Ammonium cerium(IV) sulfate: Difference between revisions
Appearance
Content deleted Content added
Benjah-bmm27 (talk | contribs) insert space |
Added bibcode. |
||
(38 intermediate revisions by 26 users not shown) | |||
Line 1: | Line 1: | ||
{{ |
{{Chembox |
||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 422716405 |
||
| ImageFile = Ammonium-cerium(IV)-sulfate-sample.jpg |
| ImageFile = Ammonium-cerium(IV)-sulfate-sample.jpg |
||
| ImageSize = 200px |
|||
| IUPACName = |
|||
| OtherNames = Ceric ammonium sulfate, ceric ammonium sulphate, ammonium cerium(IV) sulphate |
|||
| Section1 = {{Chembox Identifiers |
| Section1 = {{Chembox Identifiers |
||
| |
| CASNo_Ref = {{cascite|correct|??}} |
||
⚫ | |||
⚫ | |||
| InChIKey = NPYWBTRFOVOZNK-REWHXWOFAW |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/Ce.H3N.H2O4S/c;;1-5(2,3)4/h;1H3;(H2,1,2,3,4)/q+4;;/p-1 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = NPYWBTRFOVOZNK-UHFFFAOYSA-M |
|||
| CASNo = 10378-47-9 |
| CASNo = 10378-47-9 |
||
| |
| PubChem = 71308344 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| SMILES = [Ce+4].[NH4+].[O-]S([O-])(=O)=O |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| InChIKey = VCNAMBGKEDPVGQ-UHFFFAOYSA-J |
|||
| SMILES = [Ce+4].[O-]S(=O)(=O)[O-].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.O.O.[NH4+].[NH4+].[NH4+].[NH4+] |
|||
⚫ | |||
| Section2 = {{Chembox Properties |
| Section2 = {{Chembox Properties |
||
| |
| Formula = H<sub>20</sub>N<sub>4</sub>S<sub>4</sub>O<sub>18</sub>Ce |
||
| |
| MolarMass = 632.55 g/mol |
||
| |
| Appearance = Orange-colored solid |
||
| |
| MeltingPtC = 130 |
||
⚫ | |||
| MeltingPtC = 130 |
|||
| BoilingPt = |
|||
⚫ | |||
}} |
}} |
||
| Section3 = {{Chembox Hazards |
| Section3 = {{Chembox Hazards |
||
| |
| MainHazards = Irritant |
||
| |
| NFPA-S = OX |
||
| |
| NFPA-F = 1 |
||
| |
| NFPA-H = 2 |
||
| |
| NFPA-R = |
||
| |
| FlashPt = |
||
| GHSPictograms = {{GHS07}} |
|||
| Autoignition = |
|||
| GHSSignalWord= Warning |
|||
| HPhrases = {{H-phrases|315|319|335}} |
|||
| PPhrases = {{P-phrases|261|262|264|280|302+352|305+351+338|314|362|332+313|337+313}}<ref name=sds>{{cite web|title = Cerium(IV) Ammonium Sulfate Dihydrate|url = https://www.americanelements.com/cerium-iv-ammonium-sulfate-dihydrate-10378-47-9|publisher = [[American Elements]]|accessdate = September 13, 2018|archive-date = September 14, 2018|archive-url = https://web.archive.org/web/20180914024020/https://www.americanelements.com/cerium-iv-ammonium-sulfate-dihydrate-10378-47-9|url-status = live}}</ref> |
|||
| AutoignitionPt = |
|||
}} |
|||
| Section4 = {{Chembox Related |
|||
| OtherCompounds = [[Cerium(IV) sulfate]], [[Ceric ammonium nitrate]] |
|||
}} |
}} |
||
}} |
}} |
||
'''Ammonium cerium(IV) sulfate |
'''Ammonium cerium(IV) sulfate''' is an [[inorganic compound]] with the formula (NH<sub>4</sub>)<sub>4</sub>Ce(SO<sub>4</sub>)<sub>4</sub>·2H<sub>2</sub>O. It is an orange-colored solid. It is a strong oxidant, the potential for reduction is about +1.44V. [[Cerium(IV) sulfate]] is a related compound. |
||
==Structure== |
|||
Ammonium cerium(IV) sulfate is a very safe oxidizer, one of the most nontoxic ones. |
|||
A crystallographic study shows that the compound contains the Ce<sub>2</sub>(SO<sub>4</sub>)<sub>8</sub><sup>8−</sup> anion, where the cerium atoms are 9 coordinated by oxygen atoms belonging to sulfate groups, in a distorted tricapped trigonal prism. The compound is thus sometimes formulated as (NH<sub>4</sub>)<sub>8</sub>[Ce<sub>2</sub>(SO<sub>4</sub>)<sub>8</sub>]·4H<sub>2</sub>O.<ref name="ShanHuang1998">{{cite journal|last1=Shan|first1=Y.|last2=Huang|first2=S. D.|title=(NH<sub>4</sub>)<sub>8</sub>[Ce<sub>2</sub>(SO<sub>4</sub>)<sub>8</sub>]•4H<sub>2</sub>O|journal=Acta Crystallographica Section C|volume=54|issue=12|year=1998|pages=1744–1745|issn=0108-2701|doi=10.1107/S0108270198007057|pmid=9921692|bibcode=1998AcCrC..54.1744S }}</ref> |
|||
[[File:Dicerium-octasulfate-ion-from-ammonium-cerium(IV)-sulfate-tetrahydrate-xtal-3D-bs-17.png|250px|Structure of the [Ce<sub>2</sub>(SO<sub>4</sub>)<sub>8</sub>]<sup>8−</sup> ion in the crystal structure of ammonium cerium(IV) sulfate dihydrate]] |
|||
==References== |
|||
⚫ | |||
<references/> |
|||
⚫ | |||
⚫ | |||
{{Cerium compounds}} |
|||
{{Ammonium salts}} |
|||
⚫ | |||
{{inorganic-compound-stub}} |
|||
⚫ | |||
⚫ | |||
[[ar:كبريتات أمونيوم سيريوم]] |
|||
[[Category:Oxidizing agents]] |
|||
[[it:Solfato cerico ammonico]] |