Jump to content

Azelnidipine: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey', 'CAS_number').
recategorized from Nitrobenzenes to Nitrobenzene derivatives
 
(45 intermediate revisions by 36 users not shown)
Line 1: Line 1:
{{Short description|Antihypertensive drug of the calcium channel blocker class}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
⚫
| IUPAC_name = O3-[1-[di(phenyl)methyl]azetidin-3-yl] O5-propan-2-yl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
| Watchedfields = changed
⚫
| image = Azelnidipine.png
| verifiedrevid = 458798059
| drug_name =
| type =
⚫
| IUPAC_name = 3-1-Benzhydryl-3-azetidinyl 5-isopropyl 2-amino-6-methyl-4-(''m''-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
⚫
| image = Azelnidipine structure.svg


<!--Clinical data-->
<!--Clinical data-->| alt =
| caption =
| tradename =
| tradename = CalBlock,AZUSA,Azovas
| Drugs.com = {{drugs.com|international|azelnidipine}}
| Drugs.com = {{drugs.com|international|azelnidipine}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| MedlinePlus =
| pregnancy_US = <!-- A / B / C / D / X -->
| licence_EU =
⚫
| pregnancy_category =
| licence_US =
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category =
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫
| legal_status = Rx-only
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status = Rx-only
| routes_of_administration = Oral
| routes_of_administration = Oral


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->| bioavailability =
⚫
| protein_bound =
| bioavailability =
⚫
| metabolism =
⚫
| protein_bound =
⚫
| elimination_half-life =
⚫
| metabolism =
⚫
| excretion = <!--Identifiers-->
⚫
| elimination_half-life =
| CAS_number_Ref = {{cascite|changed|??}}
| excretion =
⚫
| CAS_number = 123524-52-7
⚫
| ATC_prefix = none
⚫
| ATC_suffix =
⚫
| ATC_supplemental =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1275868
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫
| StdInChI = 1S/C33H34N4O6/c1-20(2)42-32(38)27-21(3)35-31(34)29(28(27)24-15-10-16-25(17-24)37(40)41)33(39)43-26-18-36(19-26)30(22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-17,20,26,28,30,35H,18-19,34H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫
| StdInChIKey = ZKFQEACEUNWPMT-UHFFFAOYSA-N
⚫
| PubChem = 65948
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
| ChemSpiderID = 59352
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| UNII = PV23P19YUG
| KEGG_Ref = {{keggcite|correct|kegg}}
⚫
| KEGG = D01145


⚫
<!--Chemical data-->| chemical_formula =
⚫
<!--Identifiers-->
| C = 33
⚫
| CAS_number = <!-- blanked - oldvalue: 123524-52-7 -->
| H = 34
⚫
| ATC_prefix = none
| N = 4
⚫
| ATC_suffix =
| O = 6
⚫
| ATC_supplemental =
⚫
| smiles = [O-][N+](=O)c1cccc(c1)C5C(/C(=O)OC(C)C)=C(\NC(\N)=C5\C(=O)OC4CN(C(c2ccccc2)c3ccccc3)C4)C
⚫
| StdInChI = 1S/C33H34N4O6/c1-20(2)42-32(38)27-21(3)35-31(34)29(28(27)24-15-10-16-25(17-24)37(40)41)33(39)43-26-18-36(19-26)30(22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-17,20,26,28,30,35H,18-19,34H2,1-3H3
⚫
| StdInChIKey = ZKFQEACEUNWPMT-UHFFFAOYSA-N
⚫
| PubChem = 65948
⚫
| DrugBank =
⚫
| ChemSpiderID = 59352
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| UNII = PV23P19YUG
⚫
| KEGG = D01145

<!--Chemical data-->
⚫
| chemical_formula =
| C=33 | H=34 | N=4 | O=6
| molecular_weight = 582.64 g/mol
⚫
| smiles = [O-][N+](=O)c1cccc(c1)C5C(/C(=O)OC(C)C)=C(\NC(\N)=C5\C(=O)OC4CN(C(c2ccccc2)c3ccccc3)C4)C
| InChI = 1/C33H34N4O6/c1-20(2)42-32(38)27-21(3)35-31(34)29(28(27)24-15-10-16-25(17-24)37(40)41)33(39)43-26-18-36(19-26)30(22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-17,20,26,28,30,35H,18-19,34H2,1-3H3
| InChIKey = ZKFQEACEUNWPMT-UHFFFAOYAU
}}
}}


