Asocainol: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [ |
Importing Wikidata short description: "Chemical compound" (Shortdesc helper) |
||
| (20 intermediate revisions by 17 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 451307934 |
||
| IUPAC_name = (+-)-6,7,8,9-tetrahydro-2,12-dimethoxy-7-methyl-6-phenethyl-5H-dibenz(d,f)azonine-1-ol |
| IUPAC_name = (+-)-6,7,8,9-tetrahydro-2,12-dimethoxy-7-methyl-6-phenethyl-5H-dibenz(d,f)azonine-1-ol |
||
| image = |
| image = Asocainol Structure.svg |
||
| alt = |
| alt = |
||
| Line 25: | Line 27: | ||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 77400-65-8 |
| CAS_number = 77400-65-8 |
||
| ATCvet = |
| ATCvet = |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 2104050 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C27H31NO3/c1-28-16-15-20-10-13-23(30-2)18-24(20)26-21(11-14-25(31-3)27(26)29)17-22(28)12-9-19-7-5-4-6-8-19/h4-8,10-11,13-14,18,22,29H,9,12,15-17H2,1-3H3 |
| StdInChI = 1S/C27H31NO3/c1-28-16-15-20-10-13-23(30-2)18-24(20)26-21(11-14-25(31-3)27(26)29)17-22(28)12-9-19-7-5-4-6-8-19/h4-8,10-11,13-14,18,22,29H,9,12,15-17H2,1-3H3 |
||
| Line 43: | Line 48: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| chemical_formula = |
| chemical_formula = |
||
| molecular_weight = 417.54 g/mol |
|||
| smiles = O(c3cc2c1c(O)c(OC)ccc1CC(N(CCc2cc3)C)CCc4ccccc4)C |
| smiles = O(c3cc2c1c(O)c(OC)ccc1CC(N(CCc2cc3)C)CCc4ccccc4)C |
||
| InChI = 1/C27H31NO3/c1-28-16-15-20-10-13-23(30-2)18-24(20)26-21(11-14-25(31-3)27(26)29)17-22(28)12-9-19-7-5-4-6-8-19/h4-8,10-11,13-14,18,22,29H,9,12,15-17H2,1-3H3 |
|||
| InChIKey = IORHSKBXWWSQME-UHFFFAOYAV |
|||
}} |
}} |
||
Asocainol is a class 1a [[anti-arrhythmic]] compound.<ref>{{cite journal | |
'''Asocainol''' is a class 1a [[anti-arrhythmic]] compound.<ref>{{cite journal |vauthors=Thale J, Gülker H, Hagemense B, Rose D, Haverkamp W, Frenking B |title=Electrophysiologic effects of asocainol, a new antiarrhythmic agent with predominant class I action |journal=Arzneimittelforschung |volume=37 |issue=1 |pages=14–6 |date=January 1987 |pmid=3566851 }}</ref> |
||
==See also== |
|||
*[[Protostephanine]] {{CAS|549-28-0}} |
|||
==References== |
==References== |
||
{{reflist}} |
{{reflist}} |
||
[[Category:Antiarrhythmic agents]] |
|||
{{pharma-stub}} |
|||
{{cardiovascular-drug-stub}} |
|||