Glutaryl-CoA: Difference between revisions
Appearance
Content deleted Content added
m r2.7.1) (robot Adding: fr:Glutaryl-coenzyme A |
- made up info |
||
(14 intermediate revisions by 10 users not shown) | |||
Line 1: | Line 1: | ||
{{refimprove|date=January 2017}} |
|||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
|IUPACName= |
|||
⚫ | |||
⚫ | |||
| IUPACName=5-[(2-<nowiki/>{3-[(2''R'')-4-{[1,3-Dihydroxy-1,3-dioxo-3-(3′-''O''-phosphonoadenosin-5′-''O''-yl)-1λ<sup>5</sup>,3λ<sup>5</sup>-diphosphoxan-1-yl]oxy}-3,3-dimethylbutanamido]propanamido}ethyl)sulfanyl]-5-oxopentanoic acid |
|||
⚫ | |||
| SystematicName=(9''R'')-1-[(2''R'',3''S'',4''R'',5''R'')-5-(6-Amino-9''H''-purin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]-3,5,9-trihydroxy-8,8-dimethyl-3,5,10,14,19-pentaoxo-2,4,6-trioxa-18-thia-11,15-diaza-3λ<sup>5</sup>,5λ<sup>5</sup>-diphosphatricosan-23-oic acid |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| SMILES= |
|||
| CASNo_Ref = {{cascite|correct|??}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 2338999 |
|||
| SMILES = O=C(O)CCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3OP(=O)(O)O |
|||
| InChI = 1/C26H42N7O19P3S/c1-26(2,21(39)24(40)29-7-6-15(34)28-8-9-56-17(37)5-3-4-16(35)36)11-49-55(46,47)52-54(44,45)48-10-14-20(51-53(41,42)43)19(38)25(50-14)33-13-32-18-22(27)30-12-31-23(18)33/h12-14,19-21,25,38-39H,3-11H2,1-2H3,(H,28,34)(H,29,40)(H,35,36)(H,44,45)(H,46,47)(H2,27,30,31)(H2,41,42,43)/t14-,19-,20-,21+,25-/m1/s1 |
|||
| InChIKey = SYKWLIJQEHRDNH-CKRMAKSABC |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C26H42N7O19P3S/c1-26(2,21(39)24(40)29-7-6-15(34)28-8-9-56-17(37)5-3-4-16(35)36)11-49-55(46,47)52-54(44,45)48-10-14-20(51-53(41,42)43)19(38)25(50-14)33-13-32-18-22(27)30-12-31-23(18)33/h12-14,19-21,25,38-39H,3-11H2,1-2H3,(H,28,34)(H,29,40)(H,35,36)(H,44,45)(H,46,47)(H2,27,30,31)(H2,41,42,43)/t14-,19-,20-,21+,25-/m1/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = SYKWLIJQEHRDNH-CKRMAKSASA-N |
|||
⚫ | |||
}} |
}} |
||
|Section2= |
|Section2={{Chembox Properties |
||
| |
| Formula=C<sub>26</sub>H<sub>42</sub>N<sub>7</sub>O<sub>19</sub>P<sub>3</sub>S |
||
| |
| MolarMass=881.635 g/mol |
||
| |
| Appearance= |
||
| |
| Density= |
||
| |
| MeltingPt= |
||
| |
| BoilingPt= |
||
| |
| Solubility= |
||
}} |
}} |
||
|Section3= |
|Section3={{Chembox Hazards |
||
| |
| MainHazards= |
||
| |
| FlashPt= |
||
| AutoignitionPt = |
|||
| Autoignition= |
|||
}} |
}} |
||
}} |
}} |
||
'''Glutaryl-coenzyme A''' is an intermediate in the metabolism of [[lysine]] and [[tryptophan]]. |
|||
'''Glutaryl-coenzyme A''' is an intermediate in the metabolism of [[lysine]] and [[tryptophan]].<ref name="pmid17176108">{{cite journal | vauthors = Rao KS, Albro M, Dwyer TM, Frerman FE | title = Kinetic mechanism of glutaryl-CoA dehydrogenase | journal = Biochemistry | volume = 45 | issue = 51 | pages = 15853–61 | date = Dec 2006 | pmid = 17176108 | doi = 10.1021/bi0609016 }}</ref> |
|||
==See also== |
==See also== |
||
* [[Glutaryl-CoA dehydrogenase]] |
* [[Glutaryl-CoA dehydrogenase]] |
||
==References== |
|||
⚫ | |||
{{reflist}} |
|||
[[Category:Coenzymes]] |
|||
{{biochem-stub}} |
{{biochem-stub}} |
||
⚫ | |||
⚫ | |||
[[ja:グルタリルCoA]] |
|||
⚫ |