5751|pmid=6101908|doi=10.1038/284064a0|bibcode=1980Natur.284...64K|s2cid=4252428}}</ref> |
|||
==See also== |
|||
* [[Ampakine]] |
|||
==References== |
|||
{{Reflist|2}} |
|||
{{Ionotropic glutamate receptor modulators}} |
|||
[[Category:AMPA receptor agonists]] |
|||
[[Category:Kainate receptor agonists]] |
|||
[[Category:Alpha-Amino acids]] |
|||
[[Category:Isoxazoles]] |
|||
[[Category:Glutamate (neurotransmitter)]] |