Jump to content

Chlormezanone: Difference between revisions

Page 1
Page 2
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').
→‎top: remove extra words
 
(42 intermediate revisions by 27 users not shown)
Line 1: Line 1:
{{Short description|Withdrawn anxiolytic and muscle relaxant}}
{{Redirect|Trancopal|Trancopal Dolo|Flupirtine}}
{{Redirect|Trancopal|Trancopal Dolo|Flupirtine}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 401953477
| verifiedrevid = 460031099
| IUPAC_name = 2-(4-chlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one
| IUPAC_name = 2-(4-chlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one
| image = Chlormezanone.svg
| image = Chlormezanone.svg
| alt = Skeletal formula of chlormezanone

| width = 210
| image2 = Chlormezanone-3D-spacefill.png
| alt2 = Space-filling model of the chlormezanone molecule
| width2 = 170
<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
Line 12: Line 18:
| legal_status = Rx-only
| legal_status = Rx-only
| routes_of_administration = Oral
| routes_of_administration = Oral

<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
Line 18: Line 23:
| elimination_half-life = 40.5 hours
| elimination_half-life = 40.5 hours
| excretion =
| excretion =

<!--Identifiers-->
<!--Identifiers-->
| IUPHAR_ligand = 7323
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 80-77-3
| CAS_number = 80-77-3
Line 32: Line 36:
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = GP568V9G19
| UNII = GP568V9G19
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00268
| KEGG = D00268
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3619
| ChEBI = 3619
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1200714 -->
| ChEMBL = 1200714
<!--Chemical data-->
| C=11 | H=12 | Cl=1 | N=1 | O=3 | S=1
| C=11 | H=12 | Cl=1 | N=1 | O=3 | S=1
| molecular_weight = 273.737 g/mol
| smiles = O=S2(=O)CCC(=O)N(C2c1ccc(Cl)cc1)C
| smiles = O=S1(CCC(N(C)C1C2=CC=C(C=C2)Cl)=O)=O
| InChI = 1/C11H12ClNO3S/c1-13-10(14)6-7-17(15,16)11(13)8-2-4-9(12)5-3-8/h2-5,11H,6-7H2,1H3
| InChIKey = WEQAYVWKMWHEJO-UHFFFAOYAY
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H12ClNO3S/c1-13-10(14)6-7-17(15,16)11(13)8-2-4-9(12)5-3-8/h2-5,11H,6-7H2,1H3
| StdInChI = 1S/C11H12ClNO3S/c1-13-10(14)6-7-17(15,16)11(13)8-2-4-9(12)5-3-8/h2-5,11H,6-7H2,1H3
Line 49: Line 51:
}}
}}


'''Chlormezanone''' (marketed under the [[brandname]] '''Trancopal''') is a [[drug]] used as an [[anxiolytic]] and a [[muscle relaxant]].
'''Chlormezanone''' (marketed under the [[brandname]] '''Trancopal''' or '''Fenaprim''') is a [[drug]] used as an [[anxiolytic]] and a [[muscle relaxant]].<ref>{{cite book | vauthors = Turner P, Volan G, Wiseman H |title=Drugs Handbook |date=1997 |publisher=Palgrave Macmillan |location=UK |isbn=978-1-349-13937-8 | url = https://books.google.com/books?id=0_OxCwAAQBAJ&dq=Chlormezanone+anxiolytic&pg=PA20 | page = 20 }}</ref>


Its use was discontinued in many countries in 1996, due to rare but serious cases of [[toxic epidermal necrolysis]].
Its use was discontinued in many countries in 1996 due to rare but serious cases of [[toxic epidermal necrolysis]].<ref name="Lerch_2018">{{cite journal | vauthors = Lerch M, Mainetti C, Terziroli Beretta-Piccoli B, Harr T | title = Current Perspectives on Stevens-Johnson Syndrome and Toxic Epidermal Necrolysis | journal = Clinical Reviews in Allergy & Immunology | volume = 54 | issue = 1 | pages = 147–176 | date = February 2018 | pmid = 29188475 | doi = 10.1007/s12016-017-8654-z | s2cid = 46796285 }}</ref>

