Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Aesculetin: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 443372760 of page Aesculetin for the Chem/Drugbox validation project (updated: ''). |
m Open access bot: doi added to citation with #oabot. |
||
Line 1: | Line 1: | ||
{{distinguish|aesculin|aescin}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Aesculetin|oldid=443372760}} 443372760] of page [[Aesculetin]] with values updated to verified values.}} |
|||
{{chembox |
{{chembox |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 477243187 |
||
|Reference=<ref> |
| Reference=<ref>{{cite web|url = http://www.sigmaaldrich.com/catalog/search/ProductDetail/ALDRICH/246573|title = Aesculetin|publisher = [[Sigma-Aldrich]]}}</ref> |
||
|ImageFile=Aesculetin.svg |
| ImageFile=Aesculetin.svg |
||
|ImageSize=200px |
|||
| |
| PIN=6,7-Dihydroxy-2''H''-1-benzopyran-2-one |
||
|OtherNames= |
| OtherNames=esculetin<br>cichorigenin<br>6,7-dihydroxycoumarin |
||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
| IUPHAR_ligand = 5180 |
|||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 4444764 |
| ChemSpiderID = 4444764 |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
Line 23: | Line 24: | ||
| CASNo_Ref = {{cascite|correct|CAS}} |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
| CASNo=305-01-1 |
| CASNo=305-01-1 |
||
⚫ | |||
⚫ | |||
| UNII = SM2XD6V944 |
|||
⚫ | |||
⚫ | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 490095 |
| ChEBI = 490095 |
||
| SMILES=C1=CC(=O)OC2=CC(=C(C=C21)O)O |
| SMILES=C1=CC(=O)OC2=CC(=C(C=C21)O)O |
||
}} |
}} |
||
|Section2={{Chembox Properties |
|Section2={{Chembox Properties |
||
| C=9 | H=6 | O=4 |
|||
| Formula = C<sub>9</sub>H<sub>6</sub>O<sub>4</sub> |
|||
| |
| MolarMass = 178.14 g mol<sup>−1</sup> |
||
| Appearance = white or light yellow powder |
|||
| ExactMass = 178.026609 |
|||
| Density = |
|||
| Appearance= |
|||
| MeltingPt = |
|||
| Density= |
|||
| BoilingPt = |
|||
| MeltingPt= |
|||
| Solubility = |
|||
| BoilingPt= |
|||
| Solubility= |
|||
}} |
}} |
||
|Section3={{Chembox Hazards |
|Section3={{Chembox Hazards |
||
| |
| MainHazards = |
||
| |
| FlashPt = |
||
| AutoignitionPt = |
|||
| Autoignition= |
|||
}} |
}} |
||
}} |
}} |
||
'''Aesculetin''' (also known as '''esculetin''', '''6,7-dihydroxycoumarin''' and '''cichorigenin''') is a derivative of [[coumarin]]. It is a natural [[lactone]] that derives from the intramolecular [[cyclization]] of a [[cinnamic acid]] derivative. |
|||
It is present in [[chicory]] and in many [[toxic plant|toxic]] and [[medicinal plant]]s, in form of [[glycoside]]s and [[caffeic acid]] conjugates.<ref>{{cite book|url = https://books.google.com/books?id=NmKF0hxhpdMC&q=esculetin&pg=PA388|title = Plant Biochemistry|year = 1997|editor1-last = Dey|editor1-first = P. M.|editor2-last = Harborne|editor2-first = J. B.|editor2-link = Jeffrey Barry Harborne|publisher = [[Academic Press]]|isbn = 9780122146749}}</ref> |
|||
This compound is used in some sunscreens, but there is evidence that it acts as a photosensitizer for DNA damage.<ref>{{cite journal|author1 = Hausen, B. M.|author2 = Schmieder, M.|title = The sensitizing capacity of coumarins (I)|journal = Contact Dermatitis|volume = 15|issue = 3|pages = 157–163|date=September 1986|pmid = 3780217|doi = 10.1111/j.1600-0536.1986.tb01317.x|s2cid = 221575607}}</ref> The sodium salt of its methyl-derivative is used in [[dermatology]] for the treatment of [[varicose veins]].<ref>{{cite web|url=http://www.in-cosmetics.com/ExhibitorLibrary/606/Permethol-VA-020209-FT_3.pdf |title="Permethol" Data Sheet }}{{dead link|date=June 2017 |bot=InternetArchiveBot |fix-attempted=yes }}</ref> |
|||
It is a blue [[fluorescence]] compound found in plants.<ref>{{cite journal|author1=Lang, M.|author2=Stober, F.|last3=Lichtenthaler|first3=H.K.|author-link3=Hartmut K. Lichtenthaler|year=1991|title=Fluorescence emission spectra of plant leaves and plant constituents|journal=Radiation and Environmental Biophysics|volume=30|issue=4|pages=333–347|doi=10.1007/BF01210517|pmid=1961919|s2cid=25892031}}</ref> [[Aesculin]], the [[glucoside]] of aesculetin, will [[fluorescence|fluoresce]] under long wave [[ultraviolet]] light (360 [[nanometre|nm]]). The hydrolysis of aesculin results in loss of this fluorescence. Aesculetin has the ability to quench the inner fluorescence of [[bovine serum albumin]].<ref>{{cite journal|title = Interaction between natural pharmaceutical homologues of coumarin and bovine serum albumin|last1 = Liu|first1 = X.-F.|last2 = Xia|first2 = Y.-M.|last3 = Fang|first3 = Y.|last4 = Zou|first4 = L.|last5 = Liu|first5 = L.-L.|journal = Huaxue Xuebao|year = 2004|volume = 62|issue = 16|pages = 1484–1490}} {{INIST|16312595}}</ref> |
|||
Aesculetin can be transformed into [[scopoletin]] (7-hydroxy-6-methoxycoumarin) and [[isoscopoletin]] (6-hydroxy-7-methoxycoumarin) through incubation with rat liver [[catechol-O-methyltransferase]].<ref>{{cite journal|title = 6.7-Dihydroxycoumarin (Aesculetin) as a substrate for catechol-''o''-methyltransferase|journal = [[Z. Naturforsch. C]]|year = 1976|issue = 5–6|volume = 31|pages = 280–284|author1 = Müller-Enoch, D.|author2 = Seidl, E.|author3 = Thomas, H.|doi = 10.1515/znc-1976-5-611|pmid = 134569|s2cid = 82796973|language = de|doi-access = free}}</ref> |
|||
Aesculetin can be synthesized by condensation of hydroxyhydroquinone triacetate with malonic acid in concentrated sulfuric acid.<ref>{{Cite book| publisher = I. K. International Pvt Ltd| isbn = 978-81-88237-33-3| last1 = Ahluwalia| first1 = V. K.| last2 = Bhagat| first2 = Pooja| last3 = Aggarwal| first3 = Renu| last4 = Chandra| first4 = Ramesh| title = Intermediates for Organic Synthesis| page = 213 | date = 2013-12-30}}</ref> |
|||
== See also == |
|||
* [[Umbelliferone]] |
|||
== References == |
|||
{{Reflist}} |
|||
{{Coumarin}} |
|||
[[Category:Coumarins]] |
|||
[[Category:Catechols]] |