Jump to content

Cathine: Difference between revisions

Page 1
Page 2
Content deleted Content added
BogBot (talk | contribs)
populated new fields in {{drugbox}} and reordered per bot trial. Report errors and suggestions to User_talk:BogBot
No edit summary
 
(75 intermediate revisions by 56 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Dablink|Not to be confused with [[caffeine]], a compound found in [[coffee]] and [[tea]].}}
{{Distinguish|Caffeine}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Verifiedfields = changed
| class = {{Plainlist|
| Watchedfields = changed
*[[Appetite suppressant]]
| verifiedrevid = 399710584
*[[CNS stimulant|{{abbr|CNS|Central nervous system}} stimulant]]
}}
| solubility = 20
| verifiedrevid = 446197235
| drug_name = {{sc|D}}-norpseudoephedrine
| type =
| IUPAC_name = (1''S'',2''S'')-2-amino-1-phenylpropan-1-ol
| IUPAC_name = (1''S'',2''S'')-2-amino-1-phenylpropan-1-ol
| image = Pseudonorephedrine.png
| image = Cathine2DCSD.svg
| width = 175px
| width = 150px
| alt =
| image2 = Cathine-3d-CPK.png
| caption =
| image2 = Cathine3DanJ.gif
| width2 = 250px


<!--Clinical data-->
<!--Clinical data-->| tradename =
| tradename =
| MedlinePlus =
| pregnancy_category =
| licence_EU =
| legal_status =
| licence_US =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU = S4
| legal_BR = A3
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-04-04}}</ref>
| legal_CA = Schedule IV
| legal_DE = Rx-only/Anlage III
| legal_US = Schedule IV
| legal_UK = Class C
| legal_UN = P III
| legal_status =
| routes_of_administration = Oral
| routes_of_administration = Oral


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->| bioavailability =
| bioavailability =
| metabolism =
| elimination_half-life = 1.8–8.6 hours<ref>{{cite journal | vauthors = Toennes SW, Harder S, Schramm M, Niess C, Kauert GF | title = Pharmacokinetics of cathinone, cathine and norephedrine after the chewing of khat leaves | journal = British Journal of Clinical Pharmacology | volume = 56 | issue = 1 | pages = 125–30 | date = July 2003 | pmid = 12848785 | pmc = 1884326 | doi = 10.1046/j.1365-2125.2003.01834.x }}</ref>
| metabolism =
| elimination_half-life = 3 hours
| excretion =


<!--Identifiers-->
<!--Identifiers-->| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 492-39-7
| CAS_number = 492-39-7
| ATC_prefix = A08
| ATC_prefix = A08
| ATC_suffix = AA07
| ATC_suffix = AA07
| PubChem = 441457
| PubChem = 441457
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| synonyms = {{Plainlist|
*(+)-norpseudoephedrine
*Cathine
}}
| ChEMBL = 1412041
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01486
| DrugBank = DB01486
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390189
| ChemSpiderID = 390189
| ChEBI = 4109
| UNII_Ref = {{fdacite|changed|FDA}}
| KEGG = D07627
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = E1L4ZW2F8O
| UNII = E1L4ZW2F8O


<!--Chemical data-->
<!--Chemical data-->| C = 9
| C=9 | H=13 | N=1 | O=1
| H = 13
| N = 1
| molecular_weight = 151.206 g/mol
| O = 1
| smiles = O[C@@H](c1ccccc1)[C@@H](N)C
| smiles = O[C@@H](c1ccccc1)[C@@H](N)C
| InChI = 1/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m0/s1
| InChIKey = DLNKOYKMWOXYQA-IONNQARKBB
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m0/s1
| StdInChI = 1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m0/s1
Line 45: Line 72:
}}
}}


'''Cathine''', also known as '''d-norpseudoephedrine''', is a [[psychoactive drug]] of the [[phenethylamine]] and [[amphetamine]] [[chemical class]]es which acts as a [[stimulant]]. Along with [[cathinone]], it is found naturally in ''[[Catha edulis]]'' ([[khat]]), and contributes to its overall effects.
'''{{sc|D}}-norpseudoephedrine''', also known as '''cathine''' and '''(+)-norpseudoephedrine''', is a [[psychoactive drug]] of the [[phenethylamine]] and [[amphetamine]] [[chemical class]]es which acts as a [[stimulant]]. Along with [[cathinone]], it is found naturally in ''[[Catha edulis]]'' (khat), and contributes to its overall effects.<ref name="behav2010">{{cite journal | vauthors = Hoffman R, Al'Absi M | title = Khat use and neurobehavioral functions: suggestions for future studies | journal = Journal of Ethnopharmacology | volume = 132 | issue = 3 | pages = 554–63 | date = December 2010 | pmid = 20553832 | pmc = 2976806 | doi = 10.1016/j.jep.2010.05.033 }}</ref> It has approximately 7-10% the potency of [[amphetamine]].<ref name = behav2010/>


