Jump to content

Deoxyguanosine: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: StdInChI StdInChIKey.
 
(32 intermediate revisions by 24 users not shown)
Line 1: Line 1:
{{refimprove|date=January 2016}}
{{Chembox
{{Chembox
| Reference = <ref name="pubchem 2'">{{cite web |url=https://pubchem.ncbi.nlm.nih.gov/compound/2_-deoxyguanosine#section=Top |title=2'-deoxyguanosine |date=24 December 2016 |publisher=National Center for Biotechnology Information |work=PubChem Compound Database |access-date=2 January 2017 |archive-url=https://web.archive.org/web/20170102160635/https://pubchem.ncbi.nlm.nih.gov/compound/2_-deoxyguanosine#section=Top |archive-date=2 January 2017 |url-status=live }}</ref>
⚫
| verifiedrevid = 389077864
| Verifiedfields = changed
|ImageFile=DG chemical structure.png
| Watchedfields = changed
⚫
|ImageSize=150px
⚫
| verifiedrevid = 396326178
⚫
|IUPACName=2-Amino-9-[(2''R'',4''S'',5''R'')-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3''H''-purin-6-one
| ImageFile=Desoxyguanosin.svg
⚫
|OtherNames=
⚫
| ImageSize=170
⚫
|Section1= {{Chembox Identifiers
| ImageAlt = Skeletal formula of deoxyadenosine
⚫
| ChemSpiderID = 163230
| ImageFile1 = Deoxyadenosine-3D-balls.png
| ImageAlt1 = Ball-and-stick model of the deoxyadenosine molecule
⚫
| IUPACName=2-Amino-9-[(2''R'',4''S'',5''R'')-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3''H''-purin-6-one
⚫
| OtherNames=
⚫
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
| ChemSpiderID = 163230
| InChI = 1/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1
| InChI = 1/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1
| InChIKey = YKBGVTZYEHREMT-KVQBGUIXBI
| InChIKey = YKBGVTZYEHREMT-KVQBGUIXBI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1
| StdInChI = 1S/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YKBGVTZYEHREMT-KVQBGUIXSA-N
| StdInChIKey = YKBGVTZYEHREMT-KVQBGUIXSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=961-07-9
| CASNo=961-07-9
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| PubChem=638
| UNII = G9481N71RO
⚫
| SMILES = c1nc2c(n1[C@H]3C[C@@H]([C@H](O3)CO)O)[nH]c(nc2=O)N
⚫
| PubChem=638
⚫
| MeSHName=Deoxyguanosine
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 68908
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 17172
⚫
| SMILES = c1nc2c(n1[C@H]3C[C@@H]([C@H](O3)CO)O)[nH]c(nc2=O)N
⚫
| MeSHName=Deoxyguanosine
}}
}}
|Section2= {{Chembox Properties
|Section2={{Chembox Properties
| C=10 | H=13 | N=5 | O=4
| Formula=C<sub>10</sub>H<sub>13</sub>N<sub>5</sub>O<sub>4</sub>
| Appearance=
| MolarMass=267.24 g/mol
| Appearance=
| Density=
| Density=
| MeltingPt=
| MeltingPt=
| BoilingPt=
| BoilingPt=
| Solubility=
| Solubility=
}}
}}
|Section3= {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards=
| MainHazards=
| FlashPt=
| FlashPt=
| AutoignitionPt =
| Autoignition=
}}
}}
}}
}}


'''Deoxyguanosine''' is composed of the [[purine]] [[nucleoside]] [[guanine]] linked by its N9 nitrogen to the C1 carbon of deoxyribose. It is similar to [[guanosine]], but with one [[hydroxyl group]] removed from the 2' position of the [[ribose]] sugar (making it [[deoxyribose]]). If a phosphate group is attached at the 5' position, it becomes [[deoxyguanosine monophosphate]].
'''Deoxyguanosine''' is composed of the [[purine]] [[nucleobase]] [[guanine]] linked by its N9 nitrogen to the C1 carbon of deoxyribose. It is similar to [[guanosine]], but with one [[hydroxyl group]] removed from the 2' position of the [[ribose]] sugar (making it [[deoxyribose]]). If a phosphate group is attached at the 5' position, it becomes [[deoxyguanosine monophosphate]].

Deoxyguanosine is one of the four [[deoxyribonucleoside]]s that make up [[DNA]].<ref>{{cite web | url = http://www.hmdb.ca/metabolites/HMDB0000085 | title = Human Metabolome Database (HMDB) metabocard for Deoxyguanosine (HMDB0000085) }}</ref>


==See also==
==See also==
* [[8-Oxo-2'-deoxyguanosine]]
* [[8-Oxo-2'-deoxyguanosine]]

==References==
{{Reflist}}


{{Nucleobases, nucleosides, and nucleotides}}
{{Nucleobases, nucleosides, and nucleotides}}
Line 42: Line 62:
[[Category:Nucleosides]]
[[Category:Nucleosides]]
[[Category:Purines]]
[[Category:Purines]]
[[Category:Hydroxymethyl compounds]]



{{Biochemistry-stub}}
{{Biochemistry-stub}}

[[cs:Deoxyguanosin]]
[[es:Desoxiguanosina]]
[[fr:Désoxyguanosine]]
[[it:Deossiguanosina]]
[[ja:デオキシグアノシン]]
[[oc:Desoxiguanosina]]
[[pt:Desoxiguanosina]]
[[sr:Dezoksiguanozin]]
[[ur:Deoxyguanosine]]
[[zh:去氧鳥苷]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"