Bis(pyridine)iodonium(I) tetrafluoroborate: Difference between revisions
Appearance
Content deleted Content added
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation ( |
m Open access bot: doi updated in citation with #oabot. |
||
(23 intermediate revisions by 17 users not shown) | |||
Line 1: | Line 1: | ||
{{Chembox |
{{Chembox |
||
| verifiedrevid = |
| verifiedrevid = 428839640 |
||
| ImageFile = Bis(pyridine)iodonium(I) tetrafluoroborate.png |
| ImageFile = Bis(pyridine)iodonium(I) tetrafluoroborate.png |
||
| ImageFile1 =Bis(pyridine)iodonium(I) tetrafluoroborate from crystal.png |
| ImageFile1 =Bis(pyridine)iodonium(I) tetrafluoroborate from crystal.png |
||
| IUPACName = bis(pyridin-1-ium-1-yl)iodanuide tetrafluoroborate |
|||
| ImageSize = |
|||
⚫ | |||
| ImageAlt = |
|||
⚫ | |||
| IUPACName = |
|||
⚫ | |||
⚫ | |||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
⚫ | |||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
⚫ | |||
| UNII = 96046808SX |
|||
| PubChem = |
|||
| |
| PubChem = 10883201 |
||
| PubChem_Comment = erroneous content |
|||
⚫ | |||
| ChemSpiderID = 2016454 |
|||
⚫ | |||
| StdInChI=1S/C10H10IN2.BF4/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2-1(3,4)5/h1-10H;/q+1;-1 |
|||
| MolarMass = |
|||
| StdInChIKey = BMDSRCBKJZCUBH-UHFFFAOYSA-N |
|||
| Appearance = |
|||
| SMILES = [B-](F)(F)(F)F.C1=CC=CC=N1[I+]N2C=CC=CC=2 }} |
|||
| Density = |
|||
⚫ | |||
| MeltingPt = |
|||
⚫ | |||
| BoilingPt = |
|||
}} |
|||
| Solubility = }} |
|||
| |
|Section3={{Chembox Hazards |
||
| GHSPictograms = {{GHS07}} |
|||
| MainHazards = |
|||
| GHSSignalWord = Warning |
|||
| FlashPt = |
|||
| HPhrases = {{H-phrases|315|319|335}} |
|||
| Autoignition = }} |
|||
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} |
|||
}} |
}} |
||
}} |
|||
'''Bis(pyridine)iodonium(I) tetrafluoroborate''' or '''Barluenga's reagent''' named after |
'''Bis(pyridine)iodonium(I) tetrafluoroborate''' or '''Barluenga's reagent''', named after [[José Barluenga]],<ref>{{cite journal | last1 = Martín | first1 = Nazario | last2 = Muñiz | first2 = Kilian | title = Congratulations to Professor José Barluenga on his 70th Birthday | journal = Chemistry: A European Journal | volume = 16 | issue = 32 | pages = 9696–9697 | year = 2010 | doi = 10.1002/chem.201001986 | doi-access = }}</ref> is a mild iodinating reagent. Commercially available, it may be prepared by reacting [[iodine]] with [[pyridine]] in the presence of [[silver tetrafluoroborate]] supported on [[silica gel]].<ref>{{OrgSynth | prep = v87p0288 | title = Safe and Scalable Preparation of Barluenga's Reagent | author = Justin M. Chalker | author2 = Amber L. Thompson | author3 = Benjamin G. Davis | name-list-style=amp | volume = 87 | pages = 288 | year = 2010}}</ref> |
||
==References== |
==References== |
||
{{reflist}} |
|||
<references/> |
|||
{{Tetrafluoroborates}} |
|||
[[Category:Tetrafluoroborates]] |
[[Category:Tetrafluoroborates]] |
||
[[Category:Iodine compounds]] |
[[Category:Iodine compounds]] |
||
[[Category:Reagents for organic chemistry]] |
|||
[[Category:Phenyl compounds]] |