Bis(pyridine)iodonium(I) tetrafluoroborate: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{Chembox
-| verifiedrevid = 417443862
+| verifiedrevid = 428839640
 | ImageFile = Bis(pyridine)iodonium(I) tetrafluoroborate.png
 | ImageFile1 =Bis(pyridine)iodonium(I) tetrafluoroborate from crystal.png
+| IUPACName = bis(pyridin-1-ium-1-yl)iodanuide tetrafluoroborate
-|  ImageSize =
+| OtherNames =Barluenga's Reagent
-|  ImageAlt =
+|Section1={{Chembox Identifiers
-| IUPACName =
+| CASNo = 15656-28-7
-| OtherNames =
+| CASNo_Ref = {{cascite|correct|CAS}}
-| Section1 = {{Chembox Identifiers
+| UNII_Ref = {{fdacite|correct|FDA}}
-|  CASNo =
+| UNII = 96046808SX
-|  PubChem =
-|  SMILES = }}
+| PubChem = 10883201
+| PubChem_Comment = erroneous content
-| Section2 = {{Chembox Properties
+| ChemSpiderID = 2016454
-|  C = 10 | H = 10 | B = 1 | F = 4 | I = 1 | N = 2
+| StdInChI=1S/C10H10IN2.BF4/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2-1(3,4)5/h1-10H;/q+1;-1
-|  MolarMass =
+| StdInChIKey = BMDSRCBKJZCUBH-UHFFFAOYSA-N
-|  Appearance =
+| SMILES = [B-](F)(F)(F)F.C1=CC=CC=N1[I+]N2C=CC=CC=2 }}
-|  Density =
+|Section2={{Chembox Properties
-|  MeltingPt =
+| C=10 | H=10 | B=1 | F=4 | I=1 | N=2
-|  BoilingPt =
+ }}
-|  Solubility = }}
-| Section3 = {{Chembox Hazards
+|Section3={{Chembox Hazards
+| GHSPictograms = {{GHS07}}
-|  MainHazards =
+| GHSSignalWord = Warning
-|  FlashPt =
+| HPhrases = {{H-phrases|315|319|335}}
-|  Autoignition = }}
+| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}
 }}
+}}
-'''Bis(pyridine)iodonium(I) tetrafluoroborate''' or '''Barluenga's reagent''' named after J. Barluenga,<ref>{{cite journal | last1 = Martín | first1 = Nazario | last2 = Muñiz | first2 = Kilian | title = Congratulations to Professor José Barluenga on his 70th Birthday | journal = Chemistry - A European Journal | volume = 16 | issue = 32 | pages = 9696–9697 | year = 2010 | doi = 10.1002/chem.201001986 }}</ref> is a mild iodinating reagent. Commercially available, it may be prepared by reacting [[iodine]] with [[pyridine]] in the presence of [[silver tetrafluoroborate]] supported on [[silica gel]].<ref>{{OrgSynth | prep = v87p0288 | title = Safe and Scalable Preparation of Barluenga's Reagent | author = Justin M. Chalker, Amber L. Thompson, and Benjamin G. Davis | volume = 87 | pages = 288 | year = 2010}}</ref>
+'''Bis(pyridine)iodonium(I) tetrafluoroborate''' or '''Barluenga's reagent''', named after [[José Barluenga]],<ref>{{cite journal | last1 = Martín | first1 = Nazario | last2 = Muñiz | first2 = Kilian | title = Congratulations to Professor José Barluenga on his 70th Birthday | journal = Chemistry: A European Journal | volume = 16 | issue = 32 | pages = 9696–9697 | year = 2010 | doi = 10.1002/chem.201001986 | doi-access =  }}</ref> is a mild iodinating reagent. Commercially available, it may be prepared by reacting [[iodine]] with [[pyridine]] in the presence of [[silver tetrafluoroborate]] supported on [[silica gel]].<ref>{{OrgSynth | prep = v87p0288 | title = Safe and Scalable Preparation of Barluenga's Reagent | author = Justin M. Chalker | author2 = Amber L. Thompson | author3 = Benjamin G. Davis | name-list-style=amp | volume = 87 | pages = 288 | year = 2010}}</ref>
 ==References==
+{{reflist}}
-<references/>
+{{Tetrafluoroborates}}
 [[Category:Tetrafluoroborates]]
 [[Category:Iodine compounds]]
+[[Category:Reagents for organic chemistry]]
+[[Category:Phenyl compounds]]