== Synthesis ==
[[File:Synthesis of chlormezanone.svg|thumb|center|400px|Chlormezanone synthesis<ref>{{Cite patent |country=US |number=3082209 | title = 4-metathiazanone derivatives and their preparation |gdate = 1958 | inventor = Surrey AR | assign1 = Sterling Drug Inc.}}</ref><ref>{{Cite journal | vauthors = Surrey AR, Webb WG, Gesler RM | journal = Journal of the American Chemical Society | title = Central Nervous System Depressants. The Preparation of Some 2-Aryl-4-metathiazanones | volume = 80 | issue = 13 | pages = 3469–3471 | year = 1958 | doi = 10.1021/ja01546a065 }}</ref>]]


== Chemistry ==
[[File:Chlormezanone synthesis.png|500px]]
*Sterling Drug Inc., {{Cite patent|US|3082209}} (1958).
*{{Cite doi|10.1021/ja01546a065}}
== References ==
== References ==
{{Reflist}}
* {{cite journal | author = Wollina U, Hipler U, Seeling A, Oelschlager H | title = Investigations of interactions of chlormezanone racemate and its enantiomers on human keratinocytes and human leucoytes in vitro | journal = Skin Pharmacol Physiol | volume = 18 | issue = 3 | pages = 132–138 | year = 2005| pmid = 15897685 | doi = 10.1159/000084910}}
* {{cite journal | author = Seeling A, Oelschläger H, Rothley D | title = Important pharmaceutical-chemical characteristics of the central muscle relaxant chlormezanone | journal = Pharmazie | volume = 55 | issue = 4 | pages = 293–6 | year = 2000 | pmid = 10798243}}
* {{cite journal | author = Oelschläger H, Klinger W, Rothley D, Seeling A, Bockhard H, Hofmann B, Machts H, Riederer H, Rackur H | title = [Cleavage and biotransformation of the central muscle relaxant chlormezanone] | journal = Pharmazie | volume = 53 | issue = 9 | pages = 620–4 | year = 1998 | pmid = 9770210}}
* {{cite journal | author =Gautier V, Vincon G, Demotes-Mainard F, Albin H | title = [Pharmacokinetics of chlormezanone in healthy volunteers] (original in French) | journal = Pharmazie | volume = 45 | issue = 4 | pages = 315–9 | year = 1990| pmid = 2399514}}


== Further reading ==
{{refbegin}}
* {{cite journal | vauthors = Wollina U, Hipler UC, Seeling A, Oelschlager H | title = Investigations of interactions of chlormezanone racemate and its enantiomers on human keratinocytes and human leucoytes in vitro | journal = Skin Pharmacology and Physiology | volume = 18 | issue = 3 | pages = 132–138 | year = 2005 | pmid = 15897685 | doi = 10.1159/000084910 | s2cid = 36642315 }}
* {{cite journal | vauthors = Seeling A, Oelschläger H, Rothley D | title = [Important pharmaceutical-chemical characteristics of the central muscle relaxant chlormezanone] | journal = Die Pharmazie | volume = 55 | issue = 4 | pages = 293–296 | date = April 2000 | pmid = 10798243 }}
* {{cite journal | vauthors = Oelschläger H, Klinger W, Rothley D, Seeling A, Bockhard H, Hofmann B, Machts H, Riederer H, Rackur H | display-authors = 6 | title = [Cleavage and biotransformation of the central muscle relaxant chlormezanone] | journal = Die Pharmazie | volume = 53 | issue = 9 | pages = 620–624 | date = September 1998 | pmid = 9770210 }}
* {{cite journal | vauthors = Gautier V, Vinçon G, Demotes-Mainard F, Albin H | title = [Pharmacokinetics of chlormezanone in healthy volunteers] | journal = Therapie | volume = 45 | issue = 4 | pages = 315–319 | year = 1990 | pmid = 2399514 }}
{{refend}}


{{Anxiolytics}}
{{Anxiolytics}}
{{Muscle relaxants}}
{{Muscle relaxants}}
{{GABAAR PAMs}}


[[Category:Muscle relaxants]]
[[Category:Muscle relaxants]]
[[Category:Sulfones]]
[[Category:Sulfones]]
[[Category:Organochlorides]]
[[Category:Chloroarenes]]
[[Category:Lactams]]
[[Category:Hepatotoxins]]
[[Category:Withdrawn drugs]]
[[Category:Withdrawn drugs]]
[[Category:GABAA receptor positive allosteric modulators]]



{{musculoskeletal-drug-stub}}
{{musculoskeletal-drug-stub}}

[[sv:Klormezanon]]