'''Azelnidipine''' ([[International Nonproprietary Name|INN]]; marketed under the brand name '''Calblock''') is a [[dihydropyridine]] [[calcium channel blocker]].
'''Azelnidipine''' ([[International Nonproprietary Name|INN]]; marketed under the brand name '''CalBlock — カルブロック''') is a [[dihydropyridine]] [[calcium channel blocker]]. Azelnidipine is L and T calcium channel blocker.
It is sold in [[Japan]] by [[Daiichi-Sankyo]] pharmaceuticals, Inc.
It is sold in [[Japan]] by [[Daiichi-Sankyo]] pharmaceuticals, Inc.
Unlike [[nicardipine]], it has a gradual onset and has a long-lasting hypotensive effect, with little increase in heart rate.<ref name="pmid2810942">{{cite journal |author=Oizumi K, Nishino H, Koike H, Sada T, Miyamoto M, Kimura T |title=Antihypertensive effects of CS-905, a novel dihydropyridine Ca++ channel blocker |journal=Jpn. J. Pharmacol. |volume=51 |issue=1 |pages=57–64 |year=1989 |month=September |pmid=2810942 |doi= 10.1254/jjp.51.57|url=http://joi.jlc.jst.go.jp/JST.Journalarchive/jphs1951/51.57?from=PubMed |format={{dead link|date=April 2009}} &ndash; <sup>[http://scholar.google.co.uk/scholar?hl=en&lr=&q=intitle%3AAntihypertensive+effects+of+CS-905%2C+a+novel+dihydropyridine+Ca%2B%2B+channel+blocker&as_publication=Jpn.+J.+Pharmacol.&as_ylo=1989&as_yhi=1989&btnG=Search Scholar search]</sup>}}</ref>
Unlike [[nicardipine]], it has a gradual onset and has a long-lasting antihypertensive effect, with little increase in heart rate. Drug Controller General Of India (DCGI) has approved the use of azelnipine in India. It is launched under the brand name Azusa (ajanta pharma ltd.)<ref name="pmid2810942">{{cite journal |vauthors=Oizumi K, Nishino H, Koike H, Sada T, Miyamoto M, Kimura T |title=Antihypertensive effects of CS-905, a novel dihydropyridine Ca++ channel blocker |journal=Jpn. J. Pharmacol. |volume=51 |issue=1 |pages=57–64 |date=September 1989 |pmid=2810942 |doi=10.1254/jjp.51.57 |url=http://joi.jlc.jst.go.jp/JST.Journalarchive/jphs1951/51.57?from=PubMed |doi-access=free }}<sup>[https://scholar.google.co.uk/scholar?hl=en&lr=&q=intitle%3AAntihypertensive+effects+of+CS-905%2C+a+novel+dihydropyridine+Ca%2B%2B+channel+blocker&as_publication=Jpn.+J.+Pharmacol.&as_ylo=1989&as_yhi=1989&btnG=Search Scholar search]</sup> {{Webarchive|url=https://web.archive.org/web/20210930120520/https://scholar.google.co.uk/scholar?hl=en&lr=&q=intitle%3AAntihypertensive+effects+of+CS-905%2C+a+novel+dihydropyridine+Ca%2B%2B+channel+blocker&as_publication=Jpn.+J.+Pharmacol.&as_ylo=1989&as_yhi=1989&btnG=Search |date=2021-09-30 }}</ref> In 2020.


==References==
==References==
Line 59: Line 73:
[[Category:Carboxylate esters]]
[[Category:Carboxylate esters]]
[[Category:Azetidines]]
[[Category:Azetidines]]
[[Category:Nitrobenzenes]]
[[Category:Nitrobenzene derivatives]]
[[Category:Isopropyl esters]]


{{Cardiovascular-drug-stub}}
{{Cardiovascular-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"