Diphenylzinc: Difference between revisions

| verifiedrevid = 394158397

| ImageSize =200px

| ImageAlt =

| Section1 = {{Chembox Identifiers

| CASNo = 1078-58-6

| PubChem =

| SMILES = C1([Zn]C2=CC=CC=C2)=CC=CC=C1}}

| Section2 = {{Chembox Properties

| C = 12 | H = 10 | Zn = 1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| Autoignition = }}

'''Diphenylzinc''' is an [[organozinc compound]]. It is commonly used as the synthetic equivalent of a a Ph^&minus; [[synthon]]. Solvent-free diphenylzinc exists as dimeric PhZn(&mu;-Ph)₂ZnPh molecules in solid state.<ref>{{cite journal | last1 = Markies | first1 = Peter R. | last2 = Schat | first2 = Gerrit | last3 = Akkerman | first3 = Otto S. | last4 = Bickelhaupt | first4 = Friedrich | last5 = Smeets | first5 = Wilberth J. J. | last6 = Spek | first6 = Anthony L. | title = Coordinational behavior of solvent-free diorganylzinc compounds: the remarkable x-ray structure of dimeric diphenylzinc | doi = 10.1021/om00158a022 | year = 1990 | pages = 2243 | volume = 9 | journal = [[Organometallics]]}}</ref>

:[[File:diphenylzinc dimer.svg|thumb|left|120px|The dimeric solid state form of diphenylzinc]]{{clear-left}}

volume = 26 | pages = 1764 | year = 1961 | doi = 10.1021/jo01065a017}}</ref>

:2 PhLi + ZnBr₂ &rarr; Ph₂Zn + 2 LiBr

It may also be prepared by the reaction of [[diphenylmercury]] with zinc metal.<ref name = markies>{{cite journal | last1 = Markies | first1 = P | doi = 10.1016/0022-328X(92)80090-K | title = Complexation of diphenylzinc with simple ethers. Crystal structures of the complexes Ph₂Zn·glyme and Ph₂Zn·diglyme | year = 1992 | pages = 1 | volume = 430 | journal = [[J. Organomet. Chem.]]}}</ref>

[[zh:二苯基锌]]