Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Benfluralin: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 470459127 of page Benfluralin for the Chem/Drugbox validation project (updated: 'CASNo').
 
m added Category Preemergent herbicides
 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Benfluralin|oldid=470459127}} 470459127] of page [[Benfluralin]] with values updated to verified values.}}
{{Chembox
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 486406020
| ImageFile = Benfluralin.svg
| ImageFile = Benfluralin.svg
| ImageSize = 150px
| ImageSize = 150px
| IUPACName = ''N''-Butyl-''N''-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline
| PIN = ''N''-Butyl-''N''-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline
| OtherNames = Benefin; Benfluraline; α,α,α-Trifluoro-2,6-dinitro-''N'',''N''-ethylbutyl-''p''-toluidine
| OtherNames = Benefin; Benfluraline; α,α,α-Trifluoro-2,6-dinitro-''N'',''N''-ethylbutyl-''p''-toluidine
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo = <!-- blanked - oldvalue: 1861-40-1 -->
| CASNo = 1861-40-1
| CASNo_Ref = {{cascite|correct|}}
| CASNo_Ref = {{cascite|changed|??}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 28224BUY6R
| UNII = 28224BUY6R
| PubChem = 2319
| PubChem = 2319
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2229
| ChemSpiderID = 2229
⚫
| SMILES = [O-][N+](=O)c1cc(cc([N+]([O-])=O)c1N(CCCC)CC)C(F)(F)F
| ChEBI_Ref = {{ebicite|changed|EBI}}
⚫
| InChI = 1/C13H16F3N3O4/c1-3-5-6-17(4-2)12-10(18(20)21)7-9(13(14,15)16)8-11(12)19(22)23/h7-8H,3-6H2,1-2H3
| ChEBI = 132878
⚫
| InChIKey = SMDHCQAYESWHAE-UHFFFAOYAK
⚫
| SMILES = [O-][N+](=O)c1cc(cc([N+]([O-])=O)c1N(CCCC)CC)C(F)(F)F
⚫
| StdInChI = 1S/C13H16F3N3O4/c1-3-5-6-17(4-2)12-10(18(20)21)7-9(13(14,15)16)8-11(12)19(22)23/h7-8H,3-6H2,1-2H3
⚫
| InChI = 1/C13H16F3N3O4/c1-3-5-6-17(4-2)12-10(18(20)21)7-9(13(14,15)16)8-11(12)19(22)23/h7-8H,3-6H2,1-2H3
⚫
| StdInChIKey = SMDHCQAYESWHAE-UHFFFAOYSA-N
⚫
| InChIKey = SMDHCQAYESWHAE-UHFFFAOYAK
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫
| StdInChI = 1S/C13H16F3N3O4/c1-3-5-6-17(4-2)12-10(18(20)21)7-9(13(14,15)16)8-11(12)19(22)23/h7-8H,3-6H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫
| StdInChIKey = SMDHCQAYESWHAE-UHFFFAOYSA-N
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=13|H=16|F=3|N=3|O=4
| C=13|H=16|F=3|N=3|O=4
| Appearance = Orange crystalline solid<ref name=GESTIS>{{GESTIS|ZVG=490343}}</ref>
| Appearance = Orange crystalline solid<ref name=GESTIS>{{GESTIS|ZVG=490343}}</ref>
| Density =
| Density = 1.338 g/mL
| MeltingPtCL = 65.0
| MeltingPtC = 65.0 to 65.5
⚫
| MeltingPt_ref = <ref name=GESTIS/>
| MeltingPtCH = 65.5
| BoilingPtC = 121 to 122
⚫
| Melting_notes = <ref name=GESTIS/>
| BoilingPt_notes = at 0.6 mbar
| BoilingPtCL = 121
⚫
| BoilingPt_ref = <ref name=GESTIS/>
| BoilingPtCH = 122
| Boiling_notes = at 0.6 mbar<ref name=GESTIS/>
| Solubility = 1 mg/L<ref name=GESTIS/>
⚫
| Solubility = 1 mg/L<ref name=GESTIS/>
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
}}
}}
}}
}}
'''Benfluralin''' is an [[herbicide]] of the [[dinitroaniline]] class. The [[mechanism of action]] of benfluralin involves inhibition of root and shoot development.<ref>[http://www.globachem.com/Defaultb878.html?CID=7133&SLID=1#Benfluralin Agrochemicals] {{webarchive |url=https://web.archive.org/web/20120406170823/http://www.globachem.com/Defaultb878.html?CID=7133&SLID=1#Benfluralin |date=April 6, 2012 }}, Globachem</ref>

It is used to control grasses and other weeds. Annual use in the United States was approximately {{convert|700,000|lb|kg}} in 2004.<ref>[http://www.epa.gov/oppsrrd1/REDs/factsheets/benfluralin_fs.pdf R.E.D. FACTS: Benfluralin] {{webarchive |url=https://web.archive.org/web/20110915205513/http://www.epa.gov/oppsrrd1/REDs/factsheets/benfluralin_fs.pdf |date=September 15, 2011 }}, United States Environmental Protection Agency</ref>

==References==
{{reflist}}

{{herbicides}}

{{organic-compound-stub}}

[[Category:Herbicides]]
[[Category:Anilines]]
[[Category:Trifluoromethyl compounds]]
[[Category:Nitrobenzene derivatives]]
[[Category:Preemergent herbicides]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"