EDANS: Difference between revisions

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443170326

| ImageSize =

| ImageAlt =

| PIN = 5-[(2-Aminoethyl)amino]naphthalene-1-sulfonic acid

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 50402-56-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3JBY896YZF

| PubChem = 92329

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 83355

| SMILES = c1cc2c(cccc2S(=O)(=O)O)c(c1)NCCN

| InChI = 1/C12H14N2O3S/c13-7-8-14-11-5-1-4-10-9(11)3-2-6-12(10)18(15,16)17/h1-6,14H,7-8,13H2,(H,15,16,17)

| InChIKey = SJQRQOKXQKVJGJ-UHFFFAOYAN

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C12H14N2O3S/c13-7-8-14-11-5-1-4-10-9(11)3-2-6-12(10)18(15,16)17/h1-6,14H,7-8,13H2,(H,15,16,17)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = SJQRQOKXQKVJGJ-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| Formula = C₁₂H₁₄N₂O₃S

| MolarMass = 266.32

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

'''EDANS''' (5-((2-Aminoethyl)amino)naphthalene-1-sulfonic acid) is a donor for [[Förster resonance energy transfer|FRET]]-based nucleic acid probes and [[protease]] substrates. EDANS is often paired with DABCYL or DABSYL. The combination can be used in [[enzyme assay]]s. When the two compounds are in close proximity, most of the energy emitted from EDANS will be quenched by DABCYL. However, if the compounds are separated (for example, by substrate cleavage) EDANS will [[fluorescence|fluoresce]], giving an indication of enzyme presence.<ref>{{cite journal|title=Spectral properties of EDANS-Dabcyl pair [45] and the flowchart of the experimental design.|url=https://figshare.com/articles/_Spectral_properties_of_EDANS_Dabcyl_pair_45_and_the_flowchart_of_the_experimental_design_/1255607|first1=Jiubiao |last1=Guo|date=30 November 2014|display-authors=etal|doi=10.1371/journal.pone.0114124.g001|journal=PLOS ONE|volume=9|issue=12|doi-access=free}}</ref>

==See also==

* [[Dark quencher]]

==References==

{{reflist}}

[[Category:Fluorescent dyes]]

{{molecular-biology-stub}}