Galactitol: Difference between revisions

(24 intermediate revisions by 19 users not shown)

Line 1:

{{chembox

| Verifiedfields = changed

⚫

| verifiedrevid = ~~443830856~~

| Watchedfields = changed

⚫

|ImageFile=Dulcitol.svg

⚫

| verifiedrevid = 443831933

⚫

|ImageSize=

⚫

| ImageFile=Dulcitol.svg

⚫

|~~IUPACName~~=(2''R'',3''S'',4''R'',5''S'')-hexane-1,2,3,4,5,6-hexol

|~~OtherNames~~= ~~~~D~~~~-Galactitol~~; Dulcitol~~

| ImageFile2=D-Galactitol.png

⚫

| ImageSize=

⚫

|Section1= {{Chembox Identifiers

| IUPACName=D-Galactitol

⚫

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

⚫

|SystematicName=(2''R'',3''S'',4''R'',5''S'')-hexane-1,2,3,4,5,6-hexol

| OtherNames=Dulcitol

⚫

|Section1={{Chembox Identifiers

⚫

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 11357

| InChI = 1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6-

Line 16:

Line 20:

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=608-66-2

⚫

| UNII_Ref = {{fdacite|correct|FDA}}

⚫

| PubChem=11850

| UNII = 113ZQ1Y7DD

⚫

| ~~ChEBI_Ref~~ = {{~~ebicite~~|correct|~~EBI~~}}

⚫

| PubChem=11850

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1773904

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 16813

| SMILES = O[C@H]([C@@H](O)CO)[C@@H](O)[C@H](O)CO

}}

|Section2= {{Chembox Properties

|Section2={{Chembox Properties

|C=6|H=14|O=6

| C=6 | H=14 | O=6

| MolarMass=182.172 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

| MagSus = -112.40·10−6 cm3/mol

}}

|Section3= {{Chembox Hazards

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

| Autoignition=

}}

'''Galactitol''' ('''dulcitol''') is a [[sugar alcohol]], the [[redox|reduction]] product of [[galactose]].<ref name=pubchem>{{cite web|url=~~http~~://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11850|title=Galactitol - Compound Summary |publisher=[[National Center for Biotechnology Information]]|~~accessdate~~=2008-08-06}}</ref> In people with [[galactokinase deficiency]], a form of [[galactosemia]], excess dulcitol forms in the [[lens (anatomy)|lens]] of the eye leading to [[cataract]]s.<ref name=eMedicine>{{cite web |url = http://www.emedicine.com/ped/TOPIC815.HTM |title = Galactokinase Deficiency |~~accessdate~~ = 2008-08-08 |author = Roth, KS |date = September 10, 2007 |work = [[eMedicine]] |publisher = [[WebMD]]}}</ref>

'''Galactitol''' ('''dulcitol''') is a [[sugar alcohol]], the [[redox|reduction]] product of [[galactose]].<ref name=pubchem>{{cite web|url=https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11850|title=Galactitol - Compound Summary |publisher=[[National Center for Biotechnology Information]]|access-date=2008-08-06}}</ref> It has a slightly sweet taste.<ref name=pubchem/> In people with [[galactokinase deficiency]], a form of [[galactosemia]], excess dulcitol forms in the [[lens (anatomy)|lens]] of the eye leading to [[cataract]]s.<ref name=eMedicine>{{cite web |url = http://www.emedicine.com/ped/TOPIC815.HTM |title = Galactokinase Deficiency |access-date = 2008-08-08 |author = Roth, KS |date = September 10, 2007 |work = [[eMedicine]] |publisher = [[WebMD]]}}</ref>

Galactitol is produced from [[galactose]] in a reaction catalyzed by [[aldose reductase]]~~. Galactose itself comes from the metabolism of the disaccharide [[lactose]] into [[glucose]] and galactose~~.

Galactitol is produced from [[galactose]] in a reaction catalyzed by [[aldose reductase]].

The other common galactose metabolism defect is a defect in [[galactose-1-phosphate uridylyltransferase]], an [[autosomal recessive disorder]], which also causes a buildup of galactitol as a result of increased concentrations of galactose-1-phosphate and galactose. ~~The~~ ~~toxicity~~ ~~associated with [[galactose-1-phosphate uridylyltransferase]] deficiency is associated with symptoms of [[hepatosplenomegaly]] and [[mental retardation]] in addition~~ to ~~the~~ cataracts caused by galactitol buildup.

The other common galactose metabolism defect is a defect in [[galactose-1-phosphate uridylyltransferase]], an [[autosomal recessive disorder]], which also causes a buildup of galactitol as a result of increased concentrations of galactose-1-phosphate and galactose. This disorder leads to cataracts caused by galactitol buildup.

==References==

==External links==

⚫

[[Category:Sugar alcohols]]

*{{Commonscatinline}}

⚫

[[Category:Sugar alcohols]]

[[de:Galaktit]]

[[Category:Sugar substitutes]]

[[es:Dulcitol]]

[[fr:Dulcitol]]

[[ja:ガラクチトール]]