== Pharmacology ==
== Pharmacology ==


Like other [[amphetamine]]s such as cathinone and [[ephedrine]], cathine acts as a [[releasing agent]] of [[norepinephrine]] and [[epinephrine]], or as a [[norepinephrine releasing agent]] (NRA). It also acts as a [[dopamine releasing agent]] (DRA) to a lesser extent.
Like [[amphetamine]]s, cathinone and [[ephedrine]], cathine acts as a [[norepinephrine releasing agent]] (NRA).<ref name = behav2010/> It also acts as a [[dopamine releasing agent]] (DRA).<ref name = behav2010/><ref>{{cite journal | vauthors = Kalyanasundar B, Perez CI, Arroyo B, Moreno MG, Gutierrez R | title = The Appetite Suppressant D-norpseudoephedrine (Cathine) Acts ''via'' D1/D2-Like Dopamine Receptors in the Nucleus Accumbens Shell | journal = Frontiers in Neuroscience | volume = 14 | pages = 572328 | date = 2020-10-16 | pmid = 33177980 | pmc = 7596745 | doi = 10.3389/fnins.2020.572328 | doi-access = free }}</ref>


== Chemistry ==
== Chemistry ==


Cathine is one of the [[optical isomer]]s of [[phenylpropanolamine]] (PPA).
Cathine is one of the four [[Stereoisomerism|stereoisomers]] of [[phenylpropanolamine]] (PPA).


== Regulation ==
== Regulation ==


The [[World Anti-Doping Agency]]'s list of prohibited substances (used for the [[Olympic Games]] among other athletic events) bars cathine in concentrations of over 5 [[microgram]]s per [[milliliter]] in [[urine]]. Cathine is a [[Schedule III]] drug under the [[Convention on Psychotropic Substances]].<ref>[http://www.incb.org/pdf/e/list/green.pdf List of psychotropic substances under international control] (pdf)</ref> In the United States, it is classified as a [[Schedule IV]] [[controlled substance]].
The [[World Anti-Doping Agency]]'s list of prohibited substances (used for the [[Olympic Games]] among other athletic events) bans cathine in concentrations of over 5 [[microgram]]s per [[milliliter]] in [[urine]]. Cathine is a [[Convention on Psychotropic Substances#Schedules of Controlled Substances|Schedule III]] drug under the [[Convention on Psychotropic Substances]].<ref name="List of controlled substances" /> In the United States, it is classified as a Schedule IV [[controlled substance]].<ref>{{cite web | title = Scheduling Actions | url = https://www.deadiversion.usdoj.gov/schedules/orangebook/a_sched_alpha.pdf | work = Diversion Control Division | publisher = U.S. Department Of Justice, Drug Enforcement Administration (DEA) }}</ref>


In Australia, Cathine is officially a [[Standard for the Uniform Scheduling of Medicines and Poisons|schedule 4]] drug prescription only, but is not available or approved for any medical use.
[[Image:Catha edulis.jpg|thumb|left|250px|Cathine is found in shrub ''[[Catha edulis]]''.]]


[[File:Catha edulis.jpg|thumb|250px|left|Cathine is found in the shrub khat (''[[Catha edulis]]'').]]
In [[Hong Kong]], cathine is regulated under Schedule 1 of [[Hong Kong|Hong Kong's]] Chapter 134 ''Dangerous Drugs Ordinance''. It can only be used legally by health professionals and for university research purposes. The substance can be given by pharmacists under a prescription. Anyone who supplies the substance without prescription can be fined $10000 (HKD). The penalty for trafficking or manufacturing the substance is a $5,000,000 ([[Hong Kong dollar|HKD]]) fine and life imprisonment. Possession of the substance for consumption without license from the Department of Health is illegal with a [[Hong Kong dollar|HK$]] 1,000,000 fine and/or 7 years of jail time.

In [[Hong Kong]], cathine is regulated under Schedule 1 of Hong Kong's Chapter 134 ''Dangerous Drugs Ordinance''. Unlawful possession is punishable by severe fines and imprisonment.

