Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Balofloxacin: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{drugbox}} taken from revid 477353269 of page Balofloxacin for the Chem/Drugbox validation project (updated: 'CAS_number').
 
 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Balofloxacin|oldid=477353269}} 477353269] of page [[Balofloxacin]] with values updated to verified values.}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 461211442
| verifiedrevid = 477370396
| IUPAC_name = 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylaminopiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid
| IUPAC_name = 1-Cyclopropyl-6-fluoro-8-methoxy-7-(3-methylaminopiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid
| image = Balofloxacin.png
| image = Balofloxacin structure.svg


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound =
| protein_bound =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = <!-- blanked - oldvalue: 127294-70-6 -->
| CAS_number = 127294-70-6
| ATC_prefix = none
| ATC_prefix = none
| ATC_suffix =
| ATC_suffix =
| ATC_supplemental =
| ATC_supplemental =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1210954
| ChEMBL = 1210954
| PubChem = 65958
| PubChem = 65958
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q022B63JPM
| UNII = Q022B63JPM
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 59361
| ChemSpiderID = 59361
| InChI = 1/C20H24FN3O4/c1-22-11-4-3-7-23(9-11)17-15(21)8-13-16(19(17)28-2)24(12-5-6-12)10-14(18(13)25)20(26)27/h8,10-12,22H,3-7,9H2,1-2H3,(H,26,27)
| InChIKey = MGQLHRYJBWGORO-UHFFFAOYAR
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H24FN3O4/c1-22-11-4-3-7-23(9-11)17-15(21)8-13-16(19(17)28-2)24(12-5-6-12)10-14(18(13)25)20(26)27/h8,10-12,22H,3-7,9H2,1-2H3,(H,26,27)
| StdInChI = 1S/C20H24FN3O4/c1-22-11-4-3-7-23(9-11)17-15(21)8-13-16(19(17)28-2)24(12-5-6-12)10-14(18(13)25)20(26)27/h8,10-12,22H,3-7,9H2,1-2H3,(H,26,27)
Line 48: Line 47:


<!--Chemical data-->
<!--Chemical data-->
| chemical_formula =
| chemical_formula =
| C=20 | H=24 | F=1 | N=3 | O=4
| C=20 | H=24 | F=1 | N=3 | O=4
| molecular_weight = 389.42 g/mol
| smiles = CNC1CCCN(C1)C2=C(C=C3C(=C2OC)N(C=C(C3=O)C(=O)O)C4CC4)F
| smiles = CNC1CCCN(C1)C2=C(C=C3C(=C2OC)N(C=C(C3=O)C(=O)O)C4CC4)F
}}
}}

'''Balofloxacin''' ([[International Nonproprietary Name|INN]]) is a [[fluoroquinolone]] [[antibiotic]]. It is sold under the brand name '''Q-Roxin''' in [[Korea]], and under various names in India.<ref>{{cite journal | vauthors = Alksne L | title = Balofloxacin Choongwae | journal = Current Opinion in Investigational Drugs | volume = 4 | issue = 2 | pages = 224–9 | date = February 2003 | pmid = 12669387 }}</ref> It is not approved by the FDA for use in the United States.

== Pharmacodynamics ==
Balofloxacin is a [[fluoroquinolone]] that has a broad spectrum in vitro activity against a wide range of [[Gram-positive]] and [[Gram-negative]] bacteria, with enhanced activity against Gram positive bacteria, including MRSA and Streptococcus pneumoniae.<ref>{{Cite web |title=NCATS Inxight Drugs — BALOFLOXACIN |url=https://drugs.ncats.io/drug/Q022B63JPM |access-date=2022-07-28 |website=drugs.ncats.io |language=en}}</ref> It functions by inhibiting the action of DNA-gyrase, preventing bacterial cells from reproducing or repairing themselves, resulting in cellular death.<ref name=":1">{{Cite web |title=BALOFLOXACINhome: Uses, Side Effects and Medicines {{!}} Apollo Pharmacy |url=https://www.apollopharmacy.in/salt/BALOFLOXACINhome |access-date=2022-07-28 |website=www.apollopharmacy.in}}</ref>

== Side Effects ==
Vomiting, headache, dizziness, stomach pain, nausea, diarrhea and decreased liver function are the most common side effects. In rare cases, Balofloxacin can lead to or worsen tendinitis,<ref name=":1" /> and muscular damage.<ref name=":1" />

== See also ==
* [[Quinolones]]

== References ==
{{reflist}}

{{QuinoloneAntiBiotics}}

[[Category:Fluoroquinolone antibiotics]]
[[Category:Phenol ethers]]
[[Category:Piperidines]]
[[Category:Cyclopropyl compounds]]
[[Category:Carboxylic acids]]
[[Category:Aromatic ketones]]

{{antibiotic-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"