GW-405,833: Difference between revisions
Appearance
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation ( |
Michael7604 (talk | contribs) recategorized from Chlorobenzenes to Chlorobenzene derivatives |
||
(31 intermediate revisions by 21 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
⚫ | |||
{{Drugbox |
|||
| |
|||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
⚫ | |||
| image = GW-405,833-2D-skeletal.svg |
| image = GW-405,833-2D-skeletal.svg |
||
| width = 240px |
| width = 240px |
||
<!--Clinical data--> |
|||
⚫ | |||
| tradename = |
|||
| ATC_prefix= |
|||
⚫ | |||
| ATC_suffix= |
|||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
| DrugBank= |
|||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
| index_label = |
|||
| index2_label = |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
⚫ | |||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 85K154W99L |
|||
⚫ | |||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 73711 |
|||
| ChemSpiderID = 8087114 |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| smiles = CC1=C(C2=C(N1C(=O)C3=C(C(=CC=C3)Cl)Cl)C=CC(=C2)OC)CCN4CCOCC4 |
|||
⚫ | |||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C23H24Cl2N2O3/c1-15-17(8-9-26-10-12-30-13-11-26)19-14-16(29-2)6-7-21(19)27(15)23(28)18-4-3-5-20(24)22(18)25/h3-7,14H,8-13H2,1-2H3 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = FSFZRNZSZYDVLI-UHFFFAOYSA-N |
|||
<!--Chemical data--> |
|||
| C=23 | H=24 | Cl=2 | N=2 | O=3 |
| C=23 | H=24 | Cl=2 | N=2 | O=3 |
||
| molecular_weight = 447.353 g/mol |
|||
⚫ | |||
| bioavailability= |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| pregnancy_category = |
|||
⚫ | |||
⚫ | |||
}} |
}} |
||
'''GW-405,833''' ('''L-768,242''') is a drug |
'''GW-405,833''' ('''L-768,242''') is a drug that acts as a potent and selective [[partial agonist]] for the [[cannabinoid receptor]] subtype [[Cannabinoid receptor type 2|CB<sub>2</sub>]], with an [[EC50|EC<sub>50</sub>]] of 0.65 nM and selectivity of around 1200x for CB<sub>2</sub> over [[Cannabinoid receptor type 1|CB<sub>1</sub>]] receptors.<ref>{{cite journal | vauthors = Huffman JW | title = The search for selective ligands for the CB2 receptor | journal = Current Pharmaceutical Design | volume = 6 | issue = 13 | pages = 1323–37 | date = September 2000 | pmid = 10903395 | doi = 10.2174/1381612003399347 }}</ref><ref>{{cite journal | vauthors = Marriott KS, Huffman JW | title = Recent advances in the development of selective ligands for the cannabinoid CB(2) receptor | journal = Current Topics in Medicinal Chemistry | year = 2008 | volume = 8 | issue = 3 | pages = 187–204 | pmid = 18289088 | doi = 10.2174/156802608783498014 }}</ref> Animal studies have shown it to possess [[antiinflammatory]] and anti-[[hyperalgesia|hyperalgesic]] effects at low doses, followed by [[ataxia]] and [[analgesic]] effects when the dose is increased.<ref>{{cite journal | vauthors = Clayton N, Marshall FH, Bountra C, O'Shaughnessy CT | title = CB1 and CB2 cannabinoid receptors are implicated in inflammatory pain | journal = Pain | volume = 96 | issue = 3 | pages = 253–60 | date = April 2002 | pmid = 11972997 | doi = 10.1016/s0304-3959(01)00454-7 | s2cid = 24816928 }}</ref><ref>{{cite journal | vauthors = Valenzano KJ, Tafesse L, Lee G, Harrison JE, Boulet JM, Gottshall SL, Mark L, Pearson MS, Miller W, Shan S, Rabadi L, Rotshteyn Y, Chaffer SM, Turchin PI, Elsemore DA, Toth M, Koetzner L, Whiteside GT | display-authors = 6 | title = Pharmacological and pharmacokinetic characterization of the cannabinoid receptor 2 agonist, GW405833, utilizing rodent models of acute and chronic pain, anxiety, ataxia and catalepsy | journal = Neuropharmacology | volume = 48 | issue = 5 | pages = 658–72 | date = April 2005 | pmid = 15814101 | doi = 10.1016/j.neuropharm.2004.12.008 | s2cid = 10121434 }}</ref> Selective CB<sub>2</sub> agonist drugs such as GW-405,833 are hoped to be particularly useful in the treatment of [[allodynia]] and [[neuropathic pain]] for which current treatment options are often inadequate.<ref>{{cite journal | vauthors = Beltramo M, Bernardini N, Bertorelli R, Campanella M, Nicolussi E, Fredduzzi S, Reggiani A | title = CB2 receptor-mediated antihyperalgesia: possible direct involvement of neural mechanisms | journal = The European Journal of Neuroscience | volume = 23 | issue = 6 | pages = 1530–8 | date = March 2006 | pmid = 16553616 | doi = 10.1111/j.1460-9568.2006.04684.x | s2cid = 19266396 }}</ref><ref>{{cite journal | vauthors = Leichsenring A, Andriske M, Bäcker I, Stichel CC, Lübbert H | title = Analgesic and antiinflammatory effects of cannabinoid receptor agonists in a rat model of neuropathic pain | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 379 | issue = 6 | pages = 627–36 | date = June 2009 | pmid = 19152053 | doi = 10.1007/s00210-008-0386-4 | s2cid = 25085194 }}</ref> |
||
==References== |
== References == |
||
{{reflist}} |
|||
<references/> |
|||
{{Cannabinoids}} |
{{Cannabinoids}} |
||
Line 32: | Line 48: | ||
[[Category:Aminoalkylindoles]] |
[[Category:Aminoalkylindoles]] |
||
[[Category:Benzoylindoles]] |
[[Category:Benzoylindoles]] |
||
[[Category: |
[[Category:4-Morpholinyl compounds]] |
||
[[Category:Phenol ethers]] |
[[Category:Phenol ethers]] |
||
[[Category: |
[[Category:Chlorobenzene derivatives]] |
||
[[Category:CB2 receptor agonists]] |