== Pregnancy ==
[[Ephedra (medicine)|Ephedra]], found in many ''[[Ephedraceae]]'' species, is a Chinese and Western herb that contains, among other amphetamines, {{sc|D}}-norpseudoephedrine. In the National Birth Defects Prevention Study, which included 18,438 women from 10 states from 1999 to 2003, 1.3% of women reported using ephedra during pregnancy. During the trial, five cases of [[anencephaly]] were born to women who used ephedra, however there was no [[statistically significant]] [[Statistical association|association]] to women not using ephedra ([[odds ratio]] 2.8, [[confidence interval]] 1.0–7.3).<ref>{{cite journal | vauthors = Smid MC, Metz TD, Gordon AJ | title = Stimulant Use in Pregnancy: An Under-recognized Epidemic Among Pregnant Women | journal = Clinical Obstetrics and Gynecology | volume = 62 | issue = 1 | pages = 168–184 | date = March 2019 | pmid = 30601144 | pmc = 6438363 | doi = 10.1097/GRF.0000000000000418 }}</ref>

A small study of 642 participants in Yemen found that among pregnant women who chewed khat (containing {{sc|D}}-norpseudoephedrine) there was no increased risk of [[stillbirth]] or [[Birth defect|congenital malformations]].<ref>{{cite journal | vauthors = Nakajima M, Jebena MG, Taha M, Tesfaye M, Gudina E, Lemieux A, Hoffman R, al'Absi M | display-authors = 6 | title = Correlates of khat use during pregnancy: A cross-sectional study | journal = Addictive Behaviors | volume = 73 | pages = 178–184 | date = October 2017 | pmid = 28531823 | doi = 10.1016/j.addbeh.2017.05.008 }}</ref> Among lactating women who chew khat, {{sc|D}}-norpseudoephedrine is found in [[breastmilk]].<ref>{{cite journal | vauthors = Kristiansson B, Abdul Ghani N, Eriksson M, Garle M, Qirbi A | title = Use of khat in lactating women: a pilot study on breast-milk secretion | journal = Journal of Ethnopharmacology | volume = 21 | issue = 1 | pages = 85–90 | date = September 1987 | pmid = 3695559 | doi = 10.1016/0378-8741(87)90097-3 }}</ref>


== See also ==
== See also ==
* [[L-Norpseudoephedrine|{{sc|L}}-Norpseudoephedrine]], the [[enantiomer]]
* [[Phenylpropanolamine]]
* ''[[Catha edulis|Catha Edulis]]'' ("Khat")
* [[Cathinone]]
* [[Methcathinone]]
* [[Methcathinone]]
* ''[[Ephedra sinica|Ephedra Sinica]]'' ("Ephedra")
* ''[[Ephedra sinica]]'' ("Ephedra")
* [[Ephedrine]]
* [[Ephedrine]]
* [[Pseudoephedrine]]
* [[Pseudoephedrine]]
* [[Phenethylamine]]
* [[Amphetamine]]
* [[Methamphetamine]]
* [[Methamphetamine]]


== References ==
== References ==
{{Reflist|refs=
{{Refimprove|date=December 2007}}
<ref name="List of controlled substances">
{{Reflist|2}}
{{cite web
| url = http://www.incb.org/pdf/e/list/green.pdf
| archive-url = https://web.archive.org/web/20120831222336/http://www.incb.org/pdf/e/list/green.pdf
| archive-date = 2012-08-31
| title = List of psychotropic substances under international control
| work = International Narcotics Control Board
}}</ref>}}


{{Stimulants}}
{{Stimulants}}
{{Decongestants}}
{{Decongestants}}
{{Anorectics}}
{{Anorectics}}
{{Monoamine releasing agents}}
{{Adrenergics}}
{{Dopaminergics}}
{{Phenethylamines}}
{{Phenethylamines}}


[[Category:Alcohols]]
[[Category:Phenylethanolamines]]
[[Category:Amphetamine alkaloids]]
[[Category:Amphetamine alkaloids]]
[[Category:Decongestants]]
[[Category:Decongestants]]
[[Category:Euphoriants]]
[[Category:Euphoriants]]
[[Category:Norepinephrine-dopamine releasing agents]]

[[da:Cathin]]
[[de:Cathin]]
[[fr:Cathine]]
[[hu:Katin]]
[[ja:カチン]]
[[pl:Katyna (alkaloid)]]
[[ru:Катин (соединение)]]
[[fi:Katiini]]
[[sv:Katin]]