Jump to content

BMY-7378: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
PotatoBot (talk | contribs)
Bots
51,239 edits
m Stub sorting and placement of stub template(s): nervous-system-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.
 
(18 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 424684284
| verifiedrevid = 449578270
| IUPAC_name = 8-(2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl)-8-azaspiro[4.5]decane-7,9-dione
| IUPAC_name = 8-(2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl)-8-azaspiro[4.5]decane-7,9-dione
| image = BMY-7378_structure.png
| image = Bmy-7378.svg
| width = 200
| width = 200


<!--Clinical data-->
<!--Clinical data-->| tradename =
| tradename =
| pregnancy_AU =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_CA =
| legal_UK =
| legal_UK =
| legal_US =
| legal_US =
| legal_status =
⚫
| routes_of_administration = <!--Pharmacokinetic data-->
| legal_status =
⚫
| bioavailability =
⚫
| routes_of_administration =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion = <!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
⚫
| CAS_number = 21102-95-4
| UNII_Ref = {{fdacite|correct|FDA}}
| ChEMBL = 13647
| UNII = KC07KV8T5O
⚫
| ATC_prefix =
⚫
| ATC_suffix =
⚫
| PubChem = 2419
⚫
| IUPHAR_ligand = 9
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 2325
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C22H31N3O3/c1-28-19-7-3-2-6-18(19)24-13-10-23(11-14-24)12-15-25-20(26)16-22(17-21(25)27)8-4-5-9-22/h2-3,6-7H,4-5,8-17H2,1H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = AYYCFGDXLUPJAQ-UHFFFAOYSA-N


<!--Pharmacokinetic data-->
<!--Chemical data-->| C = 22
| H = 31
⚫
| bioavailability =
| N = 3
⚫
| protein_bound =
| O = 3
⚫
| metabolism =
⚫
| smiles = C4CCCC4(CC1=O)CC(=O)N1CCN3CCN(CC3)c2ccccc2OC
⚫
| elimination_half-life =
| excretion =
| melting_point =
⚫
| melting_high =

⚫
<!--Identifiers-->
⚫
| CAS_number = 21102-95-4
⚫
| ATC_prefix =
⚫
| ATC_suffix =
⚫
| PubChem = 2419
⚫
| IUPHAR_ligand = 9

<!--Chemical data-->
| C=22 | H=31 | N=3 | O=3
| molecular_weight = 385.499 g/mol
⚫
| smiles = C4CCCC4(CC1=O)CC(=O)N1CCN3CCN(CC3)c2ccccc2OC
| melting_point =
⚫
| melting_high =
}}
}}


'''BMY-7,378''' is a [[5-HT1A|5-HT<sub>1A</sub> receptor]] weak [[partial agonist]]/[[receptor_antagonist|antagonist]] and [[α1-adrenergic|α<sub>1D</sub>-adrenergic receptor]] antagonist.<ref name="pmid7713154">{{cite journal | author = Goetz AS, King HK, Ward SD, True TA, Rimele TJ, Saussy DL | title = BMY 7378 is a selective antagonist of the D subtype of alpha 1-adrenoceptors | journal = European Journal of Pharmacology | volume = 272 | issue = 2-3 | pages = R5–6 | year = 1995 | month = January | pmid = 7713154 | doi = 10.1016/0014-2999(94)00751-R| url = }}</ref>
'''BMY-7,378''' is a [[5-HT1A|5-HT<sub>1A</sub> receptor]] weak [[partial agonist]]/[[receptor antagonist|antagonist]] and [[α1-adrenergic|α<sub>1D</sub>-adrenergic receptor]] antagonist.<ref name="pmid7713154">{{cite journal | vauthors = Goetz AS, King HK, Ward SD, True TA, Rimele TJ, Saussy DL | title = BMY 7378 is a selective antagonist of the D subtype of alpha 1-adrenoceptors | journal = European Journal of Pharmacology | volume = 272 | issue = 2–3 | pages = R5–6 |date=January 1995 | pmid = 7713154 | doi = 10.1016/0014-2999(94)00751-R}}</ref>


== References ==
== References ==
{{Reflist|2}}
{{Reflist|2}}



{{Adrenergics}}
{{Adrenergics}}
{{Serotonergics}}
{{Serotonergics}}


[[Category:2-Methoxyphenyl compounds]]

⚫
[[Category:Phenylpiperazines]]

⚫
[[Category:Phenol ethers]]
[[Category:Piperazines]]
[[Category:Imides]]
[[Category:Imides]]


Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"