Jump to content

Clopidol: Difference between revisions

Page 1
Page 2
Content deleted Content added
PotatoBot (talk | contribs)
m Stub sorting and placement of stub template(s): antiinfective-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.
→‎top: update atc
 
(18 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Distinguish|Clopidogrel}}

{{Drugbox
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 443792824
| verifiedrevid = 450844569
| IUPAC_name = 3,5-Dichloro-2,6-dimethyl-pyridin-4-ol
| IUPAC_name = 3,5-Dichloro-2,6-dimethyl-pyridin-4-ol
| image = clopidol.png
| image = clopidol.png
| width = 140
| image2 = Clopidol molecule ball.png
| width2 = 180
| alt2 = Ball-and-stick model of the clopidol molecule


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename = Coyden, Clobek(Animate Animal Health)
| Drugs.com = {{drugs.com|international|clopidol}}
| Drugs.com = {{drugs.com|international|clopidol}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound =
| protein_bound =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 2971-90-6
| CAS_number = 2971-90-6
| ATC_prefix = none
| ATCvet = yes
| ATC_suffix =
| ATC_prefix = P51
| ATC_suffix = BX05
| PubChem = 18087
| PubChem = 18087
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 446918
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8J763HFF5N
| UNII = 8J763HFF5N
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D03559
| KEGG = D03559
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 17084
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C7H7Cl2NO/c1-3-5(8)7(11)6(9)4(2)10-3/h1-2H3,(H,10,11)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = ZDPIZLCVJAAHHR-UHFFFAOYSA-N


<!--Chemical data-->
<!--Chemical data-->
| chemical_formula =
| chemical_formula =
| C=7 | H=7 | Cl=2 | N=1 | O=1
| C=7 | H=7 | Cl=2 | N=1 | O=1
| molecular_weight = 192.04 g/mol
| smiles = CC1=C(Cl)C(O)=C(Cl)C(C)=N1
| smiles = CC1=C(Cl)C(O)=C(Cl)C(C)=N1
}}
}}


'''Clopidol''' is an [[organic compound]] that is used as in [[veterinary medicine]] as a [[coccidiostat]]. It is prepared industrially by a multistep process from [[dehydroacetic acid]].<ref>{{cite book | vauthors = Miller R, Abaecherli C, Said A, Jackson B | chapter = Ketenes | title = Ullmann's Encyclopedia of Industrial Chemistry | date = June 2000 | publisher = Wiley-VCH | location = Weinheim | doi = 10.1002/14356007.a15_063 | isbn = 3527306730 }}</ref>
'''Clopidol''' is a [[coccidiostat]] with the [[chemical formula]] C<sub>7</sub>H<sub>7</sub>Cl<sub>2</sub>NO.


The US [[National Institute for Occupational Safety and Health]] has set a [[recommended exposure limit]] (REL) for clopidol at 10 mg/m<sup>3</sup> TWA (time-weighted average) for total exposure, 5 mg/m<sup>3</sup> TWA for respiratory exposure, and 20 mg/m<sup>3</sup> for short-term exposure. The [[Occupational Safety and Health Administration]] has set a [[permissible exposure limit]] (PEL); the respiratory PEL is the same as the REL, but the total exposure limit is 15 mg/m<sup>3</sup>.<ref>{{Cite web|url = https://www.cdc.gov/niosh/npg/npgd0143.html|title = Clopidol|date = |accessdate = |website = Pocket Guide to Chemical Hazards|publisher = NIOSH|last = |first = }}</ref>


==References==
{{Reflist}}


[[Category:Antiparasitic agents]]
[[Category:Antiparasitic agents]]
[[Category:Pyridines]]
[[Category:Pyridines]]
[[Category:Organochlorides]]
[[Category:Chloroarenes]]
[[Category:Phenols]]
[[Category:Phenols]]