ICRF 193: Difference between revisions

(11 intermediate revisions by 10 users not shown)

Line 1:

{{chembox

| verifiedrevid = ~~400113711~~

| verifiedrevid = 415659765

|ImageFile=ICRF 193.png

| ImageFile=ICRF 193.png

|ImageSize=200px

| ImageSize=200px

|IUPACName=4-[2-(3,5-Dioxo-1-piperazinyl)-1-methylpropyl]piperazine-2,6-dione

| IUPACName=4-[2-(3,5-Dioxo-1-piperazinyl)-1-methylpropyl]piperazine-2,6-dione

|OtherNames=

| OtherNames=

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 103034

| InChI = 1/C12H18N4O4/c1-7(15-3-9(17)13-10(18)4-15)8(2)16-5-11(19)14-12(20)6-16/h7-8H,3-6H2,1-2H3,(H,13,17,18)(H,14,19,20)

| InChIKey = OBYGAPWKTPDTAS-UHFFFAOYAB

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 275665

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

Line 15:

Line 16:

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OBYGAPWKTPDTAS-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=21416-68-2

| PubChem=115150

| SMILES = O=C2NC(=O)CN(C(C(N1CC(=O)NC(=O)C1)C)C)C2

| MeSHName=ICRF+193

}}

|Section2={{Chembox Properties

| Formula=C12H18N4O4

| MolarMass=282.30 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

| Autoignition=

}}

'''ICRF 193''' is a [[topoisomerase inhibitor]].<ref name="pmid17495539">{{cite journal |~~author~~=Robinson HM, Bratlie-Thoresen S, Brown R, Gillespie DA |title=Chk1 is required for G2/M checkpoint response induced by the catalytic topoisomerase II inhibitor ICRF-193 |journal=Cell Cycle |volume=6 |issue=10 |pages=1265–7 |~~year~~=2007 ~~|month=May~~ |pmid=17495539 |doi= |url=http://www.landesbioscience.com/journals/cc/abstract.php?id=4225}}</ref>

'''ICRF 193''' is a [[topoisomerase inhibitor]].<ref name="pmid17495539">{{cite journal |vauthors=Robinson HM, Bratlie-Thoresen S, Brown R, Gillespie DA |title=Chk1 is required for G2/M checkpoint response induced by the catalytic topoisomerase II inhibitor ICRF-193 |journal=Cell Cycle |volume=6 |issue=10 |pages=1265–7 |date=May 2007 |pmid=17495539 |doi= 10.4161/cc.6.10.4225|url=http://www.landesbioscience.com/journals/cc/abstract.php?id=4225|doi-access=free }}</ref>

==References==

Line 42:

Line 44:

[[Category:Imides]]

[[Category:~~Piperazines~~]]

[[Category:Diketopiperazines]]

[[Category:~~Lactams~~]]

[[Category:Topoisomerase inhibitors]]

[[sr:ICRF 193]]