Calcium bicarbonate: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
No edit summary
 
(79 intermediate revisions by 67 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound existing only in aqueous solution (Ca(HCO₃)₂)}}
{{Chembox
{{Chembox
⚫
|verifiedrevid=430733457
| Watchedfields = changed
⚫
|Name=Calcium bicarbonate
⚫
| verifiedrevid = 399701812
| Name = Calcium bicarbonate
|SystematicName=Calcium bicarbonate
|OtherNames=Cleansing lime<br/>Bicarbonate of lime<br/>Rain salt
⚫
| ImageFile = Calcium bicarbonate.png
| ImageName = Calcium bicarbonate
|ImageFile=Calcium bicarbonate.png
| IUPACName = Calcium hydrogen carbonate
|ImageName=Calcium bicarbonate
| OtherNames = Calcium bicarbonate
|IUPACName=Calcium hydrogencarbonate
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| SMILES = [Ca+2].[O-]C(=O)O.[O-]C(=O)O
| SMILES = OC(=O)O[Ca]OC(=O)O
| SMILES1 = [Ca+2].[O-]C(=O)O.[O-]C(=O)O
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8351767
| ChemSpiderID = 8351767
| PubChem = 10176262
| PubChem = 10176262
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7PRA4BLM2L
| InChI = 1/2CH2O3.Ca/c2*2-1(3)4;/h2*(H2,2,3,4);/q;;+2/p-2
| InChI = 1/2CH2O3.Ca/c2*2-1(3)4;/h2*(H2,2,3,4);/q;;+2/p-2
| InChIKey = NKWPZUCBCARRDP-NUQVWONBAN
| InChIKey = NKWPZUCBCARRDP-NUQVWONBAN
Line 18: Line 22:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NKWPZUCBCARRDP-UHFFFAOYSA-L
| StdInChIKey = NKWPZUCBCARRDP-UHFFFAOYSA-L
| CASNo_Ref = {{cascite|correct|CAS}}
⚫
| CASNo =
| RTECS =
| CASNo = 3983-19-5
⚫
| RTECS =
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula = Ca(HCO<sub>3</sub>)<sub>2</sub>
| Formula = Ca(HCO<sub>3</sub>)<sub>2</sub>
| MolarMass = 162.11464 g/mol
| MolarMass = 162.11464 g/mol
| Appearance =
| Appearance =
| Density =
| Density =
| Solubility = 16.1 g/100 mL (0 °C) <br> 16.6 g/100 mL (20°C) <br> 18.4 g/100 mL (100 °C)
| Solubility = 16.1 g/100 mL (0 °C) <br> 16.6 g/100 mL (20 °C) <br> 18.5 g/100 mL (100 °C) {{reference needed|reason=This data seems erratic.|date=July 2022}}
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
| pKa =
| pKa =
| pKb =
| pKb =
| Viscosity =
| Viscosity =
}}
}}
| Section3 = {{Chembox Structure
|Section3={{Chembox Structure
| MolShape =
| MolShape =
| Coordination =
| Coordination =
| CrystalStruct =
| CrystalStruct =
| Dipole =
| Dipole =
}}
}}
| Section7 = {{Chembox Hazards
|Section7={{Chembox Hazards
| ExternalMSDS =
| ExternalSDS =
| MainHazards = Irritant
| MainHazards = Irritant
| FlashPt = Non-Flammable
| FlashPt = Non-flammable
| RPhrases = {{R36}}
| SPhrases =
}}
}}
| Section8 = {{Chembox Related
|Section8={{Chembox Related
| OtherAnions =
| OtherAnions =
| OtherCations =
| OtherCations = [[Magnesium bicarbonate]]
| OtherCompounds = [[Sodium bicarbonate]]
| Related [[?]]
| causes you to be attracted to sheep
| OtherCpds =
}}
}}
}}
}}


'''Calcium bicarbonate''' (Ca(HCO<sub>3</sub>)<sub>2</sub>), also called '''calcium hydrogencarbonate''', does not refer to a known solid compound; it exists only in [[aqueous]] solution containing the [[calcium]] (Ca<sup>2+</sup>), [[bicarbonate]] (HCO<sub>3</sub><sup>–</sup>), and [[carbonate]] (CO<sub>3</sub><sup>2–</sup>) ions, together with dissolved [[carbon dioxide]] (CO<sub>2</sub>). The relative concentrations of these carbon-containing species depend on the pH; bicarbonate predominates within the range 6.36-10.25 in fresh water.
'''Calcium bicarbonate''', also called '''calcium hydrogencarbonate''', has the chemical formula Ca(HCO<sub>3</sub>)<sub>2</sub>. The term does not refer to a known solid compound; it exists only in [[aqueous]] solution containing [[calcium]] (Ca<sup>2+</sup>), [[bicarbonate]] ({{chem|HCO|3|−}}), and [[carbonate]] ({{chem|CO|3|2−}}) ions, together with dissolved [[carbon dioxide]] (CO<sub>2</sub>). The relative concentrations of these carbon-containing species depend on the [[pH]]; bicarbonate predominates within the range 6.36–10.25 in fresh water.


