Etofamide: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox validation|Chem/Drugbox validation
recategorized from Nitrobenzenes to Nitrobenzene derivatives
 
(12 intermediate revisions by 11 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
⚫
| verifiedrevid = 444548303
⚫
| UNII_Ref = {{fdacite|changed|FDA}}
⚫
| IUPAC_name = 2,2-dichloro-''N''-(2-ethoxyethyl)-''N''- [4-(4-nitrophenoxy)benzyl]acetamide
⚫
| UNII = 03F36JH21U
⚫
| image = Etofamide.svg
⚫
| verifiedrevid = 406048674

⚫
| IUPAC_name = 2,2-dichloro-''N''-(2-ethoxyethyl)-''N''- [4-(4-nitrophenoxy)benzyl]acetamide
<!--Clinical data-->
⚫
| image = Etofamide.svg
| tradename =
⚫
| CAS_number = 25287-60-9
| Drugs.com = {{drugs.com|international|etofamide}}
| CAS_supplemental =
| ATC_prefix = P01
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| ATC_suffix = AC03
| ATC_supplemental =
| pregnancy_category =
⚫
| legal_status = Rx-only
⚫
| PubChem = 65718
⚫
| routes_of_administration = Oral

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
⚫
| CAS_number = 25287-60-9
| ATC_prefix = P01
⚫
| ATC_suffix = AC03
| ATC_supplemental =
⚫
| PubChem = 65718
| ChEMBL = 1788393
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| UNII = 03F36JH21U
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07355
| KEGG = D07355
| ChemSpiderID = 59142

<!--Chemical data-->
| C=19 | H=20 | Cl=2 | N=2 | O=5
| C=19 | H=20 | Cl=2 | N=2 | O=5
| smiles = CCOCCN(CC1=CC=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-])C(=O)C(Cl)Cl
| molecular_weight = 427.27 g/mol
| StdInChI = 1S/C19H20Cl2N2O5/c1-2-27-12-11-22(19(24)18(20)21)13-14-3-7-16(8-4-14)28-17-9-5-15(6-10-17)23(25)26/h3-10,18H,2,11-13H2,1H3
⚫
| bioavailability =
| StdInChIKey = QTRALMGDQMIVFF-UHFFFAOYSA-N
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
⚫
| legal_status = Rx-only
⚫
| routes_of_administration = Oral
}}
}}
'''Etofamide''' ([[International Nonproprietary Name|INN]], also known as '''eticlordifene''') is an [[antiprotozoal agent|antiprotozoal drug]] used in the treatment of [[amoebiasis]].
'''Etofamide''' ([[International Nonproprietary Name|INN]], also known as '''eticlordifene''') is an [[antiprotozoal agent|antiprotozoal drug]] used in the treatment of [[amoebiasis]].


Its effect against ''[[Giardia lamblia]]'' has been described as modest.<ref name="pmid1518040">{{cite journal |author=Cedillo-Rivera R, Muñoz O |title=In-vitro susceptibility of Giardia lamblia to albendazole, mebendazole and other chemotherapeutic agents |journal=J. Med. Microbiol. |volume=37 |issue=3 |pages=221–4 |year=1992 |month=September |pmid=1518040 |doi= 10.1099/00222615-37-3-221|url=}}</ref>
Its effect against ''[[Giardia lamblia]]'' has been described as modest.<ref name="pmid1518040">{{cite journal | vauthors = Cedillo-Rivera R, Muñoz O | title = In-vitro susceptibility of Giardia lamblia to albendazole, mebendazole and other chemotherapeutic agents | journal = Journal of Medical Microbiology | volume = 37 | issue = 3 | pages = 221–4 | date = September 1992 | pmid = 1518040 | doi = 10.1099/00222615-37-3-221 | doi-access = free }}</ref>


==References==
== References ==
{{reflist}}
{{reflist}}


Line 39: Line 53:


[[Category:Antiprotozoal agents]]
[[Category:Antiprotozoal agents]]
[[Category:Nitrobenzenes]]
[[Category:Nitrobenzene derivatives]]
[[Category:Organochlorides]]
[[Category:Organochlorides]]
[[Category:Phenol ethers]]
[[Category:Phenol ethers]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"