Ansoxetine: Difference between revisions

(14 intermediate revisions by 14 users not shown)

Line 1:

{{Drugbox

| verifiedrevid = ~~443434674~~

| verifiedrevid = 451564773

| IUPAC_name = 6-[3-(dimethylamino)-1-phenylpropoxy]-2-phenyl-4''H''-chromen-4-one

| image = Ansoxetine.png

Line 17:

Line 18:

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 79130-64-6

| ATC_prefix = None

Line 23:

Line 25:

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 156100

| ChEMBL = 2104191

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3LY71185IQ

Line 28:

Line 31:

| C=26 | H=25 | N=1 | O=3

| molecular_weight = 399.48 g/mol

| smiles = O=C\1c4c(O/C(=C/1)c2ccccc2)ccc(OC(c3ccccc3)CCN(C)C)c4

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

Line 36:

Line 38:

}}

'''Ansoxetine''' is an [[antidepressant]] ~~which~~ was never marketed.<ref name="isbn0-412-46630-9">{{cite book | ~~author~~ = ~~David~~ ~~J. Triggle~~ | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 ~~| pages =~~ | isbn = 0-412-46630-~~9 | oclc = | doi = | accessdate =~~ }}</ref>

'''Ansoxetine''' is the trade name of a type of [[antidepressant]] medication. It was never marketed.<ref name="isbn0-412-46630-9">{{cite book | vauthors = Triggle DJ | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | isbn = 978-0-412-46630-4 }}</ref>

== References ==

[[Category:~~Amines~~]]

[[Category:Dimethylamino compounds]]

[[Category:Antidepressants]]

[[Category:~~Flavone drugs~~]]

[[Category:Flavones]]

[[Category:~~Phenol~~ ethers]]

[[Category:Hydroquinone ethers]]

[[Category:Abandoned drugs]]