Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Acefylline clofibrol: Difference between pages

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
-{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Acefylline_clofibrol|oldid=457799576}} 457799576] of page [[Acefylline_clofibrol]] with values updated to verified values.}}
 {{Drugbox
 | Verifiedfields = changed
+| Watchedfields = changed
-| verifiedrevid = 457798631
+| verifiedrevid = 477238044
 | IUPAC_name = 2-(4-Chlorophenoxy)-2-methylpropyl (1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7''H''-purin-7-yl)acetate
 | image = Acefylline clofibrol.svg
-| width = 200px
+| width = 300px
 | image2 =
 | width2 =
+| drug_name =
-| imagename = <!-- else may use drug_name -->
-| drug_name = <!-- else may use imagename -->
 <!--Clinical data-->
@@ Line 25: / Line 25: @@
 | legal_status =
 | dependency_liability =
-| routes_of_administration =
+| routes_of_administration =  [[Intramuscular]], [[Intravenous]]
 <!--Pharmacokinetic data-->
 | bioavailability =
@@ Line 33: / Line 32: @@
 | elimination_half-life =
 | excretion =
 <!--Identifiers-->
 | CAS_number_Ref = {{cascite|changed|??}}
-| CAS_number = <!-- blanked - oldvalue: 70788-27-1 -->
+| CAS_number = 70788-27-1
 | ATC_prefix =
 | ATC_suffix =
@@ Line 43: / Line 41: @@
 | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 | DrugBank =
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
+| ChEMBL = 2104056
 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 62127
 | UNII_Ref = {{fdacite|changed|FDA}}
-| UNII = <!-- blanked - oldvalue: WY672D78VW -->
+| UNII = WY672D78VW
 | synonyms =
 <!--Chemical data-->
 | chemical_formula =
-| C=19 | H=21 | As=  | Au=  | Br=  | Cl=1 | Co=  | F=  | Gd=  | I=  | Mn=  | N=4 | Na=  | O=5 | P=  | Pt=  | S=  | Se=  | Sr=  | Tc=  | charge =
+| C=19 | H=21 | Cl=1 | N=4 | O=5
+| SMILES = Clc3ccc(OC(C)(C)COC(=O)Cn1c2c(nc1)N(C(=O)N(C2=O)C)C)cc3
-| molecular_weight = 420.847
-| smiles = Clc3ccc(OC(C)(C)COC(=O)Cn1c2c(nc1)N(C(=O)N(C2=O)C)C)cc3
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChI = 1S/C19H21ClN4O5/c1-19(2,29-13-7-5-12(20)6-8-13)10-28-14(25)9-24-11-21-16-15(24)17(26)23(4)18(27)22(16)3/h5-8,11H,9-10H2,1-4H3
@@ Line 65: / Line 63: @@
 | sec_combustion =
 }}
+'''Acefylline clofibrol''' is a derivative of [[acefylline]] and [[clofibrate]] used as a [[hypolipidemic agent]].<ref>{{cite patent | inventor = Tamietto, Teresio; Franzone, Jose Sebastian | title = 2-(p-Chlorophenoxy)-2-methylpropyl theophylline-7-acetate useful as a hypocholesterolemiant | pubdate = 1979 | country = FR |  | number = 2393803}}</ref><ref>[http://euroasiarnd.com/productdetail-Galiellalactone-DNA%20REGULATION%20/productdetail-Acefylline-Clofibrol-ANTI-AGONIST-4405-14.html euroasiarnd] {{webarchive |url=https://web.archive.org/web/20110815212540/http://euroasiarnd.com/productdetail-Galiellalactone-DNA%20REGULATION%20/productdetail-Acefylline-Clofibrol-ANTI-AGONIST-4405-14.html |date=August 15, 2011 }}</ref>
+== References ==
+{{reflist}}
+[[Category:Acetate esters]]
+{{cardiovascular-drug-stub}}