Magnesium lactate: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
+{{cs1 config|name-list-style=vanc}}
 {{Drugbox
-| verifiedrevid = 428790155
+| verifiedrevid = 447933514
 | IUPAC_name = magnesium 2-hydroxypropanoate
 | image = magnesium lactate.png
@@ Line 20: / Line 22: @@
 | bioavailability =
 | protein_bound =
-| metabolism = 256.4 g/mol
+| metabolism =
 | elimination_half-life =
 | excretion =
 <!--Identifiers-->
+| CAS_number_Ref = {{cascite|correct|??}}
 | CAS_number = 18917-93-6
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = MT6QI8324A
 | ATC_prefix = A12
 | ATC_suffix = CC06
-| PubChem = 11969531
+| PubChem = 6536825
 | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 | DrugBank =
+| ChemSpiderID      = 4477551
 <!--Chemical data-->
+| C=6 | H=10 | Mg=1 | O=6
-| chemical_formula = C<sub>6</sub>H<sub>10</sub>MgO<sub>6</sub>
+| smiles            = [Mg+2].[O-]C(=O)C(O)C.[O-]C(=O)C(O)C
+| StdInChI          = 1S/2C3H6O3.Mg/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2
+| StdInChIKey       = OVGXLJDWSLQDRT-UHFFFAOYSA-L
-| molecular_weight = 202.45 g/mol
-}}
+| solubility        = 77.6<ref>{{cite web | url=https://go.drugbank.com/drugs/DB14515 | title=Magnesium lactate | access-date=2024-04-04 | archive-date=2023-12-11 | archive-url=https://web.archive.org/web/20231211014852/https://go.drugbank.com/drugs/DB14515 | url-status=live }}</ref>
-'''Magnesium lactate''', the [[magnesium]] [[salt (chemistry)|salt]] of [[lactic acid]], is a [[Dietary mineral|mineral supplement]].
+| sol_units         = mg/mL
+}}'''Magnesium lactate''', the [[magnesium]] [[salt (chemistry)|salt]] of [[lactic acid]].
-Added to some food and beverages as an acidity regulator and labeled as [[E number|E329]].
+==Mineral supplement==
+Magnesium lactate can be used as a [[Dietary mineral|mineral supplement]] to prevent and treat low amounts of magnesium in the blood.<ref>{{Cite web | url = https://www.webmd.com/drugs/2/drug-11660/magnesium-lactate-oral/details | title = Magnesium Lactate Tablet, Extended Release - Uses, Side Effects, and More | website = [[WebMD]] | access-date = 2023-02-22 | archive-date = 2023-02-22 | archive-url = https://web.archive.org/web/20230222194313/https://www.webmd.com/drugs/2/drug-11660/magnesium-lactate-oral/details | url-status = live }}</ref><ref>{{cite web | url=https://www.drugs.com/mtm/magnesium-lactate.html | title=Magnesium lactate Uses, Side Effects & Warnings | access-date=2024-04-04 | archive-date=2024-01-19 | archive-url=https://web.archive.org/web/20240119022632/https://www.drugs.com/mtm/magnesium-lactate.html | url-status=live }}</ref>
+Magnesium lactate may help treat leg muscle cramps in pregnancy.<ref name="pmid11869565">{{cite journal |vauthors=Young GL, Jewell D |title=Interventions for leg cramps in pregnancy |journal=Cochrane Database Syst Rev |volume= 2015|issue=1 |pages=CD000121 |date=2002 |pmid=11869565 |doi=10.1002/14651858.CD000121|pmc=7045417 }}</ref>
+==Food additive==
+As a [[food additive]], it has the [[E number]] E329 and is used in food and beverages as an [[acidity regulator]].<ref>{{Cite web | url = https://world.openfoodfacts.org/additive/e329-magnesium-lactate | title = E329 - Magnesium lactate | website = openfoodfacts.org | access-date = 2023-02-22 | archive-date = 2023-02-22 | archive-url = https://web.archive.org/web/20230222194311/https://world.openfoodfacts.org/additive/e329-magnesium-lactate | url-status = live }}</ref>
+==References==
+{{reflist}}
 {{Mineral supplements}}
@@ Line 47: / Line 66: @@
 [[Category:Magnesium compounds]]
 [[Category:Lactates]]
 {{gastrointestinal-drug-stub}}