All waters in contact with the atmosphere absorb carbon dioxide, and as these waters come into contact with rocks and sediments they acquire metal ions, most commonly calcium and magnesium, so most natural waters that come from streams, lakes, and especially wells, can be regarded as dilute solutions of these bicarbonates. These [[hard water]]s tend to form carbonate scale in pipes and boilers and they react with soaps to form an undesirable scum.
All waters in contact with the atmosphere absorb carbon dioxide, and as these waters come into contact with rocks and sediments they acquire metal ions, most commonly calcium and [[magnesium]], so most natural waters that come from streams, lakes, and especially wells, can be regarded as dilute solutions of these bicarbonates. These [[hard water]]s tend to form carbonate scale in pipes and boilers, and they react with soaps to form an undesirable scum.


Attempts to prepare compounds such as calcium bicarbonate by evaporating its solution to dryness invariably yield the solid carbonate instead: Ca(HCO<sub>3</sub>)<sub>2</sub>([[Aqueous solution|aq]]) → CO<sub>2</sub>(g) + H<sub>2</sub>O(l) + [[Calcium carbonate|CaCO<sub>3</sub>]](s). Very few solid bicarbonates other than those of the [[Alkali metal|alkali metals]] and [[ammonium|ammonium ion]] are known to exist.
Attempts to prepare compounds such as solid calcium bicarbonate by evaporating its solution to dryness invariably yield instead the solid [[calcium carbonate]]:<ref>{{cite web |url=http://www.newton.dep.anl.gov/askasci/chem99/chem99492.htm |url-status=dead |archive-url=https://web.archive.org/web/20000929065617/http://www.newton.dep.anl.gov/askasci/chem99/chem99492.htm |archive-date=2000-09-29 |title=Baking Soda}}</ref>
:Ca(HCO<sub>3</sub>)<sub>2</sub>([[Aqueous solution|aq]]) → CO<sub>2</sub>(g) + H<sub>2</sub>O(l) + [[Calcium carbonate|CaCO<sub>3</sub>]](s).
Very few solid bicarbonates other than those of the [[alkali metal]]s (other than [[ammonium bicarbonate]]) are known to exist.{{clarify|reason=meaning is unclear and unsourced|date=June 2020}}


The above reaction is very important to the formation of [[stalactites]], [[stalagmite]]s, columns, and other [[speleothems]] within [[caves]] and, for that matter, in the formation of the caves themselves. As water containing carbon dioxide (including extra CO<sub>2</sub> acquired from soil organisms) passes through limestone or other calcium carbonate containing minerals, it dissolves part of the calcium carbonate and hence becomes richer in bicarbonate. As the groundwater enters the cave, the excess carbon dioxide is released from the solution of the bicarbonate, causing the much less soluble calcium carbonate to be deposited.
The above reaction is very important to the formation of [[stalactites]], [[stalagmite]]s, columns, and other [[speleothems]] within [[caves]], and for that matter, in the formation of the caves themselves. As water containing carbon dioxide (including extra CO<sub>2</sub> acquired from soil organisms) passes through limestone or other calcium carbonate-containing minerals, it dissolves part of the calcium carbonate, hence becomes richer in bicarbonate. As the groundwater enters the cave, the excess carbon dioxide is released from the solution of the bicarbonate, causing the much less soluble calcium carbonate to be deposited.


Dissolved carbon dioxide (CO<sub>2</sub>) in rainwater (H<sub>2</sub>O) reacts with limestone, calcium carbonate (CaCO<sub>3</sub>) to form soluble calcium bicarbonate (Ca(HCO<sub>3</sub>)<sub>2</sub>). This soluble compound is then washed away with the rainwater. This is form of weathering is called 'Carbonation'.
In the reverse process, dissolved carbon dioxide (CO<sub>2</sub>) in rainwater (H<sub>2</sub>O) reacts with [[limestone]] [[calcium carbonate]] (CaCO<sub>3</sub>) to form soluble calcium bicarbonate (Ca(HCO<sub>3</sub>)<sub>2</sub>). This soluble compound is then washed away with the rainwater. This form of weathering is called [[carbonation]] and [[carbonatation]].

In medicine, calcium bicarbonate is sometimes administered intravenously to immediately correct the cardiac depressor effects of [[hyperkalemia]] by increasing calcium concentration in serum, and at the same time, correcting the acid usually present.

== References ==
<references/>


{{Calcium compounds}}
{{Calcium compounds}}
{{Carbonates}}


{{DEFAULTSORT:Calcium Bicarbonate}}
[[Category:Bicarbonates]]
[[Category:Bicarbonates]]
[[Category:Acid salts]]
[[Category:Acid salts]]
[[Category:Calcium compounds]]
[[Category:Calcium compounds]]
[[Category:Hypothetical chemical compounds]]

[[cs:Hydrogenuhličitan vápenatý]]
[[de:Calciumhydrogencarbonat]]
[[fr:Bicarbonate de calcium]]
[[it:Bicarbonato di calcio]]
[[nl:Calciumwaterstofcarbonaat]]
[[ja:炭酸水素カルシウム]]
[[ru:Гидрокарбонат кальция]]
[[sv:Kalciumvätekarbonat]]
[[th:แคลเซียมไบคาร์บอเนต]]
[[zh:碳酸氫鈣]]
[[pl:Wodorowęglan wapnia]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"