Formiminoglutamic acid: Difference between revisions

| Verifiedfields = changed

| verifiedrevid = 436877363

| ImageFile=Formiminoglutamic acid.svg

| ImageSize=

| IUPACName= ''N''-(aminomethylidene)-<small>L</small>-glutamic acid

| OtherNames=FIGLU

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=816-90-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = YV703N7VOG

| PubChem=909

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 388370

| SMILES=C(CC(=O)O)C(C(=O)O)N=CN

| MeSHName=Formiminoglutamic+acid

|Section2={{Chembox Properties

| C=6 | H=10 | N=2 | O=4

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

'''Formiminoglutamic acid''' ('''FIGLU'''; [[conjugate acid|conjugate base]], '''formiminoglutamate''') is an intermediate in the [[catabolic|catabolism]] of [[histidine|L-histidine]] to [[glutamic acid|L-glutamic acid]]. It thus is also a [[biomarker]] for [[intracellular]] levels of [[folate]]. The FIGLU test is used to identify [[vitamin B12 deficiency|vitamin B₁₂ deficiency]], [[folate deficiency]], and [[liver failure]] or [[liver disease]].<ref>{{Cite book | doi=10.1007/978-94-009-1846-7_31|chapter = Formiminoglutamic Acid (FIGLU) Test|title = Diagnostic Function Tests in Chemical Pathology| pages=59–60|year = 1989|last1 = Lascelles|first1 = P. T.| last2=Donaldson| first2=D.| isbn=978-0-7462-0107-7}}</ref><ref>{{MeshName|FIGLU+Test}}</ref> It is elevated with folate trapping, where it is accompanied by decreased [[methylmalonic acid]], increased folate and a decrease in [[homocysteine]].<ref>{{cite journal |last1=Scott |first1=JohnM. |last2=Weir |first2=DonaldG. |title=THE METHYL FOLATE TRAP: A physiological response in man to prevent methyl group deficiency in kwashiorkor (methionine deficiency) and an explanation for folic-acid-induced exacerbation of subacute combined degeneration in pernicious anaemia |journal=The Lancet |date=15 August 1981 |volume=318 |issue=8242 |pages=337–340 |doi=10.1016/S0140-6736(81)90650-4 |pmid=6115113 |s2cid=29977127 |issn=0140-6736}}</ref>

* [[Glutamate-1-semialdehyde]]

* [[Imidazol-4-one-5-propionic acid]]

==References==

{{reflist}}

[[Category:Amidines]]

[[Category:Amino acid derivatives]]

[[Category:Glutamic acids]]

{{biochem-stub}}

{{Base-stub}}