Fluorocitric acid: Difference between revisions

| verifiedrevid = 445847233

| OtherNames = 1-Fluoro-2-hydroxypropane-1,2,3-tricarboxylic acid

| Section1 = {{Chembox Identifiers

| CASNo = 357-89-1

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 107647

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| SMILES = O=C(O)C(O)(CC(=O)O)C(F)C(=O)O

| InChI = 1/C6H7FO7/c7-3(4(10)11)6(14,5(12)13)1-2(8)9/h3,14H,1H2,(H,8,9)(H,10,11)(H,12,13)

| InChIKey = DGXLYHAWEBCTRU-UHFFFAOYAE

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

}}

| Section2 = {{Chembox Properties

| C=6|H=7|F=1|O=7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| Autoignition =

}}

'''Fluorocitric acid''' is a [[Fluorine|fluorinated]] [[carboxylic acid]] derived from [[citric acid]] by [[Substituent|substitution]] of one [[hydrogen]] by a fluorine [[atom]]. The appropriate [[anion]] is called '''fluorocitrate'''. It is a [[metabolite]] of [[fluoroacetic acid]] and is very [[toxic]] because it is not processable using [[aconitase]] in the [[citrate cycle]] (where fluorocitrate takes place of [[citrate]] as the [[Substrate (biochemistry)|substrate]]). The [[enzyme]] is [[Inhibition|inhibited]] and the cycle stops working.<ref>{{cite book|last=Horák|first=J.|last2=Linhart|first2=I.|last3=Klusoň|first3=P.|title=Úvod do toxikologie a ekologie pro chemiky|edition=1st|publisher=VŠCHT v Praze|location=Prague|year=2004|isbn=807080548X|language=Czech}}</ref>

<references />

{{organic-compound-stub}}

[[cs:Kyselina fluorcitronová]]