Jump to content

Enviomycin: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox validation|Chem/Drug
GreenC bot (talk | contribs)
Bots
2,502,799 edits
 
(20 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
⚫
| verifiedrevid = 443977985
⚫
| IUPAC_name = 3,6-diamino-''N''-[(3''R'',6''Z'')-3-(2-amino-3,4,5,6-tetrahydropyrimidin-4-yl)-6-[(carbamoylamino)methylidene]-9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclohexadec-15-yl]-4-hydroxyhexanamide
⚫
| image = Enviomycin.svg

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|enviomycin}}
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category =
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status = Rx-only
⚫
| routes_of_administration = IM

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
⚫
| CAS_number = 33103-22-9
⚫
| ATC_prefix = J04
⚫
| ATC_suffix = AB06
⚫
| ATC_supplemental =
⚫
| PubChem = 3032903
⚫
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
⚫
| DrugBank = DB08993
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = XU299C23A2
| UNII = XU299C23A2
⚫
| verifiedrevid = 437205200
⚫
| IUPAC_name = 3,6-diamino-''N''-[(3''R'',6''Z'')-3-(2-amino-3,4,5,6-tetrahydropyrimidin-4-yl)-6-[(carbamoylamino)methylidene]-9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclohexadec-15-yl]-4-hydroxyhexanamide
⚫
| image = Enviomycin.svg
⚫
| CAS_number = 33103-22-9
| CAS_supplemental =
⚫
| ATC_prefix = none
⚫
| ATC_suffix =
⚫
| ATC_supplemental =
⚫
| PubChem = 3032903
⚫
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07897
| KEGG = D07897
| ChEMBL_Ref = {{ebicite|changed|EBI}}
⚫
| chemical_formula =
| ChEMBL = 2146142
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 16736480
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C25H43N13O10/c26-3-1-16(41)10(27)5-17(42)33-12-6-31-23(47)18(11-2-4-30-24(28)37-11)38-20(44)13(7-32-25(29)48)34-21(45)14(8-39)36-22(46)15(9-40)35-19(12)43/h7,10-12,14-16,18,39-41H,1-6,8-9,26-27H2,(H,31,47)(H,33,42)(H,34,45)(H,35,43)(H,36,46)(H,38,44)(H3,28,30,37)(H3,29,32,48)/b13-7-/t10-,11-,12+,14+,15+,16-,18+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = HPWIIERXAFODPP-GHBBWTPBSA-N

<!--Chemical data-->
⚫
| chemical_formula =
| C=25 | H=43 | N=13 | O=10
| C=25 | H=43 | N=13 | O=10
⚫
| smiles = C1CN=C(NC1C2C(=O)NCC(C(=O)NC(C(=O)NC(C(=O)NC(=CNC(=O)N)C(=O)N2)CO)CO)NC(=O)CC(C(CCN)O)N)N
| molecular_weight = 685.69 g/mol
⚫
| smiles = C1CN=C(NC1C2C(=O)NCC(C(=O)NC(C(=O)NC(C(=O)NC(=CNC(=O)N)C(=O)N2)CO)CO)NC
(=O)CC(C(CCN)O)N)N
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category=
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status = Rx-only
⚫
| routes_of_administration = IM
}}
}}


'''Enviomycin''' ([[International Nonproprietary Name|INN]], also called '''tuberactinomycin N''') is an [[antibiotic]] drug, isolated from ''Streptomyces griseoverticillatus'' var. ''tuberacticus''.<ref>[http://www.google.com/patents?id=FWMvAAAAEBAJ&dq=3892732 Jinnosuke Abe et al. Antibiotic Tuberactinomycin-N and process for production thereof. US patent 3892732]</ref> It is used in the treatment of [[tuberculosis]].<ref>{{cite journal | last1 = Selvakumar | first1 = N | last2 = Kumar | first2 = V | last3 = Acharyulu | first3 = GS | last4 = Rehman | first4 = F | last5 = Paramasivan | first5 = CN | last6 = Prabhakar | first6 = R | title = Susceptibility of south Indian strains of Mycobacterium tuberculosis to tuberactinomycin | journal = The Indian journal of medical research | volume = 95 | pages = 101–4 | year = 1992 | pmid = 1506058 }}</ref>
'''Enviomycin''' ([[International Nonproprietary Name|INN]], also called '''tuberactinomycin N''') is an [[antibiotic]] drug, isolated from ''[[Streptomyces griseoverticillatus]]'' var. ''tuberacticus''.<ref>[https://patents.google.com/patent/US3892732 Jinnosuke Abe et al. Antibiotic Tuberactinomycin-N and process for production thereof. US patent 3892732]</ref> It is used in the treatment of [[tuberculosis]].<ref>{{cite journal | vauthors = Selvakumar N, Kumar V, Acharyulu GS, Rehman F, Paramasivan CN, Prabhakar R | title = Susceptibility of south Indian strains of Mycobacterium tuberculosis to tuberactinomycin | journal = The Indian Journal of Medical Research | volume = 95 | pages = 101–4 | date = May 1992 | pmid = 1506058 }}</ref>


==References==
== References ==
{{reflist}}
<references/>


{{Antimycobacterials}}
[[Category:Antibiotics]]


[[Category:Polypeptide antibiotics]]


{{pharma-stub}}
{{antiinfective-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"