Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Alovudine: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 451561076 of page Alovudine for the Chem/Drugbox validation project (updated: 'CAS_number'). |
|||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Alovudine|oldid=451561076}} 451561076] of page [[Alovudine]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 477318627 |
||
| IUPAC_name = |
| IUPAC_name = |
||
| image = Alovudine structure.png |
|||
| |
| image = Alovudine.svg |
||
| width = 200 |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| metabolism = |
| metabolism = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| |
| CAS_number_Ref = {{cascite|changed|??}} |
||
| CAS_number = |
| CAS_number = 25526-93-6 |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| PubChem = 33039 |
| PubChem = 33039 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 30578 |
| ChemSpiderID = 30578 |
||
| Line 33: | Line 31: | ||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| ChEMBL = 105318 |
| ChEMBL = 105318 |
||
| synonyms = |
| synonyms = Fluorothymidine |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=10 | H=13 | F= |
| C=10 | H=13 | F=1 | N=2 | O=4 |
||
| molecular_weight = 244.22 g/mol |
|||
| smiles = O=C/1NC(=O)N(\C=C\1C)[C@@H]2O[C@@H]([C@@H](F)C2)CO |
| smiles = O=C/1NC(=O)N(\C=C\1C)[C@@H]2O[C@@H]([C@@H](F)C2)CO |
||
| InChI = 1/C10H13FN2O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1 |
|||
| InChIKey = UXCAQJAQSWSNPQ-XLPZGREQBJ |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C10H13FN2O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1 |
| StdInChI = 1S/C10H13FN2O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1 |
||
| Line 46: | Line 40: | ||
| StdInChIKey = UXCAQJAQSWSNPQ-XLPZGREQSA-N |
| StdInChIKey = UXCAQJAQSWSNPQ-XLPZGREQSA-N |
||
}} |
}} |
||
'''Alovudine''' ('''fluorothymidine''') is an [[antiviral drug|antiviral]] agent which was being [[drug development|developed]] by [[Medivir]]. It was discontinued after a Phase II trial in 2005 due to toxicity. It is a [[DNA polymerase]] inhibitor.<ref>{{cite journal | vauthors = Georgopapadakou N | s2cid = 24703317 | title = Discontinued drugs in 2005: anti-infectives | journal = Expert Opinion on Investigational Drugs | volume = 16 | issue = 1 | pages = 1–10 | date = January 2007 | pmid = 17155849 | doi = 10.1517/13543784.16.1.1 }}</ref> |
|||
== See also == |
|||
* [[Fluorothymidine F-18]], an isotopically enriched version of alovudine used as a PET tracer |
|||
== References == |
|||
{{Reflist}} |
|||
{{HIVpharm}} |
|||
{{DNA antivirals}} |
|||
{{RNA antivirals}} |
|||
[[Category:Antiviral drugs|Antivirals]] |
|||
[[Category:Pyrimidinediones]] |
|||
[[Category:Organofluorides]] |
|||
[[Category:Abandoned drugs]] |
|||
{{antiinfective-drug-stub}} |
|||